![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1. Mission briefing.mp4 | 2023-10-20 12:00 | 32M | |
| 2. Solution for exercise 1 - Next steps.mp4 | 2023-10-20 12:00 | 70M | |
| 3. Solution for exercise 2 - Pointer into the middle of a structure.mp4 | 2023-10-20 12:00 | 67M | |
| 4. Solution for exercise 3 - Stack frame and stack pointer.mp4 | 2023-10-20 12:00 | 85M | |
| 5. Solution for exercise 4 - Further analysis.mp4 | 2023-10-20 12:00 | 89M | |