![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 1. Introduction (1).mp4 | 2025-09-18 09:26 | 19M | |
| 2. TLOC OMP Route Type.mp4 | 2025-09-18 09:26 | 49M | |
| 3. SDWAN Controller TLOC Advertisement Deep Dive.mp4 | 2025-09-18 09:26 | 51M | |
| 4. Color Restrict via Configuration Group Technet24.mp4 | 2025-09-18 09:26 | 31M | |
| 5. Explore IPsec Tunnels via the Catalyst Manager Packet Capture Feature.mp4 | 2025-09-18 09:26 | 34M | |
| 6. The Impact of Public and Private TLOC Colors on IPsec Tunnel formation.mp4 | 2025-09-18 09:26 | 69M | |
| 7. Secure Data Plane Operations.mp4 | 2025-09-18 09:26 | 38M | |
| 8. TLOC Carrier.mp4 | 2025-09-18 09:26 | 23M | |
| 9. Tunnel Groups.mp4 | 2025-09-18 09:26 | 65M | |
| 10. SDWAN Fabric and NAT.mp4 | 2025-09-18 09:26 | 31M | |
| 11. Bidirectional Forwarding Detection (BFD).mp4 | 2025-09-18 09:26 | 54M | |
| 12. TLOC Extension.mp4 | 2025-09-18 09:26 | 21M | |