![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | Security/ | 2024-12-02 12:00 | - | |
| Programming/ | 2024-12-02 12:00 | - | |
| Networking/ | 2024-12-02 12:00 | - | |
| Hacking/ | 2024-12-02 12:00 | - | |
| Forensics/ | 2024-12-02 12:00 | - | |
| DataBase/ | 2024-12-02 12:00 | - | |
![[ ]](/icons/layout.gif) | x86-64 buffer overflow exploits and the borrowed code chunks exploitation technique.pdf | 2016-07-07 12:00 | 32K | |
| www.dedoimedo.com-apache-web-server-lm.pdf | 2015-09-04 12:00 | 3.4M | |
| webvpn-capture-tool.pdf | 2016-07-07 12:00 | 16K | |
| wake.pdf | 2009-02-03 12:00 | 150K | |
| vvlanref.pdf | 2016-07-07 12:00 | 168K | |
| vpn5k-msias.pdf | 2016-07-07 12:00 | 386K | |
| vol2-lab10.pdf | 2016-07-07 12:00 | 105K | |
| vol2-lab9.pdf | 2016-07-07 12:00 | 121K | |
| vol2-lab8.pdf | 2016-07-07 12:00 | 111K | |
| vol2-lab7.pdf | 2016-07-07 12:00 | 94K | |
| vol2-lab6.pdf | 2016-07-07 12:00 | 88K | |
| vol2-lab5.pdf | 2016-07-07 12:00 | 75K | |
| vol2-lab4.pdf | 2016-07-07 12:00 | 133K | |
| vol2-lab3.pdf | 2016-07-07 12:00 | 95K | |
| vol2-lab2.pdf | 2016-07-07 12:00 | 166K | |
| vol2-lab1.pdf | 2016-07-07 12:00 | 138K | |
| vol1-lab20.pdf | 2016-07-07 12:00 | 49K | |
| vol1-lab19.pdf | 2016-07-07 12:00 | 58K | |
| vol1-lab18.pdf | 2016-07-07 12:00 | 47K | |
| vol1-lab17.pdf | 2016-07-07 12:00 | 64K | |
| vol1-lab16.pdf | 2016-07-07 12:00 | 68K | |
| vol1-lab15.pdf | 2016-07-07 12:00 | 66K | |
| vol1-lab14.pdf | 2016-07-07 12:00 | 76K | |
| vol1-lab13.pdf | 2016-07-07 12:00 | 70K | |
| vol1-lab12.pdf | 2016-07-07 12:00 | 135K | |
| vol1-lab11.pdf | 2016-07-07 12:00 | 92K | |
| vol1-lab10.pdf | 2016-07-07 12:00 | 122K | |
| vol1-lab9.pdf | 2016-07-07 12:00 | 114K | |
| vol1-lab8.pdf | 2016-07-07 12:00 | 129K | |
| vol1-lab7.pdf | 2016-07-07 12:00 | 132K | |
| vol1-lab6.pdf | 2016-07-07 12:00 | 165K | |
| vol1-lab5.pdf | 2016-07-07 12:00 | 178K | |
| vol1-lab4.pdf | 2016-07-07 12:00 | 143K | |
| vol1-lab3.pdf | 2016-07-07 12:00 | 218K | |
| vol1-lab2.pdf | 2016-07-07 12:00 | 180K | |
| vol1-lab1.pdf | 2016-07-07 12:00 | 225K | |
| userg-HTB_Linux_queuing_discipline_manual.pdf | 2015-09-04 12:00 | 214K | |
| usenix00.pdf | 2009-02-03 12:00 | 293K | |
| understanding_ssl.pdf | 2009-02-03 12:00 | 265K | |
| trouble_auth.pdf | 2016-07-07 12:00 | 30K | |
| trapdoor.pdf | 2009-02-03 12:00 | 41K | |
| tivo-hacks.100-industrial-strength-tips-and-tools.pdf | 2014-12-07 12:00 | 8.8M | |
| temporary.pdf | 2016-07-07 12:00 | 15K | |
| swvlan.pdf | 2016-07-07 12:00 | 402K | |
| swqos.pdf | 2016-07-07 12:00 | 609K | |
| svcios.pdf | 2016-07-07 12:00 | 797K | |
| stp.pdf | 2016-07-07 12:00 | 377K | |
| startup.config.pdf | 2016-07-07 12:00 | 7.8K | |
| squid-configuration-manual-30.pdf | 2015-09-04 12:00 | 4.9M | |
| sp-14-Almeida-Hacking-MIFARE-Classic-Cards-Slides.pdf | 2015-05-28 12:00 | 8.8M | |
| skipjack-kea.pdf | 2009-02-03 12:00 | 214K | |
| shi_asap00.pdf | 2009-02-03 12:00 | 63K | |
| secret_key_cryptography.pdf | 2009-02-03 12:00 | 1.1M | |
| sec16_paper_vanhoef.pdf | 2016-08-10 12:00 | 1.5M | |
| sample_vol.4.pdf | 2016-07-07 12:00 | 560K | |
| rp_DBIR_2016_Report_en_xg.pdf | 2017-01-09 12:00 | 2.6M | |
| routing-engine.pdf | 2016-07-07 12:00 | 41K | |
| robustness.pdf | 2009-02-03 12:00 | 123K | |
| refman-5.0-en.pdf | 2015-09-04 12:00 | 12M | |
| radare.pdf | 2016-07-07 12:00 | 281K | |
| queensland.pdf | 2009-02-03 12:00 | 202K | |
| qos-tunnel.pdf | 2016-07-07 12:00 | 21K | |
| qbsc_2004.pdf | 2009-02-03 12:00 | 62K | |
| pvdm3_ds.pdf | 2016-07-07 12:00 | 1.1M | |
| pswdrec_2900xl.pdf | 2016-04-08 12:00 | 46K | |
| prevention-securite.pdf | 2016-07-07 12:00 | 1.2M | |
| preprint_frey.pdf | 2009-02-03 12:00 | 336K | |
| postfix-amavis.pdf | 2015-09-04 12:00 | 35K | |
| pmtud_ipfrag.pdf | 2016-07-07 12:00 | 266K | |
| pkids_ds.pdf | 2016-07-07 12:00 | 52K | |
| pixrn634.pdf | 2016-04-09 12:00 | 407K | |
| pixrn633.pdf | 2016-07-07 12:00 | 340K | |
| pix70-syslog.pdf | 2016-07-07 12:00 | 490K | |
| pix70-nat-pat.pdf | 2016-07-07 12:00 | 249K | |
| pix70-enh-spk-client-vpn.pdf | 2016-07-07 12:00 | 88K | |
| pix70-asa-portredir.pdf | 2016-07-07 12:00 | 450K | |
| pix7x-asa-client-stick.pdf | 2016-07-07 12:00 | 83K | |
| pix-dyntostat-ipsec-nat.pdf | 2016-07-07 12:00 | 37K | |
| pix-dual-isp.pdf | 2016-07-07 12:00 | 363K | |
| pix-3-networks.pdf | 2016-07-07 12:00 | 589K | |
| pitfalls.pdf | 2009-02-03 12:00 | 56K | |
| phnrn82s.pdf | 2016-04-08 12:00 | 306K | |
| phnrn71s2.pdf | 2016-04-08 12:00 | 183K | |
| phnrn70s2.pdf | 2016-04-08 12:00 | 182K | |
| perf.pdf | 2009-02-03 12:00 | 179K | |
| pdminst.pdf | 2016-07-07 12:00 | 186K | |
| paper886.pdf | 2009-02-03 12:00 | 72K | |
| paper885.pdf | 2009-02-03 12:00 | 395K | |
| paper879.pdf | 2009-02-03 12:00 | 245K | |
| paper878.pdf | 2009-02-03 12:00 | 271K | |
| paper874.pdf | 2009-02-03 12:00 | 73K | |
| paper768.pdf | 2009-02-03 12:00 | 60K | |
| paper764.pdf | 2009-02-03 12:00 | 70K | |
| paper751.pdf | 2009-02-03 12:00 | 33K | |
| paper740.pdf | 2009-02-03 12:00 | 40K | |
| paper738.pdf | 2009-02-03 12:00 | 135K | |
| paper737.pdf | 2009-02-03 12:00 | 101K | |
| paper736.pdf | 2009-02-03 12:00 | 38K | |
| paper735.pdf | 2009-02-03 12:00 | 33K | |
| paper732.pdf | 2009-02-03 12:00 | 33K | |
| paper726.pdf | 2009-02-03 12:00 | 46K | |
| paper724.pdf | 2009-02-03 12:00 | 85K | |
| paper723.pdf | 2009-02-03 12:00 | 30K | |
| paper722.pdf | 2009-02-03 12:00 | 34K | |
| paper716.pdf | 2009-02-03 12:00 | 76K | |
| oreilly bash shell(2005).pdf | 2015-09-04 12:00 | 2.1M | |
| openssl-cookbook.pdf | 2016-07-07 12:00 | 1.6M | |
| ont.wlan.security.management.and.qos.1.00.pdf | 2016-07-07 12:00 | 113K | |
| ont.qos.overview.1.00.pdf | 2016-07-07 12:00 | 92K | |
| ont.diffserv.qos.1.00.pdf | 2016-07-07 12:00 | 150K | |
| ont.cisco.voip.overview.1.01.pdf | 2016-07-07 12:00 | 148K | |
| onetime.pdf | 2009-02-03 12:00 | 50K | |
| odyssey.pdf | 2009-02-03 12:00 | 120K | |
| ocf.pdf | 2009-02-03 12:00 | 133K | |
| ocb-full.pdf | 2009-02-03 12:00 | 659K | |
| oakland.pdf | 2009-02-03 12:00 | 263K | |
| ntop_IEEE.pdf | 2016-07-07 12:00 | 98K | |
| new_introduction_crypto.pdf | 2009-02-03 12:00 | 278K | |
| nat_trans.pdf | 2016-07-07 12:00 | 23K | |
| musee.pdf | 2009-02-03 12:00 | 718K | |
| mpls-nanog49.pdf | 2016-07-07 12:00 | 1.5M | |
| more_advanced_sql_injection.pdf | 2016-07-07 12:00 | 32K | |
| modesv2.pdf | 2009-02-03 12:00 | 118K | |
| metasploit_guide.pdf | 2018-01-07 12:00 | 242K | |
| md5_someday.pdf | 2009-02-03 12:00 | 55K | |
| matrices.pdf | 2009-02-03 12:00 | 121K | |
| master_doit_v2_labsample_sc.pdf | 2016-07-07 12:00 | 215K | |
| master_doit_v2_labsample_ak.pdf | 2016-07-07 12:00 | 538K | |
| marco.pdf | 2009-02-03 12:00 | 233K | |
| mac_acl_block_arp.pdf | 2016-07-07 12:00 | 16K | |
| lpe.pdf | 2009-02-03 12:00 | 242K | |
| logiciels_ malveillants.pdf | 2016-07-07 12:00 | 57K | |
| little_black_book_oc_computer_viruses.pdf | 2014-12-07 12:00 | 1.4M | |
| linux-server-hacks.pdf | 2014-12-07 12:00 | 33M | |
| lars_knudsen.pdf | 2009-02-03 12:00 | 301K | |
| lab16.solution.pdf | 2016-07-07 12:00 | 25K | |
| lab15.solution.pdf | 2016-07-07 12:00 | 25K | |
| lab14.solution.pdf | 2016-07-07 12:00 | 26K | |
| lab13.solution.pdf | 2016-07-07 12:00 | 28K | |
| lab12.solution.pdf | 2016-07-07 12:00 | 29K | |
| lab11.solution.pdf | 2016-07-07 12:00 | 25K | |
| lab10.solution.pdf | 2016-07-07 12:00 | 25K | |
| lab9.solution.pdf | 2016-07-07 12:00 | 28K | |
| lab8.solution.pdf | 2016-07-07 12:00 | 29K | |
| lab7.solution.pdf | 2016-07-07 12:00 | 28K | |
| lab6.solution.pdf | 2016-07-07 12:00 | 27K | |
| lab5.solution.pdf | 2016-07-07 12:00 | 28K | |
| lab4.solution.pdf | 2016-07-07 12:00 | 32K | |
| lab3.solution.pdf | 2016-07-07 12:00 | 26K | |
| lab2.solution.pdf | 2016-07-07 12:00 | 27K | |
| lab1.solution.pdf | 2016-07-07 12:00 | 28K | |
| l2tp_mtu_tuning.pdf | 2016-07-07 12:00 | 21K | |
| keyrecovery.pdf | 2009-02-03 12:00 | 169K | |
| key-mngmt-crypto-fs.pdf | 2009-02-03 12:00 | 57K | |
| katmct.pdf | 2009-02-03 12:00 | 98K | |
| iso#8.pdf | 2016-07-07 12:00 | 25K | |
| iso#7.pdf | 2016-07-07 12:00 | 30K | |
| iso#6.pdf | 2016-07-07 12:00 | 278K | |
| iso#5.pdf | 2016-07-07 12:00 | 594K | |
| iso#4.pdf | 2016-07-07 12:00 | 190K | |
| iso#3.pdf | 2016-07-07 12:00 | 40K | |
| iso#2.pdf | 2016-07-07 12:00 | 40K | |
| iscw.network.security.1.00.pdf | 2016-07-07 12:00 | 81K | |
| iscw.mpls.1.00.pdf | 2016-07-07 12:00 | 295K | |
| iscw.ipsec.vpns.1.00.pdf | 2016-07-07 12:00 | 269K | |
| iscw.ios.ips.1.00.pdf | 2016-07-07 12:00 | 94K | |
| iscw.ios.firewall.1.00.pdf | 2016-07-07 12:00 | 135K | |
| iscw.basic.teleworker.services.1.00.pdf | 2016-07-07 12:00 | 88K | |
| ip spoofing.pdf | 2016-07-07 12:00 | 16K | |
| ipsec_debug.pdf | 2016-07-07 12:00 | 54K | |
| ipsec.pdf | 2009-02-03 12:00 | 216K | |
| ipsec-rtr-2-pix-asa.pdf | 2016-07-07 12:00 | 549K | |
| ipsec-pix70-nat.pdf | 2016-07-07 12:00 | 520K | |
| ipmulti.pdf | 2016-07-07 12:00 | 131K | |
| ipmultcasti.pdf | 2016-07-07 12:00 | 131K | |
| ios_pat_ipsec_tunnel.pdf | 2016-07-07 12:00 | 69K | |
| ios#1.pdf | 2016-07-07 12:00 | 12K | |
| internet-modes.pdf | 2009-02-03 12:00 | 62K | |
| injection-sql.pdf | 2016-07-07 12:00 | 16K | |
| inchash.pdf | 2009-02-03 12:00 | 427K | |
| inc2.pdf | 2009-02-03 12:00 | 237K | |
| inc1.pdf | 2009-02-03 12:00 | 259K | |
| ie2003.pdf | 2016-07-07 12:00 | 1.9M | |
| ie.rs.v5.0.hardware.specification.pdf | 2016-07-07 12:00 | 105K | |
| ie.rs.v4.10.hardware.specification.pdf | 2016-07-07 12:00 | 151K | |
| hzv-ezine_03.pdf | 2016-07-07 12:00 | 15M | |
| hzv-ezine_02.pdf | 2016-07-07 12:00 | 13M | |
| hzv-ezine_01.pdf | 2016-07-07 12:00 | 5.8M | |
| hungry_minds-debian_gnu_linux_bible-(2001).pdf | 2015-09-04 12:00 | 6.8M | |
| how_to_conf_webvpn.pdf | 2016-07-07 12:00 | 4.1M | |
| histoire_cryptographie.pdf | 2009-02-03 12:00 | 215K | |
| high-perf-crypto.pdf | 2009-02-03 12:00 | 46K | |
| herys.pdf | 2009-02-03 12:00 | 10K | |
| help_manual.pdf | 2016-07-07 12:00 | 82K | |
| hakin9_2006_FR.pdf | 2016-07-07 12:00 | 11M | |
| hakin9_3_2006_FR.pdf | 2016-07-07 12:00 | 11M | |
| hakin9_05_2009_e_book-2.pdf | 2016-07-07 12:00 | 4.5M | |
| hakin9-6-2009 Ebook.pdf | 2016-07-07 12:00 | 18M | |
| hakin9-5-2009 Ebook.pdf | 2016-07-07 12:00 | 4.5M | |
| hakin9-3-2009 Ebook.pdf | 2016-07-07 12:00 | 11M | |
| hakin9-3-2006 Ebook.pdf | 2016-07-07 12:00 | 11M | |
| hakin9-1-2010 Ebook.pdf | 2016-07-07 12:00 | 4.6M | |
| hackmag11.pdf | 2017-01-10 12:00 | 13M | |
| hacker ethic.pdf | 2014-12-07 12:00 | 13M | |
| gre_ipsec_ospf.pdf | 2016-07-07 12:00 | 1.8M | |
| gladman.pdf | 2009-02-03 12:00 | 45K | |
| fusion.pdf | 2009-02-03 12:00 | 148K | |
| fta-m2-admin_gnulinux-v1.pdf | 2015-09-04 12:00 | 19M | |
| fse93.pdf | 2009-02-03 12:00 | 77K | |
| fox_ujf.pdf | 2009-02-03 12:00 | 402K | |
| ezine 50-1337.pdf | 2016-07-07 12:00 | 14M | |
| exchange2000_sybex.pdf | 2015-09-04 12:00 | 9.0M | |
| ethical hacking student guide.pdf | 2015-09-04 12:00 | 7.4M | |
| ethical hacking, student guide.pdf | 2014-12-07 12:00 | 7.4M | |
| essay-037.pdf | 2009-02-03 12:00 | 31K | |
| esm.pdf | 2009-02-03 12:00 | 60K | |
| enhance-vpn-pix70.pdf | 2016-07-07 12:00 | 53K | |
| emacs-speak-ug.pdf | 2015-09-04 12:00 | 89K | |
| elec6703-2-3.pdf | 2009-02-03 12:00 | 60K | |
| ebay-hacks-100-industrial-strength-tips-and-tools.pdf | 2014-12-07 12:00 | 4.3M | |
| eBook_Web_Application_Development_With_PHP_4.0.pdf | 2015-09-04 12:00 | 6.3M | |
| eBook_Protected_Internet_Intranet_&_Virtual_Private_Networks.pdf | 2015-09-04 12:00 | 3.5M | |
| eBook_MySQL-PHP_Database_Applications.pdf | 2015-09-04 12:00 | 3.5M | |
| eBook_Dictionary_Of_Networking.pdf | 2015-09-04 12:00 | 8.1M | |
| eBook_A_Programmers_Introduction_To_Visual_Basic_.NET.pdf | 2015-09-04 12:00 | 4.1M | |
| eBook_ASP.net_Web_Developers_Guide.pdf | 2015-09-04 12:00 | 7.0M | |
| eBook The Book of Overclocking.pdf | 2015-09-04 12:00 | 2.8M | |
| doit_v2_lab3_sc.pdf | 2016-07-07 12:00 | 240K | |
| doit_v2_lab3_ak.pdf | 2016-07-07 12:00 | 511K | |
| doit_v2_lab2_sc.pdf | 2016-07-07 12:00 | 271K | |
| doit_v2_lab2_ak.pdf | 2016-07-07 12:00 | 619K | |
| doit_v2_lab1_sc.pdf | 2016-07-07 12:00 | 258K | |
| doit_v2_lab1_ak.pdf | 2016-07-07 12:00 | 673K | |
| doc_gdb.pdf | 2016-07-07 12:00 | 84K | |
| dlsw_rg0897.pdf | 2016-07-07 12:00 | 2.0M | |
| djalil-crypto.pdf | 2009-02-03 12:00 | 157K | |
| debug.pdf | 2016-07-07 12:00 | 27K | |
| debian_squid_trick.pdf | 2015-09-04 12:00 | 35K | |
| dean02.pdf | 2009-02-03 12:00 | 94K | |
| cvpn3k_pix_ias.pdf | 2016-07-07 12:00 | 779K | |
| cucs-021-04.pdf | 2009-02-03 12:00 | 131K | |
| csd-ios.pdf | 2016-07-07 12:00 | 2.7M | |
| cryptosizes.pdf | 2009-02-03 12:00 | 438K | |
| cryptography_new.pdf | 2009-02-03 12:00 | 219K | |
| cryptoanalyse.pdf | 2009-02-03 12:00 | 64K | |
| crypto_moderne.pdf | 2009-02-03 12:00 | 205K | |
| crypto_mod.pdf | 2009-02-03 12:00 | 173K | |
| crypto.pdf | 2009-02-03 12:00 | 217K | |
| crypt.talk.pdf | 2009-02-03 12:00 | 100K | |
| cracking-sql-passwords.pdf | 2014-12-07 12:00 | 160K | |
| concours_aes.pdf | 2009-02-03 12:00 | 471K | |
| code.pdf | 2009-02-03 12:00 | 198K | |
| cmc.pdf | 2009-02-03 12:00 | 750K | |
| citctf-2010-writeup-nibbles.pdf | 2016-07-07 12:00 | 16K | |
| cisco-univ-net-mgmt-20070208.pdf | 2016-07-07 12:00 | 8.1M | |
| ches99.pdf | 2009-02-03 12:00 | 181K | |
| cfun_vcg.pdf | 2016-07-07 12:00 | 44K | |
| cfskey.pdf | 2009-02-03 12:00 | 42K | |
| cfs.pdf | 2009-02-03 12:00 | 82K | |
| ceh-official-certified-ethical-hacker-review-guide-exam-312-50.9780782144376.27422.pdf | 2014-12-07 12:00 | 4.7M | |
| ccs2017.pdf | 2017-10-16 12:00 | 627K | |
| cbtwirl.pdf | 2009-02-03 12:00 | 118K | |
| cbac_email.pdf | 2016-07-07 12:00 | 181K | |
| cat2948g-releasenote.120-25.W5.27c.pdf | 2016-07-07 12:00 | 112K | |
| c1200-releasenote.4-29.pdf | 2016-04-09 12:00 | 52K | |
| c1200-releasenote.4-26.pdf | 2016-04-09 12:00 | 201K | |
| c541c12.pdf | 2016-07-07 12:00 | 140K | |
| c541c11.pdf | 2016-07-07 12:00 | 166K | |
| c541c10.pdf | 2016-07-07 12:00 | 133K | |
| c541c09.pdf | 2016-07-07 12:00 | 192K | |
| c541c08.pdf | 2016-07-07 12:00 | 150K | |
| c541c07.pdf | 2016-07-07 12:00 | 224K | |
| c541c06.pdf | 2016-07-07 12:00 | 298K | |
| c541c05.pdf | 2016-07-07 12:00 | 192K | |
| c541c04.pdf | 2016-07-07 12:00 | 156K | |
| c541c03.pdf | 2016-07-07 12:00 | 214K | |
| c541c02.pdf | 2016-07-07 12:00 | 134K | |
| c521c14.pdf | 2016-07-07 12:00 | 463K | |
| c521c13.pdf | 2016-07-07 12:00 | 942K | |
| c521c12.pdf | 2016-07-07 12:00 | 444K | |
| c521c11.pdf | 2016-07-07 12:00 | 303K | |
| c521c10.pdf | 2016-07-07 12:00 | 409K | |
| c521c09.pdf | 2016-07-07 12:00 | 231K | |
| c521c08.pdf | 2016-07-07 12:00 | 371K | |
| c521c07.pdf | 2016-07-07 12:00 | 311K | |
| c521c06.pdf | 2016-07-07 12:00 | 488K | |
| c521c05.pdf | 2016-07-07 12:00 | 570K | |
| c521c04.pdf | 2016-07-07 12:00 | 258K | |
| c521c03.pdf | 2016-07-07 12:00 | 412K | |
| c521c02.pdf | 2016-07-07 12:00 | 142K | |
| c521CramSheet.pdf | 2016-07-07 12:00 | 59K | |
| c.pdf | 2009-02-03 12:00 | 99K | |
| bsd-hacks.pdf | 2014-12-07 12:00 | 2.0M | |
| bsci.routing.features.1.00.pdf | 2016-07-07 12:00 | 111K | |
| bsci.ospf.part3.1.00.pdf | 2016-07-07 12:00 | 320K | |
| bsci.ospf.part2.1.00.pdf | 2016-07-07 12:00 | 381K | |
| bsci.ospf.part1.1.00.pdf | 2016-07-07 12:00 | 341K | |
| bsci.multicast.1.00.pdf | 2016-07-07 12:00 | 211K | |
| bsci.isis.1.00.pdf | 2016-07-07 12:00 | 299K | |
| bsci.ipv6.1.00.pdf | 2016-07-07 12:00 | 125K | |
| bsci.ip.routing.overview.1.00.pdf | 2016-07-07 12:00 | 65K | |
| bsci.eigrp.1.00.pdf | 2016-07-07 12:00 | 430K | |
| bsci.bgp.1.00.pdf | 2016-07-07 12:00 | 558K | |
| bit_order.pdf | 2009-02-03 12:00 | 66K | |
| bh-usa-07-yason-WP.pdf | 2016-07-07 12:00 | 504K | |
| bgp-origin-validation-FINAL.pdf | 2016-07-07 12:00 | 954K | |
| bear-lion.pdf | 2009-02-03 12:00 | 152K | |
| bcmsn.wireless.client.access.1.01.pdf | 2016-07-07 12:00 | 534K | |
| bcmsn.vlans.trunking.vtp.1.00.pdf | 2016-07-07 12:00 | 279K | |
| bcmsn.stp.1.01.pdf | 2016-07-07 12:00 | 172K | |
| bcmsn.layer2.security.1.00.pdf | 2016-07-07 12:00 | 107K | |
| bcmsn.layer2.qos.1.00.pdf | 2016-07-07 12:00 | 76K | |
| bcmsn.intervlan.routing.1.00.pdf | 2016-07-07 12:00 | 104K | |
| bcmsn.gateway.redundancy.1.00.pdf | 2016-07-07 12:00 | 73K | |
| bcmsn.etherchannel.1.01.pdf | 2016-07-07 12:00 | 82K | |
| bcmsn.campus.design.1.00.pdf | 2016-07-07 12:00 | 146K | |
| bcmsn.bsci.intro.1.00.pdf | 2016-07-07 12:00 | 80K | |
| bcmsn.advanced.stp.1.01.pdf | 2016-07-07 12:00 | 120K | |
| basic_config_cli.pdf | 2016-07-07 12:00 | 271K | |
![[ ]](/icons/unknown.gif) | asia-16-Ossmann-Rapid-Radio-Reversing-wp.pdf.1 | 2016-07-07 12:00 | 370K | |
| asia-16-Ossmann-Rapid-Radio-Reversing-wp.pdf | 2016-07-07 12:00 | 370K | |
| asia-16-He-Hey-Your-Parcel-Looks-Bad-Fuzzing-And-Exploiting-Parcelization-Vulnerabilities-In-Android.pdf | 2016-07-07 12:00 | 9.4M | |
| asa-remotevpn-asdm.pdf | 2016-07-07 12:00 | 570K | |
| arit.pdf | 2009-02-03 12:00 | 202K | |
| andreas3.pdf | 2009-02-03 12:00 | 2.3M | |
| all.labs.solution.pdf | 2016-07-07 12:00 | 438K | |
| alibaba.pdf | 2009-02-03 12:00 | 227K | |
| aes-crypto.pdf | 2009-02-03 12:00 | 304K | |
| advanced heap spraying techniques.pdf | 2016-07-07 12:00 | 32K | |
| advanced_heap_spraying_techniques.pdf | 2016-07-07 12:00 | 32K | |
| actu_secu_septembre2007.pdf | 2016-07-07 12:00 | 3.2M | |
| actu_secu_septembre2006.pdf | 2016-07-07 12:00 | 1.1M | |
| actu_secu_octobre2007.pdf | 2016-07-07 12:00 | 1.8M | |
| actu_secu_octobre2006.pdf | 2016-07-07 12:00 | 1.0M | |
| actu_secu_novembre2006.pdf | 2016-07-07 12:00 | 4.8M | |
| actu_secu_mars2007.pdf | 2016-07-07 12:00 | 3.2M | |
| actu_secu_mars2006.pdf | 2016-07-07 12:00 | 925K | |
| actu_secu_mai2007.pdf | 2016-07-07 12:00 | 4.0M | |
| actu_secu_mai2006.pdf | 2016-07-07 12:00 | 5.2M | |
| actu_secu_juin2007.pdf | 2016-07-07 12:00 | 3.9M | |
| actu_secu_juin2006.pdf | 2016-07-07 12:00 | 1.6M | |
| actu_secu_juillet-aout2006.pdf | 2016-07-07 12:00 | 1.4M | |
| actu_secu_janvier2007.pdf | 2016-07-07 12:00 | 5.9M | |
| actu_secu_fevrier2007.pdf | 2016-07-07 12:00 | 2.0M | |
| actu_secu_decembre2006.pdf | 2016-07-07 12:00 | 1.7M | |
| actu_secu_avril2007.pdf | 2016-07-07 12:00 | 2.7M | |
| actu_secu_avril2006.pdf | 2016-07-07 12:00 | 3.8M | |
| actu_secu_Janvier2008.pdf | 2016-07-07 12:00 | 5.8M | |
| actu_secu_19_Blackhat.pdf | 2016-07-07 12:00 | 5.6M | |
| aa-svrgrps-asdm.pdf | 2016-07-07 12:00 | 211K | |
| [Packt] Understanding TCP IP - A Clear and Comprehensive Guide (2006) - BBL.pdf | 2015-09-04 12:00 | 13M | |
| [No Starch] Cisco Routers for the Desperate- Router Management, The Easy Way [ISBN1593270496] [2004].pdf | 2015-09-04 12:00 | 15M | |
| [No Starch Press] The Debian System - Concepts and Techniques (2005).pdf | 2015-09-04 12:00 | 5.5M | |
| [No Starch Press] Nagios - System and Network Monitoring (2006) - BBL.pdf | 2015-09-04 12:00 | 6.5M | |
| [Developer Shed Network] Server Side - XML - XML Parsing with DOM and Xerces (Part 1).pdf | 2015-09-04 12:00 | 51K | |
| [Developer Shed Network] Server Side - XML - XML Basics (Part 2).pdf | 2015-09-04 12:00 | 40K | |
| [Developer Shed Network] Server Side - XML - XML Basics (Part 1).pdf | 2015-09-04 12:00 | 39K | |
| [Developer Shed Network] Server Side - XML - XLink Basics.pdf | 2015-09-04 12:00 | 41K | |
| [Developer Shed Network] Server Side - XML - Using PHP with XML (Part 2).pdf | 2015-09-04 12:00 | 31K | |
| [Developer Shed Network] Server Side - XML - Using PHP with XML (Part 1).pdf | 2015-09-04 12:00 | 71K | |
| [Developer Shed Network] Server Side - XML - Understanding XML Schema.pdf | 2015-09-04 12:00 | 53K | |
| [Developer Shed Network] Server Side - XML - The Fundamentals of DTD Design.pdf | 2015-09-04 12:00 | 52K | |
| [Developer Shed Network] Server Side - XML - Introduction to XML.pdf | 2015-09-04 12:00 | 15K | |
| [Developer Shed Network] Server Side - XML - Introduction to Cocoon, XML XSL.pdf | 2015-09-04 12:00 | 41K | |
| [Developer Shed Network] Server Side - XML - Doing More with XML Schemas (Part 4).pdf | 2015-09-04 12:00 | 49K | |
| [Developer Shed Network] Server Side - XML - Doing More with XML Schemas (Part 3).pdf | 2015-09-04 12:00 | 53K | |
| [Developer Shed Network] Server Side - XML - Doing More with XML Schemas (Part 2).pdf | 2015-09-04 12:00 | 49K | |
| [Developer Shed Network] Server Side - XML - Doing More with XML Schemas (Part 1).pdf | 2015-09-04 12:00 | 49K | |
| [Developer Shed Network] Server Side - XML - An Introduction to XML.pdf | 2015-09-04 12:00 | 26K | |
| [Developer Shed Network] Server Side - Python - Writing CGI Programs in Python.pdf | 2015-09-04 12:00 | 45K | |
| [Developer Shed Network] Server Side - Python - Python 101 (Part 8) - An Exceptionally Clever Snake.pdf | 2015-09-04 12:00 | 38K | |
| [Developer Shed Network] Server Side - Python - Python 101 (Part 7) - Dinner with a Hungry Giant.pdf | 2015-09-04 12:00 | 45K | |
| [Developer Shed Network] Server Side - Python - Python 101 (Part 6) - Hedgehogs, Pythons and Funky Chameleons.pdf | 2015-09-04 12:00 | 36K | |
| [Developer Shed Network] Server Side - Python - Python 101 (Part 6) - Hedgehogs, Pythons and Funky Chameleons(1).pdf | 2015-09-04 12:00 | 8.0K | |
| [Developer Shed Network] Server Side - Python - Python 101 (Part 5) - Snake Oil for the Soul.pdf | 2015-09-04 12:00 | 31K | |
| [Developer Shed Network] Server Side - Python - Python 101 (Part 4) - Feeding the Snake.pdf | 2015-09-04 12:00 | 32K | |
| [Developer Shed Network] Server Side - Python - Python 101 (Part 3) - A Twist in the Tail.pdf | 2015-09-04 12:00 | 34K | |
| [Developer Shed Network] Server Side - Python - Python 101 (Part 2) - If Wishes Were Pythons.pdf | 2015-09-04 12:00 | 33K | |
| [Developer Shed Network] Server Side - Python - Python 101 (Part 1) - Snake Eyes.pdf | 2015-09-04 12:00 | 29K | |
| [Developer Shed Network] Server Side - Python - Object Oriented Programming with Python (Part 2).pdf | 2015-09-04 12:00 | 32K | |
| [Developer Shed Network] Server Side - Python - Object Oriented Programming with Python (Part 1).pdf | 2015-09-04 12:00 | 36K | |
| [Developer Shed Network] Server Side - Python - MySQL Connectivity with Python.pdf | 2015-09-04 12:00 | 45K | |
| [Developer Shed Network] Server Side - Python - Essential Resources for the Python Professional.pdf | 2015-09-04 12:00 | 55K | |
| [Developer Shed Network] Server Side - Perl - Web Mining with Perl.pdf | 2015-09-04 12:00 | 40K | |
| [Developer Shed Network] Server Side - Perl - Using the Perl Debugger.pdf | 2015-09-04 12:00 | 34K | |
| [Developer Shed Network] Server Side - Perl - Using Perl with XML (Part 2).pdf | 2015-09-04 12:00 | 80K | |
| [Developer Shed Network] Server Side - Perl - Using Perl with XML (Part 1).pdf | 2015-09-04 12:00 | 77K | |
| [Developer Shed Network] Server Side - Perl - Using Perl with WDDX.pdf | 2015-09-04 12:00 | 64K | |
| [Developer Shed Network] Server Side - Perl - Understanding Perl's Special Variables.pdf | 2015-09-04 12:00 | 26K | |
| [Developer Shed Network] Server Side - Perl - Perl 101 (Part 8) - Putting it to the Test.pdf | 2015-09-04 12:00 | 29K | |
| [Developer Shed Network] Server Side - Perl - Perl 101 (Part 7) - CGI Basics.pdf | 2015-09-04 12:00 | 29K | |
| [Developer Shed Network] Server Side - Perl - Perl 101 (Part 6) - The Perl Toolbox.pdf | 2015-09-04 12:00 | 33K | |
| [Developer Shed Network] Server Side - Perl - Perl 101 (Part 5) - Sub-Zero Code.pdf | 2015-09-04 12:00 | 30K | |
| [Developer Shed Network] Server Side - Perl - Perl 101 (Part 4) - Mind Games.pdf | 2015-09-04 12:00 | 38K | |
| [Developer Shed Network] Server Side - Perl - Perl 101 (Part 3) - Looping the Loop.pdf | 2015-09-04 12:00 | 34K | |
| [Developer Shed Network] Server Side - Perl - Perl 101 (Part 1) - The Basics.pdf | 2015-09-04 12:00 | 25K | |
| [Developer Shed Network] Server Side - Perl - Object Oriented Programming in Perl (Part 2).pdf | 2015-09-04 12:00 | 32K | |
| [Developer Shed Network] Server Side - Perl - Object Oriented Programming in Perl (Part 1).pdf | 2015-09-04 12:00 | 32K | |
| [Developer Shed Network] Server Side - Perl - Introduction to mod_perl (Part 6) - Even More Perl Basics.pdf | 2015-09-04 12:00 | 38K | |
| [Developer Shed Network] Server Side - Perl - Introduction to mod_perl (Part 5) - More Perl Basics.pdf | 2015-09-04 12:00 | 41K | |
| [Developer Shed Network] Server Side - Perl - Introduction to mod_perl (Part 4) - Perl Basics.pdf | 2015-09-04 12:00 | 39K | |
| [Developer Shed Network] Server Side - Perl - Introduction to mod_perl (Part 3) - Non-Priveledged Install.pdf | 2015-09-04 12:00 | 44K | |
| [Developer Shed Network] Server Side - Perl - Introduction to mod_perl (Part 2) - mod_perl Quickstart.pdf | 2015-09-04 12:00 | 91K | |
| [Developer Shed Network] Server Side - Perl - Introduction to mod_perl (Part 1) - Why mod_perl.pdf | 2015-09-04 12:00 | 112K | |
| [Developer Shed Network] Server Side - Perl - Carping About DBI.pdf | 2015-09-04 12:00 | 41K | |
| [Developer Shed Network] Server Side - Perl - CGI.pm Basics.pdf | 2015-09-04 12:00 | 29K | |
| [Developer Shed Network] Server Side - PHP - Writing Self-Documenting PHP Code.pdf | 2015-09-04 12:00 | 132K | |
| [Developer Shed Network] Server Side - PHP - Website Database Basics with PHP and MySQL.pdf | 2015-09-04 12:00 | 95K | |
| [Developer Shed Network] Server Side - PHP - Web Development with PHP FastTemplate.pdf | 2015-09-04 12:00 | 94K | |
| [Developer Shed Network] Server Side - PHP - Watching the Web.pdf | 2015-09-04 12:00 | 42K | |
| [Developer Shed Network] Server Side - PHP - WAP-Enabling a Website with PHP3.pdf | 2015-09-04 12:00 | 30K | |
| [Developer Shed Network] Server Side - PHP - Using the Google Web APIs with PHP.pdf | 2015-09-04 12:00 | 167K | |
| [Developer Shed Network] Server Side - PHP - Using XML-RPC with PHP.pdf | 2015-09-04 12:00 | 45K | |
| [Developer Shed Network] Server Side - PHP - Using Variable Variables in PHP.pdf | 2015-09-04 12:00 | 21K | |
| [Developer Shed Network] Server Side - PHP - Using PHP with LDAP (Part 2).pdf | 2015-09-04 12:00 | 107K | |
| [Developer Shed Network] Server Side - PHP - Using PHP with LDAP (Part 1).pdf | 2015-09-04 12:00 | 123K | |
| [Developer Shed Network] Server Side - PHP - Using PHP with Java.pdf | 2015-09-04 12:00 | 51K | |
| [Developer Shed Network] Server Side - PHP - Using PHP Classes to Navigate Distributed Whois Databases.pdf | 2015-09-04 12:00 | 29K | |
| [Developer Shed Network] Server Side - PHP - Using Amazon Web Services with PHP and SOAP (Part 2).pdf | 2015-09-04 12:00 | 172K | |
| [Developer Shed Network] Server Side - PHP - Using Amazon Web Services with PHP and SOAP (Part 1).pdf | 2015-09-04 12:00 | 230K | |
| [Developer Shed Network] Server Side - PHP - User Contributed - PHP, MySQL, and Images.pdf | 2015-09-04 12:00 | 18K | |
| [Developer Shed Network] Server Side - PHP - User Authentication with patUser (Part 3).pdf | 2015-09-04 12:00 | 38K | |
| [Developer Shed Network] Server Side - PHP - User Authentication with patUser (Part 2).pdf | 2015-09-04 12:00 | 156K | |
| [Developer Shed Network] Server Side - PHP - User Authentication with patUser (Part 1).pdf | 2015-09-04 12:00 | 130K | |
| [Developer Shed Network] Server Side - PHP - User Authentication with Apache and PHP.pdf | 2015-09-04 12:00 | 86K | |
| [Developer Shed Network] Server Side - PHP - Time Is Money (Part 2).pdf | 2015-09-04 12:00 | 103K | |
| [Developer Shed Network] Server Side - PHP - Time Is Money (Part 1).pdf | 2015-09-04 12:00 | 76K | |
| [Developer Shed Network] Server Side - PHP - The Soothingly Seamless Setup of Apache, SSL, MySQL, and PH.pdf | 2015-09-04 12:00 | 66K | |
| [Developer Shed Network] Server Side - PHP - Template-Based Web Development with patTemplate (Part 2).pdf | 2015-09-04 12:00 | 97K | |
| [Developer Shed Network] Server Side - PHP - Template-Based Web Development with patTemplate (Part 1).pdf | 2015-09-04 12:00 | 151K | |
| [Developer Shed Network] Server Side - PHP - Talking the Talk - a phpBB Primer.pdf | 2015-09-04 12:00 | 669K | |
| [Developer Shed Network] Server Side - PHP - TAR File Management with PHP Archive_TAR.pdf | 2015-09-04 12:00 | 59K | |
| [Developer Shed Network] Server Side - PHP - String Theory.pdf | 2015-09-04 12:00 | 45K | |
| [Developer Shed Network] Server Side - PHP - Stream Me Up, Scotty! (Part 2).pdf | 2015-09-04 12:00 | 28K | |
| [Developer Shed Network] Server Side - PHP - Stream Me Up, Scotty! (Part 1).pdf | 2015-09-04 12:00 | 35K | |
| [Developer Shed Network] Server Side - PHP - Socket Programming with PHP.pdf | 2015-09-04 12:00 | 57K | |
| [Developer Shed Network] Server Side - PHP - Socket Programming with PHP(1).pdf | 2015-09-04 12:00 | 57K | |
| [Developer Shed Network] Server Side - PHP - Search This!.pdf | 2015-09-04 12:00 | 30K | |
| [Developer Shed Network] Server Side - PHP - Scratching the Surface - Getting Started with PHP Fusebox.pdf | 2015-09-04 12:00 | 55K | |
| [Developer Shed Network] Server Side - PHP - Quick and Dirty Search Engine with PHP and MySQL.pdf | 2015-09-04 12:00 | 15K | |
| [Developer Shed Network] Server Side - PHP - Plugging RDF Content Into Your Website with PHP.pdf | 2015-09-04 12:00 | 131K | |
| [Developer Shed Network] Server Side - PHP - Paginating MySQL Data with PHP.pdf | 2015-09-04 12:00 | 34K | |
| [Developer Shed Network] Server Side - PHP - PHP and PostgreSQL.pdf | 2015-09-04 12:00 | 58K | |
| [Developer Shed Network] Server Side - PHP - PHP and COM.pdf | 2015-09-04 12:00 | 170K | |
| [Developer Shed Network] Server Side - PHP - PHPLib Templates.pdf | 2015-09-04 12:00 | 27K | |
| [Developer Shed Network] Server Side - PHP - PHP Fast Template.pdf | 2015-09-04 12:00 | 25K | |
| [Developer Shed Network] Server Side - PHP - PHP Application Development with ADODB (Part 2).pdf | 2015-09-04 12:00 | 53K | |
| [Developer Shed Network] Server Side - PHP - PHP Application Development with ADODB (Part1).pdf | 2015-09-04 12:00 | 75K | |
| [Developer Shed Network] Server Side - PHP - PHP 101 (Part 5) - The Wonderland Factor.pdf | 2015-09-04 12:00 | 37K | |
| [Developer Shed Network] Server Side - PHP - PHP 101 (Part 4) - Look, Ma... It's Alive!.pdf | 2015-09-04 12:00 | 34K | |
| [Developer Shed Network] Server Side - PHP - PHP 101 (Part 3) - Chocolate Fudge and Time Machines.pdf | 2015-09-04 12:00 | 32K | |
| [Developer Shed Network] Server Side - PHP - PHP 101 (Part 2) - Shakespeare's Rose.pdf | 2015-09-04 12:00 | 33K | |
| [Developer Shed Network] Server Side - PHP - PHP 101 (Part 1) - Secret Agent Man.pdf | 2015-09-04 12:00 | 25K | |
| [Developer Shed Network] Server Side - PHP - PHP3 Introduction.pdf | 2015-09-04 12:00 | 31K | |
| [Developer Shed Network] Server Side - PHP - PDF Generation with PHP.pdf | 2015-09-04 12:00 | 111K | |
| [Developer Shed Network] Server Side - PHP - Output Buffering with PHP.pdf | 2015-09-04 12:00 | 40K | |
| [Developer Shed Network] Server Side - PHP - Nuking the Competition.pdf | 2015-09-04 12:00 | 151K | |
| [Developer Shed Network] Server Side - PHP - Miles To Go Before I Sleep....pdf | 2015-09-04 12:00 | 90K | |
| [Developer Shed Network] Server Side - PHP - Logging with PHP.pdf | 2015-09-04 12:00 | 68K | |
| [Developer Shed Network] Server Side - PHP - Image Generation with PHP.pdf | 2015-09-04 12:00 | 44K | |
| [Developer Shed Network] Server Side - PHP - File and Directory Manipulation in PHP (Part 2).pdf | 2015-09-04 12:00 | 407K | |
| [Developer Shed Network] Server Side - PHP - File and Directory Manipulation in PHP (Part 1).pdf | 2015-09-04 12:00 | 25K | |
| [Developer Shed Network] Server Side - PHP - Error Handling in PHP (Part 2).pdf | 2015-09-04 12:00 | 160K | |
| [Developer Shed Network] Server Side - PHP - Error Handling in PHP (Part 1).pdf | 2015-09-04 12:00 | 74K | |
| [Developer Shed Network] Server Side - PHP - Easy Application Configuration with patConfiguration.pdf | 2015-09-04 12:00 | 65K | |
| [Developer Shed Network] Server Side - PHP - Dynamic Generation of Menu Structures and JavaScript Rollovers in PHP.pdf | 2015-09-04 12:00 | 26K | |
| [Developer Shed Network] Server Side - PHP - Developing a User Personalization System with PHP and Cookies.pdf | 2015-09-04 12:00 | 25K | |
| [Developer Shed Network] Server Side - PHP - Democracy, the PHP Way.pdf | 2015-09-04 12:00 | 92K | |
| [Developer Shed Network] Server Side - PHP - Date-Time Processing with PHP.pdf | 2015-09-04 12:00 | 59K | |
| [Developer Shed Network] Server Side - PHP - Database Abstraction with PHP.pdf | 2015-09-04 12:00 | 51K | |
| [Developer Shed Network] Server Side - PHP - Data Exchange with XML, WDDX and PHP.pdf | 2015-09-04 12:00 | 44K | |
| [Developer Shed Network] Server Side - PHP - Creating a Mailing List Manager with PHP.pdf | 2015-09-04 12:00 | 32K | |
| [Developer Shed Network] Server Side - PHP - Cracking the Vault (Part 2).pdf | 2015-09-04 12:00 | 93K | |
| [Apress] Hardening Linux (2005) - BBL.pdf | 2015-09-04 12:00 | 2.6M | |
| [2009] - Lpic-1 Linux Professional Institute Certification Study Guide (Level 1 Exams 101 And 102) - Second Edition.pdf | 2015-09-04 12:00 | 8.0M | |
| [2008] - The Book of Wireless A Painless Guide to Wi-Fi and Broadband Wireless - [No Starch Press] - [1593271697].pdf | 2015-09-04 12:00 | 11M | |
| [2008] - Netcat Power Tools - [Syngress] - [1597492574].pdf | 2015-09-04 12:00 | 9.9M | |
| [2008] - CCNA Cisco Certified Network Associate Study Guide (Exam 640-802) (Certification Press) - [McGraw-Hill Osborne Media] - [0071497285].pdf | 2015-09-04 12:00 | 16M | |
| [2007] - Security Power Tools - [O'Reilly Media, Inc] - [0596009631].pdf | 2015-09-04 12:00 | 12M | |
| [2005] - Optimizing Linux(R) Performance A Hands-On Guide to Linux(R) Performance Tools (HP Professional Series) - [Prentice Hall PTR] - [0131486829].pdf | 2015-09-04 12:00 | 1.8M | |
| [2004] - Managing Projects with GNU Make (Nutshell Handbooks) - [O'Reilly Media, Inc] - [0596006101].pdf | 2015-09-04 12:00 | 3.3M | |
| Zope_Plone_ed2_v1.pdf | 2016-07-07 12:00 | 6.4M | |
| Zenk pentest LampSec CTF6.pdf | 2016-07-07 12:00 | 32K | |
| ZIP Attacks with Reduced Known Plaintext.pdf | 2016-07-07 12:00 | 32K | |
| ZI Hackademy - Newbie 3.pdf | 2016-07-07 12:00 | 31M | |
| Yahoo Hacking Of Oracle Technologies.pdf | 2016-07-07 12:00 | 32K | |
| Xbox-hack - AIM-2002-008.pdf | 2014-12-07 12:00 | 515K | |
| XXXX_static_vuln_detection_x86.pdf | 2014-09-11 12:00 | 322K | |
| XXXX_signal_oriented_programming.pdf | 2014-09-11 12:00 | 362K | |
| XXXX_rsa.pdf | 2014-12-13 12:00 | 126K | |
| XXXX_linear_diff_cryptanalysis.pdf | 2016-09-13 12:00 | 177K | |
| XXXX_lattice_crypto_beginners.pdf | 2016-02-28 12:00 | 1.1M | |
| XXXX_heap_exploitation.pdf | 2014-10-10 12:00 | 312K | |
| XXXX_cryptoanblock.pdf | 2014-12-28 12:00 | 291K | |
| XXXX_crypto_handbook_ch8.pdf | 2014-12-31 12:00 | 296K | |
| XXXX_FEAL.pdf | 2016-12-10 12:00 | 616K | |
| XXXX_ARM_exploitation.pdf | 2014-09-11 12:00 | 3.9M | |
| XXXX_20years_attack_rsa.pdf | 2016-09-19 12:00 | 303K | |
| XSS Tunnelling.pdf | 2016-07-07 12:00 | 48K | |
| XSS.pdf | 2016-07-07 12:00 | 32K | |
| Wrox - Beginning Php5, Apache, And Mysql Web Development - 2005.pdf | 2015-09-04 12:00 | 14M | |
| Write_up_WEB_CSAW_CTF_2010.pdf | 2016-07-07 12:00 | 32K | |
| Wits00.pdf | 2009-02-03 12:00 | 29K | |
| Wireless Networks For Dummies 2004.pdf | 2014-12-07 12:00 | 8.2M | |
| Wireless Network Hacks & Mods for Dummies.pdf | 2014-12-07 12:00 | 7.2M | |
| Wireless Lan Techniques Rf, Wifi, Bluetooth.pdf | 2016-07-07 12:00 | 2.1M | |
| Wireless IP and Building the Mobile Internet 2003.pdf | 2014-12-07 12:00 | 17M | |
| Wireless Hacking Tools.pdf | 2016-07-07 12:00 | 126K | |
| Wireless Hacking Projects for Wi-Fi Enthusiasts 2004.pdf | 2014-12-07 12:00 | 18M | |
| Wireless Communications.pdf | 2014-12-07 12:00 | 48M | |
| Wireless Communication Technologies New Multimedia Systems 2002.pdf | 2014-12-07 12:00 | 10M | |
| Windows PostÂExploitation Command Execution.pdf | 2016-07-07 12:00 | 32K | |
| Windows Internals.pdf | 2016-07-07 12:00 | 22M | |
| WinXP SP1 Hack.pdf | 2014-12-07 12:00 | 8.6K | |
| Wiley.PHP6.and.MySQL.Bible.Jan.2009.pdf | 2015-09-04 12:00 | 21M | |
| Wiley.OpenSolaris.Bible.Feb.2009.pdf | 2015-09-04 12:00 | 15M | |
| Wiley.Linux.Bible.2009.Edition.Jan.2009.pdf | 2015-09-04 12:00 | 36M | |
| Wiley.Fedora.10.and.Red.Hat.Enterprise.Linux.Bible.Jan.2009.pdf | 2015-09-04 12:00 | 8.3M | |
| Wiley - Linux Bible 2007 Edition.pdf | 2015-09-04 12:00 | 15M | |
| Wi Foo - The Secrets of Wireless Hacking.pdf | 2016-07-07 12:00 | 7.7M | |
| Wi-Fi Toys - 15 Cool Wireless Projects For Home, Office, And Entertainment 2004.pdf | 2014-12-07 12:00 | 12M | |
| Websters.New.World.Websters.New.World.Hacker.Dictionary.Sep.2006.pdf | 2014-12-07 12:00 | 4.9M | |
| WebShells survey and development of a framework for penetration testing.pdf | 2016-07-07 12:00 | 32K | |
| Web Penetration Testing with Kali Linux.pdf | 2016-07-07 12:00 | 20M | |
| Web Application Obfuscation.pdf | 2016-07-07 12:00 | 1.5M | |
| Watermarking _ Pirate identification Fingerprinting _ Content identication.pdf | 2016-07-07 12:00 | 32K | |
| Watermarking & Fingerprinting.pdf | 2016-07-07 12:00 | 32K | |
| Ward_AddPath_N48.pdf | 2016-07-07 12:00 | 355K | |
| WRITEUPS PCTF 2011 - CoP.pdf | 2016-07-07 12:00 | 32K | |
| WASC THREAT CLASSIFICATION.pdf | 2016-07-07 12:00 | 16K | |
| WAF Bypassing.pdf | 2016-07-07 12:00 | 32K | |
| Vulnerabilites.pdf | 2016-07-07 12:00 | 32K | |
| Volatility CheatSheet.pdf | 2018-01-07 12:00 | 220K | |
| Voice over IP Fundamentals.pdf | 2016-07-07 12:00 | 6.1M | |
| Voice WB 4.0 Solutions.pdf | 2016-07-07 12:00 | 6.7M | |
| VoIP for Dummies 2005.pdf | 2014-12-07 12:00 | 8.3M | |
| VoIP for Dummies.pdf | 2016-07-07 12:00 | 8.3M | |
| VoIP Telephony With Asterisk.pdf | 2016-07-07 12:00 | 2.7M | |
| VoIP Cisco Voice Over IP CVOICE Student Guide V4.2.pdf | 2016-07-07 12:00 | 17M | |
| VoIP - Implementing Voice Over IP.pdf | 2016-07-07 12:00 | 7.9M | |
| Violent Python.pdf | 2016-07-07 12:00 | 6.9M | |
| VTI_Design_Guide.pdf | 2016-07-07 12:00 | 1.0M | |
| VPN_performance.pdf | 2016-07-07 12:00 | 321K | |
| VPN_and_VoIP.pdf | 2016-07-07 12:00 | 300K | |
| VPN 3005 Getting Started.pdf | 2016-07-07 12:00 | 3.4M | |
| VPN10SG_vol3.pdf | 2016-07-07 12:00 | 17M | |
| VPN10SG_vol2.pdf | 2016-07-07 12:00 | 23M | |
| VPN10SG_vol1.pdf | 2016-07-07 12:00 | 23M | |
| VPN.pdf | 2016-07-07 12:00 | 22M | |
| VOIP_CISCO_VOICE_OVER_IP_CV.pdf | 2016-07-07 12:00 | 17M | |
| VLAN Load Balancing Between Trunks Using the Spanning-Tree Protocol Port Priority.pdf | 2016-07-07 12:00 | 39K | |
| VLAN.pdf | 2016-07-07 12:00 | 72K | |
| V3PN_SRND.pdf | 2016-07-07 12:00 | 2.5M | |
| V3PN_Redundancy_Load_Sharing_SRND.pdf | 2016-07-07 12:00 | 2.6M | |
| Usurpation d identite sur Ethernet.pdf | 2016-07-07 12:00 | 48K | |
| Using Samba, 3Rd Edition (2007) - O'reilly.pdf | 2015-09-04 12:00 | 6.4M | |
| Using PortFast and Other Commands to Fix Workstation Startup Connectivity Delays.pdf | 2016-07-07 12:00 | 75K | |
| Using IP Multicast Tools.pdf | 2016-07-07 12:00 | 125K | |
| Using Google in Penetration Testing.pdf | 2016-07-07 12:00 | 15M | |
| Userid_org - IPSec VPN Design - GRE and IPSec .pdf | 2016-07-07 12:00 | 69K | |
| User Guide for the Catalyst Express 500 Switches.pdf | 2016-07-07 12:00 | 2.0M | |
| UserAuth.pdf | 2009-02-03 12:00 | 390K | |
| Upgrading_the_System_Image .pdf | 2016-07-07 12:00 | 316K | |
| Upgrading Software Images on Catalyst 3550 Series Switches Using the Command Line Interface.pdf | 2016-07-07 12:00 | 68K | |
| Unreliable Guide To Locking.pdf | 2016-07-07 12:00 | 247K | |
| Unlock-IEWB-RS-VOL-2.lab18.v5.00.021.pdf | 2016-07-07 12:00 | 79K | |
| Unlock-IEWB-RS-VOL-2.lab18.solutions.v5.00.021.pdf | 2016-07-07 12:00 | 206K | |
| Unlock-IEWB-RS-VOL-2.lab17.v5.00.021.pdf | 2016-07-07 12:00 | 76K | |
| Unlock-IEWB-RS-VOL-2.lab17.solutions.v5.00.021.pdf | 2016-07-07 12:00 | 175K | |
| Unlock-IEWB-RS-VOL-2.lab16.v5.00.020.pdf | 2016-07-07 12:00 | 81K | |
| Unlock-IEWB-RS-VOL-2.lab16.solutions.v5.00.020.pdf | 2016-07-07 12:00 | 243K | |
| Unlock-IEWB-RS-VOL-2.lab14.v5.00.011.pdf | 2016-07-07 12:00 | 98K | |
| Unlock-IEWB-RS-VOL-2.lab14.solutions.v5.00.011.pdf | 2016-07-07 12:00 | 109K | |
| Unlock-IEWB-RS-VOL-2.lab13.v5.00.012.pdf | 2016-07-07 12:00 | 92K | |
| Unlock-IEWB-RS-VOL-2.lab13.solutions.v5.00.014.pdf | 2016-07-07 12:00 | 260K | |
| Unlock-IEWB-RS-VOL-2.lab12.v5.00.014.pdf | 2016-07-07 12:00 | 98K | |
| Unlock-IEWB-RS-VOL-2.lab12.solutions.v5.00.014.pdf | 2016-07-07 12:00 | 344K | |
| Unlock-IEWB-RS-VOL-2.lab11.v5.00.013_2.pdf | 2016-07-07 12:00 | 229K | |
| Unlock-IEWB-RS-VOL-2.lab11.solutions.v5.00.012_2.pdf | 2016-07-07 12:00 | 722K | |
| Unlock-IEWB-RS-VOL-2.lab10.v5.00.021.pdf | 2016-07-07 12:00 | 80K | |
| Unlock-IEWB-RS-VOL-2.lab10.solutions.v5.00.021_2.pdf | 2016-07-07 12:00 | 247K | |
| Unlock-IEWB-RS-VOL-2.lab9.v5.00.013_2.pdf | 2016-07-07 12:00 | 245K | |
| Unlock-IEWB-RS-VOL-2.lab9.solutions.v5.00.011_2.pdf | 2016-07-07 12:00 | 768K | |
| Unlock-IEWB-RS-VOL-2.lab8.v5.00.012_2.pdf | 2016-07-07 12:00 | 237K | |
| Unlock-IEWB-RS-VOL-2.lab8.solutions.v5.00.011_2.pdf | 2016-07-07 12:00 | 676K | |
| Unlock-IEWB-RS-VOL-2.lab7.v5.00.016_2.pdf | 2016-07-07 12:00 | 130K | |
| Unlock-IEWB-RS-VOL-2.lab7.solutions.v5.00.015_2.pdf | 2016-07-07 12:00 | 409K | |
| Unlock-IEWB-RS-VOL-2.lab6.v5.00.015.pdf | 2016-07-07 12:00 | 88K | |
| Unlock-IEWB-RS-VOL-2.lab6.solutions.v5.00.015_2.pdf | 2016-07-07 12:00 | 275K | |
| Unlock-IEWB-RS-VOL-2.lab5.v5.00.012_2.pdf | 2016-07-07 12:00 | 87K | |
| Unlock-IEWB-RS-VOL-2.lab5.solutions.v5.00.015_2.pdf | 2016-07-07 12:00 | 305K | |
| Unlock-IEWB-RS-VOL-2.lab4.v5.00.016.pdf | 2016-07-07 12:00 | 81K | |
| Unlock-IEWB-RS-VOL-2.lab4.solutions.v5.00.022.pdf | 2016-07-07 12:00 | 288K | |
| Unlock-IEWB-RS-VOL-2.lab3.v5.00.021_2.pdf | 2016-07-07 12:00 | 85K | |
| Unlock-IEWB-RS-VOL-2.lab3.solutions.v5.00.021_2.pdf | 2016-07-07 12:00 | 321K | |
| Unlock-IEWB-RS-VOL-2.lab2.v5.00.050.pdf | 2016-07-07 12:00 | 84K | |
| Unlock-IEWB-RS-VOL-2.lab2.solutions.v5.00.055.pdf | 2016-07-07 12:00 | 203K | |
| Unlock-IEWB-RS-VOL-2.lab1.v5.00.025.pdf | 2016-07-07 12:00 | 87K | |
| Unlock-IEWB-RS-VOL-2.lab1.solutions.v5.00.050.pdf | 2016-07-07 12:00 | 268K | |
| Unix malwares Myth or reality.pdf | 2016-07-07 12:00 | 1.0M | |
| Unified WLAN Design.pdf | 2016-07-07 12:00 | 5.1M | |
| Unicast Flooding in Switched Campus Networks.pdf | 2016-07-07 12:00 | 22K | |
| Understanding and Troubleshooting DHCP in Catalyst Switch or Enterprise Networks.pdf | 2016-07-07 12:00 | 330K | |
| Understanding and Configuring the Cisco UplinkFast Feature.pdf | 2016-07-07 12:00 | 85K | |
| Understanding and Configuring VLAN Trunk Protocol (VTP).pdf | 2016-07-07 12:00 | 77K | |
| Understanding and Configuring Backbone Fast on Catalyst Switches.pdf | 2016-07-07 12:00 | 92K | |
| Understanding_IP_adressing.pdf | 2014-12-07 12:00 | 1.1M | |
| Understanding QoS Policing and Marking on the Catalyst 3550.pdf | 2016-07-07 12:00 | 67K | |
| Understanding Ipv6, Second Edition (Microsoft Press, 2008).pdf | 2016-07-07 12:00 | 24M | |
| USBee.pdf | 2016-08-29 12:00 | 1.0M | |
| Tuto XSS.pdf | 2016-07-07 12:00 | 32K | |
| TuringPres.pdf | 2009-02-03 12:00 | 270K | |
| Trusted Computing for Military Applications.pdf | 2016-07-07 12:00 | 765K | |
| Trusted Computer System Evaluation Criteria_DoD.pdf | 2016-07-07 12:00 | 423K | |
| Troubleshooting the Catalyst VMPS Switch.pdf | 2016-07-07 12:00 | 48K | |
| Troubleshooting_the_Implementation_of_Ipsec_VPNs_Timms.pdf | 2016-07-07 12:00 | 3.0M | |
| Troubleshooting IP Telephony Networks - Case Studies.pdf | 2016-07-07 12:00 | 1.5M | |
| TriplePlay-NetworkPenTestingTools.pdf | 2014-10-08 12:00 | 4.0M | |
| Transparent Proxy with Linux and Squid mini-HOWTO.pdf | 2015-09-04 12:00 | 71K | |
| Traffic_Engineering_with_MPLS.pdf | 2016-07-07 12:00 | 5.8M | |
| To-Catch-an-APT-YARA-Jay-DiMartino.pdf | 2016-04-15 12:00 | 1.2M | |
| Timins Attacks on Public Key Crypto.pdf | 2016-07-07 12:00 | 207K | |
| Time-Based Blind SQL Injection using Heavy Queries.pdf | 2016-07-07 12:00 | 16K | |
| The hackademy Hors Serie 3.pdf | 2016-07-07 12:00 | 14M | |
| The hackademy Hors Serie 2.pdf | 2016-07-07 12:00 | 19M | |
| The hackademy Hors Serie 1.pdf | 2016-07-07 12:00 | 12M | |
| The_simple_ideal_cipher_system.pdf | 2009-02-03 12:00 | 104K | |
| The_Business_of_Cybercrime.pdf | 2014-12-07 12:00 | 4.7M | |
| The Web Hacking Incidents Database 2007.pdf | 2016-07-07 12:00 | 32K | |
| The Web Hacking Incident Database 2010.pdf | 2016-07-07 12:00 | 32K | |
| The Shellcoder’s Handbook.pdf | 2016-07-07 12:00 | 8.7M | |
| The Satellite Communication Applications Handbook, 2nd Ed.pdf | 2016-07-07 12:00 | 6.4M | |
| The Pen Test Perfect Storm Combining Network, Web App, and Wireless Pen Test Techniques - Part I.pdf | 2016-07-07 12:00 | 16K | |
| The Linux Cookbook Tips and Techniques for Everyday Use(2004).pdf | 2015-09-04 12:00 | 3.7M | |
| The Hackers Handbook.pdf | 2016-07-07 12:00 | 32K | |
| The Hackademy School - Newbie - part 4.pdf | 2016-07-07 12:00 | 9.2M | |
| The Hackademy School - Newbie - part 3.pdf | 2016-07-07 12:00 | 11M | |
| The Hackademy School - Newbie - part 2.pdf | 2016-07-07 12:00 | 9.9M | |
| The Hackademy School - Newbie - part 1.pdf | 2016-07-07 12:00 | 10M | |
| The Hackademy School - Mini guide anonymat.pdf | 2016-07-07 12:00 | 2.3M | |
| The Hackademy School - Hack Newbie.pdf | 2016-07-07 12:00 | 3.5M | |
| The Great Telecom Meltdown.pdf | 2016-07-07 12:00 | 7.8M | |
| The Giant Black Book of Computer Viruses.pdf | 2016-07-07 12:00 | 5.7M | |
| The Definitive Guide To MySQL 5, 3rd Edition (2005).pdf | 2015-09-04 12:00 | 11M | |
| The Definitive Guide To Controlling Malware, Spyware, Phishing, And Spam.pdf | 2015-09-04 12:00 | 2.9M | |
| The Complete Guide To Lockpicking - Eddie the Wire - Loompanics.pdf | 2016-07-07 12:00 | 3.6M | |
| The CodeBreakers - Kahn David.pdf | 2014-12-07 12:00 | 1.4M | |
| The Book Of PF - A No-Nonsense Guide To The OpenBSD Firewall (2008).pdf | 2015-09-04 12:00 | 3.6M | |
| The Art of Memory Forensics - Detecting Malware and Threats in Windows, Linux, and Mac Memory (2014).pdf | 2018-01-07 12:00 | 7.2M | |
| The-Hacker-Playbook-Practical-Guide-To-Penetration-Testing-2014.pdf | 2016-02-16 12:00 | 26M | |
| The-Best-Damn-Server-Virtualization-Book-Period-Including-Vmware-Xen-And-Microsoft-Virtual-Server 9781597492171.30070.pdf | 2015-09-04 12:00 | 35M | |
| Testking_640-802_Version_12.pdf | 2016-07-07 12:00 | 12M | |
| TestInside%20CCNA640-802%20v13.pdf | 2016-07-07 12:00 | 7.3M | |
| Tensors, differential forms, and variational principles-Dover (1989).pdf | 2017-02-02 12:00 | 13M | |
| Telecommunications Fundamentals, 2nd Edition.pdf | 2016-07-07 12:00 | 8.7M | |
| Telecommunication Circuit Design, 2nd Ed.pdf | 2016-07-07 12:00 | 6.5M | |
| Teach Yourself Php Mysql And Apache In 24Hours.pdf | 2015-09-04 12:00 | 7.4M | |
| Teach.Yourself.Php,.Mysql.And.Apache.All.In.One.pdf | 2015-09-04 12:00 | 88M | |
| TOC - Start.pdf | 2016-07-07 12:00 | 1.1M | |
| THUMBS DB FILES FORENSIC ISSUES.pdf | 2016-07-07 12:00 | 32K | |
| TCPIP for Dummies.pdf | 2014-12-07 12:00 | 4.1M | |
| TCP IP Foundations Aug 2004.pdf | 2014-12-07 12:00 | 6.8M | |
| TCP IP Analysis and Troubleshooting Toolkit 2003.pdf | 2014-12-07 12:00 | 12M | |
| System Requirements to Implement Trunking.pdf | 2016-07-07 12:00 | 64K | |
| Syngress Nagios 3 Enterprise Network Monitoring Including Plug-Ins and Hardware Devices May 2008 eBook-DDU.pdf | 2015-09-04 12:00 | 3.7M | |
| Syngress.Nmap in the Enterprise - Your Guide to Network Scanning.Jan.2008.pdf | 2015-09-04 12:00 | 5.7M | |
| Syngress, Nessus Snort And Ethereal Power Tools Customizing Open Source Security Applications (2005).pdf | 2015-09-04 12:00 | 7.1M | |
| Sybex CCNP Complete Study Guide 2005.pdf | 2016-07-07 12:00 | 26M | |
| Sybex CCNA Cisco Certified Network Associate Study Guide.5th Edition.pdf | 2016-07-07 12:00 | 14M | |
| Sybex 642-501 CCSP Securing Cisco IOS Networks Study Guide.pdf | 2016-07-07 12:00 | 9.3M | |
| Sybex.Linux.Administrator.Street.Smarts.Oct.2006.pdf | 2015-09-04 12:00 | 9.0M | |
| Sybex.CCSP.Complete.Study.Guide.Mar.2005.eBook-DDU.pdf | 2016-07-07 12:00 | 25M | |
| Sybex.CCNA.Cisco.Certified.Network.Associate.Study.Guide.Exam.640-802.6th.Edition.Aug.2007.pdf | 2016-07-07 12:00 | 256K | |
| Sybex.Books.CCSP.Secure.Intrusion.Detection.and.SAFE.Implementation.Study.Guide.pdf | 2016-07-07 12:00 | 23M | |
| Sybex - Network Security Foundations.pdf | 2016-07-07 12:00 | 5.8M | |
| Sybex - Certification LPIC-1 - 2006.pdf | 2015-09-04 12:00 | 11M | |
| Sybex -- Linux System Administration, 2nd Ed.pdf | 2015-09-04 12:00 | 7.4M | |
| Sybex -- Linux+ Study Guide.pdf | 2015-09-04 12:00 | 19M | |
| Switching, Routing, and Wireless Essentials Companion Guide (CCNAv7).pdf | 2020-07-05 12:00 | 58M | |
| SurveyAsynchExt.pdf | 2009-02-03 12:00 | 149K | |
| Successful NAC Deployments.pdf | 2016-07-07 12:00 | 5.5M | |
| SubstGen.pdf | 2009-02-03 12:00 | 79K | |
| Student Lab Guide.pdf | 2016-07-07 12:00 | 9.0M | |
| Student Guide - Volume 3.pdf | 2016-07-07 12:00 | 8.7M | |
| Student Guide - Volume 2.pdf | 2016-07-07 12:00 | 16M | |
| Student Guide - Volume 1.pdf | 2016-07-07 12:00 | 11M | |
| Step-by-step instructions on building a FrankenIDS.pdf | 2016-07-07 12:00 | 9.2K | |
| Starter Kit CISCO.pdf | 2016-08-23 12:00 | 154M | |
| Stamp M., Low R.M. Applied cryptanalysis...pdf | 2014-12-07 12:00 | 18M | |
| Stack Overflow Exploitation Explained.pdf | 2016-07-07 12:00 | 32K | |
| Squid.Configuration.Manual.pdf | 2015-09-04 12:00 | 200K | |
| Spanning Tree Protocol Root Guard Enhancement.pdf | 2016-07-07 12:00 | 71K | |
| Spanning Tree PortFast BPDU Guard Enhancement.pdf | 2016-07-07 12:00 | 36K | |
| Solutions Challenge Insomni_Hack 2008.pdf | 2016-07-07 12:00 | 32K | |
| Social Engineering.pdf | 2016-07-07 12:00 | 32K | |
| Site_to_Site_IPSec_Cisco_Router_and_Linux_FreeSWAN.pdf | 2016-07-07 12:00 | 464K | |
| Simplecrypto.pdf | 2009-02-03 12:00 | 42K | |
| Session_11 - (Part 2) Dissecting_the_HeartBeat_RAT_Functionalities.pdf | 2016-07-07 12:00 | 18M | |
| Session_10 - (Part 1) Reversing & Decrypting_Communications_of_HeartBeat_RAT.pdf | 2016-07-07 12:00 | 13M | |
| Session_9_Malware Analysis using pymal & malpimp.pdf | 2016-07-07 12:00 | 154K | |
| Session_8_Introduction_to_Android.pdf | 2016-07-07 12:00 | 319K | |
| Session_7_Malware_Memory_Forensics.pdf | 2016-07-07 12:00 | 17M | |
| Session_6_Malware_Sandbox_Analysis.pdf | 2016-07-07 12:00 | 6.1M | |
| Session_5_Reversing_Automation.pdf | 2016-07-07 12:00 | 2.5M | |
| Session_4_Anti-Analysis_Techniques.pdf | 2016-07-07 12:00 | 2.9M | |
| Session_3_Botnet_Analysis_Part_2.pdf | 2016-07-07 12:00 | 2.9M | |
| Session_2_Botnet_Analysis_Part_1.pdf | 2016-07-07 12:00 | 4.2M | |
| Session_1_Detection _and_Removal_of_Malwares.pdf | 2016-07-07 12:00 | 19M | |
| Security in VoIP Telephony Systems.pdf | 2016-07-07 12:00 | 1.2M | |
| Securing and Optimizing Linux -- The Ultimate Solution.pdf | 2015-09-04 12:00 | 4.4M | |
| Securing_and_Optimizing_Linux-DNS_and_BIND.pdf | 2015-09-04 12:00 | 320K | |
| Securing Voice in the New world Enterprise.pdf | 2016-07-07 12:00 | 6.4M | |
| Securing Networks with Private VLANs and VLAN Access Control Lists.pdf | 2016-07-07 12:00 | 331K | |
| Securing IIS By Breaking.pdf | 2016-07-07 12:00 | 31K | |
| Securing-Optimizing-Linux-The-Ultimate-Solution-v2.0.pdf | 2015-09-04 12:00 | 6.2M | |
| Securing & Hardening Linux v1.0.pdf | 2016-07-07 12:00 | 119K | |
| Secured_Branch_Router_Configuration_Example.pdf | 2016-07-07 12:00 | 218K | |
| Secur Student Guide V1.1-Securing Cisco IOS Networks[2004].pdf | 2016-07-07 12:00 | 9.6M | |
| Secrets of lockpicking-2.pdf | 2016-07-07 12:00 | 156K | |
| Secrets of Reverse Engineering.pdf | 2016-07-07 12:00 | 8.6M | |
| Secrets of Lockpicking.pdf | 2016-07-07 12:00 | 710K | |
| Seamus O'Leary - Understanding Digital Terrestrial Broadcasting.pdf | 2016-07-07 12:00 | 1.3M | |
| Scholl_BGPTE_N48.pdf | 2016-07-07 12:00 | 482K | |
| SaveVig.pdf | 2009-02-03 12:00 | 476K | |
| Sams PHP and MySQL Web Development 3rd Edition.pdf | 2015-09-04 12:00 | 11M | |
| Sams - Teach Yourself Apache 2 in 24 Hours - June 2002.pdf | 2015-09-04 12:00 | 8.9M | |
| Sams -- Teach Yourself Linux In 24 Hours, 2nd Edition.pdf | 2015-09-04 12:00 | 14M | |
| Sakovich_SIP_N48.pdf | 2016-07-07 12:00 | 32K | |
| Sahala_SIP_N48.pdf | 2016-07-07 12:00 | 243K | |
| SSTIC2014-BTA outil open-source d.analyse AD.pdf | 2018-01-07 12:00 | 637K | |
| SSTIC2014-BTA outil open-source d.analyse AD-slides.pdf | 2018-01-07 12:00 | 1.7M | |
| SSTIC09-article-XSS.pdf | 2016-07-07 12:00 | 32K | |
| SSTIC08-article-Pentesting.pdf | 2016-07-07 12:00 | 16K | |
| SSL_TLS_Deployment_Best_Practices.pdf | 2016-07-07 12:00 | 314K | |
| SSLVPN_conf_guide.pdf | 2016-07-07 12:00 | 2.9M | |
| SSLVPN Deployment Guide.pdf | 2016-07-07 12:00 | 235K | |
| SQQL Injection.pdf | 2016-07-07 12:00 | 32K | |
| SQL_Injection_Pocket_Reference.pdf | 2016-07-07 12:00 | 32K | |
| SQL_Injection.pdf | 2016-07-07 12:00 | 16K | |
| SQLInjectionWhitePaper.pdf | 2014-12-07 12:00 | 797K | |
| SQL Injection Attacks and Defense.pdf | 2014-12-07 12:00 | 3.3M | |
| SQL Injection.pdf | 2016-07-07 12:00 | 32K | |
| SQL INJECTION SECOND EDITIOn.pdf | 2016-07-07 12:00 | 21M | |
| SNA and TCP IP Integration Handbook 1999.pdf | 2014-12-07 12:00 | 10M | |
| SIPPhoneReleaseNotes7_5.pdf | 2016-04-08 12:00 | 202K | |
| SIPPhoneReleaseNotes7_4.pdf | 2016-04-09 12:00 | 126K | |
| SIPPhoneReleaseNotes7_3.pdf | 2016-04-09 12:00 | 131K | |
| SIPPhoneReleaseNotes7_2.pdf | 2016-04-08 12:00 | 169K | |
| SIPPhoneReleaseNotes6_3.pdf | 2016-04-08 12:00 | 169K | |
| SIPPhoneReleaseNotes6_2.pdf | 2016-04-09 12:00 | 155K | |
| SIPPhoneReleaseNotes.6.1.pdf | 2016-04-09 12:00 | 161K | |
| SIPPhoneReleaseNotes.6.0.pdf | 2016-04-08 12:00 | 181K | |
| SIPPhoneReleaseNotes.5.3.pdf | 2016-04-09 12:00 | 155K | |
| SIPPhoneReleaseNotes.5.2.pdf | 2016-04-09 12:00 | 156K | |
| SIPPhoneReleaseNotes.5.1.pdf | 2016-04-09 12:00 | 155K | |
| SIPPhoneReleaseNotes.5.0.pdf | 2016-04-09 12:00 | 161K | |
| SIPPhoneReleaseNotes.4.4.pdf | 2016-04-09 12:00 | 166K | |
| SIPPhoneReleaseNotes.4.3.pdf | 2016-04-09 12:00 | 154K | |
| SIPPhoneReleaseNotes.4.2.pdf | 2016-04-09 12:00 | 36K | |
| SIPPhoneReleaseNotes.4.1.pdf | 2016-04-09 12:00 | 155K | |
| SIPPhoneReleaseNotes.4.0.pdf | 2016-04-08 12:00 | 169K | |
| SIPPhoneReleaseNotes.3.2.pdf | 2016-04-09 12:00 | 67K | |
| SIPPhoneReleaseNotes.3.1.pdf | 2016-04-09 12:00 | 68K | |
| SIPPhoneReleaseNotes.3.0.pdf | 2016-04-09 12:00 | 55K | |
| SIPPhoneReleaseNotes.2.2.pdf | 2016-04-08 12:00 | 243K | |
| SIPPhoneReleaseNotes.2.1.pdf | 2016-04-08 12:00 | 170K | |
| SIPFacts.pdf | 2016-07-07 12:00 | 163K | |
| SEH Overwrites Simplified v1.01.pdf | 2016-07-07 12:00 | 32K | |
| SEH Overwrites Simplified.pdf | 2016-07-07 12:00 | 16K | |
| SEH Based Exploits.pdf | 2016-07-07 12:00 | 16K | |
| SEH Based Exploits - just another example.pdf | 2016-07-07 12:00 | 32K | |
| SECRETS OF LOCK PICKING GUIDE 2001.pdf | 2016-07-07 12:00 | 710K | |
| SECRETS OF LOCK PICKING.pdf | 2016-07-07 12:00 | 193K | |
| Running IPv6 2006.pdf | 2014-12-07 12:00 | 3.6M | |
| Rubianto_1263_doit_v2_lab19_sc.pdf | 2016-07-07 12:00 | 270K | |
| Rubianto_1263_doit_v2_lab19_ak.pdf | 2016-07-07 12:00 | 434K | |
| Rubianto_1263_doit_v2_lab17_sc.pdf | 2016-07-07 12:00 | 235K | |
| Rubianto_1263_doit_v2_lab17_ak.pdf | 2016-07-07 12:00 | 435K | |
| Rubianto_1263_doit_v2_lab16_sc.pdf | 2016-07-07 12:00 | 232K | |
| Rubianto_1263_doit_v2_lab16_ak.pdf | 2016-07-07 12:00 | 416K | |
| Rubianto_1263_doit_v2_lab15_sc.pdf | 2016-07-07 12:00 | 262K | |
| Rubianto_1263_doit_v2_lab15_ak.pdf | 2016-07-07 12:00 | 439K | |
| Rubianto_1263_doit_v2_lab14_sc.pdf | 2016-07-07 12:00 | 251K | |
| Rubianto_1263_doit_v2_lab14_ak.pdf | 2016-07-07 12:00 | 679K | |
| Rubianto_1263_doit_v2_lab8_sc.pdf | 2016-07-07 12:00 | 255K | |
| Rubianto_1263_doit_v2_lab8_ak.pdf | 2016-07-07 12:00 | 504K | |
| Rubianto_1263_doit_v2_lab7_sc.pdf | 2016-07-07 12:00 | 269K | |
| Rubianto_1263_doit_v2_lab7_ak.pdf | 2016-07-07 12:00 | 600K | |
| Rubianto_1263_doit_v2_lab4_sc.pdf | 2016-07-07 12:00 | 213K | |
| Rubianto_1263_doit_v2_lab4_ak.pdf | 2016-07-07 12:00 | 462K | |
| Routing-Bits Handbook CCIE R&S v4.3.pdf | 2016-07-07 12:00 | 71M | |
| Routers_Security.pdf | 2016-07-07 12:00 | 254K | |
| Router_SDM_WebVPN.pdf | 2016-07-07 12:00 | 1.1M | |
| Rootkits sous Oracle.pdf | 2016-07-07 12:00 | 32K | |
| Rootkits - Subverting the Windows Kernel.pdf | 2016-07-07 12:00 | 2.3M | |
| Rootkit Arsenal.pdf | 2016-07-07 12:00 | 81M | |
| RivestKaliski-RSAProblem.pdf | 2009-02-03 12:00 | 97K | |
| Right to left override unicode can be used in multiple spoofing cases.pdf | 2016-07-07 12:00 | 32K | |
| Reversing by warr.pdf | 2016-07-07 12:00 | 1.0M | |
| Reversing Encrypted Callbacks and COM Interfaces.pdf | 2016-07-07 12:00 | 1.2M | |
| Reversing CRC Theory and Practice.pdf | 2016-07-07 12:00 | 624K | |
| Reversing.pdf | 2016-07-07 12:00 | 1.0M | |
| Reversing & Malware Analysis Training Part 12 - Rootkit Analysis.pdf | 2016-07-07 12:00 | 5.3M | |
| Reversing & Malware Analysis Training Part 11 - Exploit Development Advanced.pdf | 2016-07-07 12:00 | 879K | |
| Reversing & Malware Analysis Training Part 10 - Exploit Development Basics.pdf | 2016-07-07 12:00 | 820K | |
| Reversing & Malware Analysis Training Part 9 - Advanced Malware Analysis.pdf | 2016-07-07 12:00 | 3.9M | |
| Reversing & Malware Analysis Training Part 8 - Malware Memory Forensics.pdf | 2016-07-07 12:00 | 1.8M | |
| Reversing & Malware Analysis Training Part 7 - Unpacking UPX.pdf | 2016-07-07 12:00 | 1.1M | |
| Reversing & Malware Analysis Training Part 6 - Practical Reversing (I).pdf | 2016-07-07 12:00 | 826K | |
| Reversing & Malware Analysis Training Part 5 - Reverse Engineering Tools Basics .pdf | 2016-07-07 12:00 | 1.1M | |
| Reversing & Malware Analysis Training Part 4 - Assembly Programming Basics .pdf | 2016-07-07 12:00 | 1.0M | |
| Reversing & Malware Analysis Training Part 3 - Windows PE File Format Basics.pdf | 2016-07-07 12:00 | 1.6M | |
| Reversing & Malware Analysis Training Part 2 - Introduction to Windows Internals.pdf | 2016-07-07 12:00 | 1.1M | |
| Reversing & Malware Analysis Training Part 1 - Lab Setup Guide.pdf | 2016-07-07 12:00 | 892K | |
| Reverse enginering.pdf | 2016-07-07 12:00 | 269K | |
| Reverse_Engineering_for_Beginners-en-A5.pdf | 2016-07-07 12:00 | 8.1M | |
| Reverse Engineering avec LD PRELOAD.pdf | 2016-07-07 12:00 | 32K | |
| Reverse-Engineering-Malware-Part1.pdf | 2016-07-07 12:00 | 940K | |
| ReportingAdminGuide.pdf | 2016-07-07 12:00 | 2.7M | |
| Redundancy and Load Sharing Design Guide.pdf | 2016-07-07 12:00 | 2.6M | |
| Red Hat Press -- Red Hat Linux Security and Optimization.pdf | 2015-09-04 12:00 | 5.1M | |
| Red Hat Press -- Red Hat Linux Networking and System Administration.pdf | 2015-09-04 12:00 | 7.8M | |
| Red Hat Linux Complete Command Reference.pdf | 2015-09-04 12:00 | 10M | |
| Red Hat Linux 7.2 Bible Unlimited Ed.pdf | 2015-09-04 12:00 | 6.4M | |
| Recuperation distante d informations.pdf | 2016-07-07 12:00 | 32K | |
| Reconsidering Physical Key Secrecy_ Teleduplication via Optical Decoding.pdf | 2016-07-07 12:00 | 3.4M | |
| ReallyUsefulEbooks_1847192645_Packt.Publishing.Network.Administration.with.FreeBSD.Mar.2008.pdf | 2015-09-04 12:00 | 6.6M | |
| ReallyUsefulEbooks.com_1430218916_Apress_Pro_OpenSolaris_April_2009.pdf | 2015-09-04 12:00 | 15M | |
| RS_Short-Notes-4.2.pdf | 2016-07-07 12:00 | 2.8M | |
| RSA_hardware_implementation.pdf | 2009-02-03 12:00 | 279K | |
| RSA Timing Attacks_Boneh.pdf | 2016-07-07 12:00 | 144K | |
| RSA Timing Attacks.pdf | 2016-07-07 12:00 | 80K | |
| RSA02.pdf | 2009-02-03 12:00 | 855K | |
| ROM_Monitor.pdf | 2016-07-07 12:00 | 317K | |
| RHUL-MA-2001-5.pdf | 2009-02-03 12:00 | 501K | |
| Quick Reference Guide.pdf | 2016-07-07 12:00 | 1.2M | |
| Queueing Networks And Markov Chains - Modelling And Performance Evaluation With Computer Science Applications.pdf | 2016-07-07 12:00 | 52M | |
| QC.pdf | 2009-02-03 12:00 | 1.8M | |
| Q931_Disconnect_Cause_Code_List.pdf | 2016-07-07 12:00 | 30K | |
| Professional_LAMP_-_Linux,_Apache,_MySQL,_and_PHP5_Web_Development_(Wrox-2006).pdf | 2015-09-04 12:00 | 7.1M | |
| Professional LAMP - Linux, Apache, MySQL, & PHP5 Web Development (2007).pdf | 2015-09-04 12:00 | 7.2M | |
| Problemes d authentification HTTP.pdf | 2016-07-07 12:00 | 16K | |
| Pro Nagios 2.0 (2006).pdf | 2015-09-04 12:00 | 3.3M | |
| Pro Linux System Administration (Apress, 2009, 1430219122).pdf | 2015-09-04 12:00 | 52M | |
| Private VLAN Catalyst Switch Support Matrix.pdf | 2016-07-07 12:00 | 13K | |
| Preventing Web App Hacking.pdf | 2016-07-07 12:00 | 32K | |
| Presence in a Unified World.pdf | 2016-07-07 12:00 | 9.9M | |
| Prentice Hall Building A Monitoring Infrastructure With Nagios Feb 2007.pdf | 2015-09-04 12:00 | 2.9M | |
| Practice of System and Network Administration-2nd Edition[2007].pdf | 2015-09-04 12:00 | 5.9M | |
| Practical VoIP Security 2006.pdf | 2014-12-07 12:00 | 9.7M | |
| Practical Packet Analysis.pdf | 2016-07-07 12:00 | 16M | |
| Practical Malware Analysis.pdf | 2016-07-07 12:00 | 9.4M | |
| Portable Command Guide.pdf | 2016-07-07 12:00 | 1.5M | |
| Policy Routing with Catalyst 3550 Series Switch.pdf | 2016-07-07 12:00 | 49K | |
| Planting and Extracting Sensitive Data From Your iPhone Subconscious.pdf | 2016-07-07 12:00 | 32K | |
| Pix-ASA.pdf | 2016-07-07 12:00 | 1.9M | |
| Perl Hacks Tips and Tools for Programming Debugging and Surviving - D. Conway, C. Poe - O'Reilly - 2006.pdf | 2015-09-04 12:00 | 1.9M | |
| Pentesting With Burp Suite.pdf | 2016-07-07 12:00 | 16K | |
| Pentest d une application Android.pdf | 2016-07-07 12:00 | 32K | |
| Penetration Test Report - 2013.pdf | 2016-07-07 12:00 | 32K | |
| Pcap Attack Trace - Forensic challenge.pdf | 2018-01-07 12:00 | 286K | |
| Part_III.pdf | 2009-02-03 12:00 | 520K | |
| Packt Publishing Zenoss Core Network and System Monitoring Jun 2008.pdf | 2015-09-04 12:00 | 13M | |
| Packt.Publishing.Understanding.TCP.IP.A.Clear.And.Comprehensive.Guide.Apr.2006.pdf | 2015-09-04 12:00 | 13M | |
| Packt.Publishing.Mastering.OpenLDAP.Aug.2007.pdf | 2015-09-04 12:00 | 11M | |
| Packt.Publishing.Designing.and.Implementing.Linux.Firewalls.with.QoS.Oct.2006.pdf | 2015-09-04 12:00 | 8.7M | |
| Packt.Publishing.Catalyst.Accelerating.Perl.Web.Application.Development.Nov.2007.pdf | 2015-09-04 12:00 | 4.2M | |
| Packer-analysis-report-debugging-unpacking-nspack-3.4-packer-3.7.pdf | 2016-07-07 12:00 | 4.7M | |
| PSec Virtual Tunnel Interface.pdf | 2016-07-07 12:00 | 248K | |
| PROGRESS ON CRYPTOGRAPHY 25 Years of Cryptography in China - Kefei Chen.pdf | 2014-12-07 12:00 | 5.0M | |
| PRE-RELEASE_The_Nagios_Book-05012006.pdf | 2015-09-04 12:00 | 376K | |
| PLEASE READ.pdf | 2016-07-07 12:00 | 243K | |
| PIX_command_guide_6.3.pdf | 2016-07-07 12:00 | 4.6M | |
| PIX-install.pdf | 2016-04-09 12:00 | 3.8M | |
| PHP LFI to arbitratry code execution via rfc1867 file upload temporary files.pdf | 2016-07-07 12:00 | 32K | |
| PC Games - How to Crack CD Protection.pdf | 2014-12-07 12:00 | 30K | |
| PB-472.pdf | 2009-02-03 12:00 | 157K | |
| P.Languages for Information Security.pdf | 2016-07-07 12:00 | 1.0M | |
| Overriding FILES array during uploading multiple files in php.pdf | 2016-07-07 12:00 | 32K | |
| Oreilly Lpi Linux Certification In A Nutshell 2Nd Edition Jul 2006-2.pdf | 2015-09-04 12:00 | 9.6M | |
| Oreilly Linux Networking Cookbook Nov 2007.pdf | 2015-09-04 12:00 | 4.5M | |
| Oreilly Apache Security Mar 2005 Ebook-Lib.pdf | 2015-09-04 12:00 | 1.9M | |
| Oreilly, Understanding Linux Network Internals (2005) Bbl Lotb.pdf | 2015-09-04 12:00 | 44M | |
| Oreilly, Bash Cookbook Solutions And Examples For Bash Users (2007) Bbl [0596526.pdf | 2015-09-04 12:00 | 3.2M | |
| Optimised Edge Routing.pdf | 2016-07-07 12:00 | 1.4M | |
| Optimisation des shellcodes sous Linux.pdf | 2016-07-07 12:00 | 32K | |
| Openssl Command-Line Howto.pdf | 2015-09-04 12:00 | 163K | |
| OpenVPN Building and Integrating Virtual Private Networks.pdf | 2015-09-04 12:00 | 9.3M | |
| Open Source Web Development with LAMP Using Linux, Apache, MySQL, Perl, and PHP.pdf | 2015-09-04 12:00 | 9.8M | |
| OpenSolaris Bible (Wiley, 2009, 0470385480).pdf | 2015-09-04 12:00 | 16M | |
| Open Capture the Flag 6 Whitepaper.pdf | 2016-07-07 12:00 | 32K | |
| OllyDbg 2.0 Brief Help.pdf | 2016-07-07 12:00 | 372K | |
| OllyDbg.pdf | 2016-07-07 12:00 | 446K | |
| Official Certification Guide.pdf | 2016-07-07 12:00 | 8.4M | |
| Oded_Goldreich-Foundations_of_Cryptography__Volume_2,_Basic_Applications-Cambridge_University_Press(2009).pdf | 2014-12-07 12:00 | 2.0M | |
| Oded_Goldreich-Foundations_of_Cryptography__Volume_2,_Basic_Applications(2009).pdf | 2014-12-07 12:00 | 1.9M | |
| Object-Oriented ActionScript For Flash 8 2006.pdf | 2014-12-07 12:00 | 13M | |
| OS X PostÂExploitation Command List.pdf | 2016-07-07 12:00 | 32K | |
| OS X For_Hackers_At_Heart_2005.pdf | 2016-07-07 12:00 | 15M | |
| OSPF-Core-Sample.pdf | 2016-07-07 12:00 | 48K | |
| OReilly.sendmail.4th.Edition.Oct.2007.pdf | 2015-09-04 12:00 | 7.2M | |
| OReilly.bash.Cookbook.May.2007.eBook-BBL.pdf | 2015-09-04 12:00 | 3.2M | |
| OReilly.Security.Power.Tools.Aug.2007.pdf | 2015-09-04 12:00 | 12M | |
| OReilly.Network.Warrior.Jun.2007.pdf | 2015-09-04 12:00 | 6.3M | |
| OReilly.Network.Security.Hacks.2nd.Edition.Oct.2006.eBook-BBL.pdf | 2015-09-04 12:00 | 3.8M | |
| OReilly.Mastering.Regular.Expressions.3rd.Edition.Aug.2006.pdf | 2015-09-04 12:00 | 9.9M | |
| OReilly.Mastering.Perl.Jul.2007.eBook-BBL.pdf | 2015-09-04 12:00 | 7.4M | |
| OReilly.Linux.System.Administration.Mar.2007.pdf | 2015-09-04 12:00 | 3.4M | |
| OReilly.Learning.the.vi.and.Vim.Editors.7th.Edition.Jul.2008.pdf | 2015-09-04 12:00 | 6.9M | |
| OReilly.Learning.Perl.5th.Edition.Jul.2008.eBook-DDU.pdf | 2015-09-04 12:00 | 7.6M | |
| OReilly.Essential.SNMP.2nd.Edition.Sep.2005.pdf | 2015-09-04 12:00 | 4.5M | |
| OReilly - Unix Backup and Recovery.pdf | 2015-09-04 12:00 | 5.6M | |
| OReIlly.High.Performance.MySQL.Second.Edition.Jun.2008.pdf | 2015-09-04 12:00 | 5.6M | |
| OREILLY-High_Performance_Linux_Clusters_with_OSCAR_Rocks_OpenMosix_and_MPI.pdf | 2015-09-04 12:00 | 8.1M | |
| OL11484.pdf | 2016-04-09 12:00 | 2.1M | |
| OFDM Broadband Wireless Networks Design and Optimization.pdf | 2016-07-07 12:00 | 14M | |
| O'reilly - Sed And Awk 2Nd Edition.pdf | 2015-09-04 12:00 | 3.9M | |
| O'reilly - Linux Kernel In A Nutshell - Dec 2006.pdf | 2015-09-04 12:00 | 6.3M | |
| O'reilly, Linux Server Security (2005), 2ed Lib Lotb.pdf | 2015-09-04 12:00 | 7.0M | |
| O'reilly,LinuxSecurity Cookbook (2003); Bm Ocr 6.0 Shareconnector.pdf | 2015-09-04 12:00 | 2.8M | |
| O'Reilly Linux eBook USING SAMBA.pdf | 2015-09-04 12:00 | 38M | |
| O'Reilly Exim The Mail Transfer Agent 2001-Jun.pdf | 2015-09-04 12:00 | 5.7M | |
| O'Reilly - Ssh The Secure Shell, The Definitive Guide.pdf | 2015-09-04 12:00 | 9.7M | |
| O'Reilly - Network Security with OpenSSL.pdf | 2015-09-04 12:00 | 2.4M | |
| O'Reilly - Lpi Linux Certification In A Nutshell (2007).pdf | 2015-09-04 12:00 | 7.6M | |
| O'Reilly - Linux Server Hacks--100 Industrial-Strenght Tips & Tools [2003].pdf | 2015-09-04 12:00 | 34M | |
| O'Reilly - Linux Security Cookbook (2003).pdf | 2015-09-04 12:00 | 2.8M | |
| O'Reilly - Building Embedded Linux Systems 2nd Edition 2008.pdf | 2015-09-04 12:00 | 4.2M | |
| O'Reilly - Asterisk- The Future of Telephony, 2nd Ed - Aug 2007.pdf | 2015-09-04 12:00 | 15M | |
| O'Reilly -- Linux Server Hacks.pdf | 2015-09-04 12:00 | 34M | |
| O'Reilly -- Learning Debian GNU Linux.pdf | 2015-09-04 12:00 | 7.7M | |
| O'Reilly,.Asterisk.The.Future.of.Telephony.(2005).Smokie.pdf | 2015-09-04 12:00 | 8.1M | |
| O'Reilly's - Learning the vi Editor, 6th Edition.pdf | 2015-09-04 12:00 | 1.9M | |
| No_Watermark_INE R&S v5.0 Vol 4 - All in one.pdf | 2016-07-07 12:00 | 2.7M | |
| No_Watermark_IEWB-RS-VOL-I-V5.Section.14.MPLS.VPN.0.04.pdf | 2016-07-07 12:00 | 229K | |
| No_Watermark_IEWB-RS-VOL-I-V5.Section.13.IP.Services.1.01.pdf | 2016-07-07 12:00 | 338K | |
| No_Watermark_IEWB-RS-VOL-I-V5.Section.12.System.Management.0.99.pdf | 2016-07-07 12:00 | 251K | |
| No_Watermark_IEWB-RS-VOL-I-V5.Section.11.Security.1.10.pdf | 2016-07-07 12:00 | 641K | |
| No_Watermark_IEWB-RS-VOL-I-V5.Section.10.QoS.1.00.pdf | 2016-07-07 12:00 | 2.2M | |
| No_Watermark_IEWB-RS-VOL-I-V5.Section.9.IPv6.1.01.pdf | 2016-07-07 12:00 | 392K | |
| No_Watermark_IEWB-RS-VOL-I-V5.Section.8.Multicast.0.06.pdf | 2016-07-07 12:00 | 558K | |
| No_Watermark_IEWB-RS-VOL-I-V5.Section.7.BGP.0.01.027-BigEdit.pdf | 2016-07-07 12:00 | 1.9M | |
| No_Watermark_IEWB-RS-VOL-I-V5.Section.6.OSPF.1.00.000.pdf | 2016-07-07 12:00 | 570K | |
| No_Watermark_IEWB-RS-VOL-I-V5.Section.5.EIGRP.0.99.003.pdf | 2016-07-07 12:00 | 250K | |
| No_Watermark_IEWB-RS-VOL-I-V5.Section.4.RIP.0.99.002.pdf | 2016-07-07 12:00 | 175K | |
| No_Watermark_IEWB-RS-VOL-I-V5.Section.3.IP.Routing.0.99.003.pdf | 2016-07-07 12:00 | 397K | |
| No_Watermark_IEWB-RS-VOL-I-V5.Section.2.Frame.Relay.1.01.013.pdf | 2016-07-07 12:00 | 141K | |
| No_Watermark_IEWB-RS-VOL-I-V5.Section.1.Bridging.and.Switching.1.04.005.pdf | 2016-07-07 12:00 | 423K | |
| No_Watermark_IEWB-RS-VOL-I-V5.Diagrams.1.00.pdf | 2016-07-07 12:00 | 97K | |
| No Starch Press - The TCP-IP Guide - A Comprehensive, Illustrated Internet Protocols Reference (2005) ISBN 159327047X.pdf | 2015-09-04 12:00 | 28M | |
| No Starch Press - The Book of PF - Jan 2008.pdf | 2015-09-04 12:00 | 7.3M | |
| No Starch Press - PGP and GPG Email for the Practical Paranoid.pdf | 2014-12-07 12:00 | 3.4M | |
| No Starch Press - Linux Firewalls (2007).pdf | 2015-09-04 12:00 | 6.5M | |
| No Starch Press - Cisco Routers for the Desperate (2004).pdf | 2015-09-04 12:00 | 12M | |
| No.Starch.The.Book.Of.Postfix.State.Of.The.Art.Message.Transport.Mar.2005.eBook-DDU.pdf | 2015-09-04 12:00 | 54M | |
| No.Starch.Press.Practical.Packet.Analysis.May.2007.eBook-BBL.pdf | 2015-09-04 12:00 | 10M | |
| No.Starch.Press.Absolute.FreeBSD.The.Complete.Guide.to.FreeBSD.2nd.Edition.Nov.2007.pdf | 2015-09-04 12:00 | 7.1M | |
| No.Starch,.Wicked.Cool.Perl.Scripts.Useful.Perl.Scripts.(2006).DDU.LotB.pdf | 2015-09-04 12:00 | 22M | |
| Nmap Network Scanning.pdf | 2016-07-07 12:00 | 424M | |
| Next Generation Web Attacks - HTML 5, DOM(L3) and XHR(L2).pdf | 2016-07-07 12:00 | 32K | |
| NewsKeyRecoverySVV10.pdf | 2011-03-03 12:00 | 932K | |
| Network Security With OpenSSL (2002).pdf | 2015-09-04 12:00 | 2.4M | |
| Network Security Hacks.pdf | 2015-09-04 12:00 | 38M | |
| Network Intrusion Detection.pdf | 2016-07-07 12:00 | 2.5M | |
| Network Attack.pdf | 2016-07-07 12:00 | 282K | |
| Network-Design-Cookbook_2nd-Edition.pdf | 2023-11-01 12:00 | 36M | |
| NarbikCCIE Trouble Shooting LabTICKETS.pdf | 2016-07-07 12:00 | 52M | |
| Nac95abs.pdf | 2009-02-03 12:00 | 87K | |
| NT.pdf | 2009-02-03 12:00 | 240K | |
| NMWd95ca.pdf | 2009-02-03 12:00 | 105K | |
| NLI CCIE Security Written 2006 toc.pdf | 2016-07-07 12:00 | 184K | |
| NLI CCIE Security Lab Guide V.1-2003.pdf | 2016-07-07 12:00 | 22M | |
| NLI CCIE R&S Lab Study Guide - V7.0.2006.pdf | 2016-07-07 12:00 | 709K | |
| NEW YY#LAB 5.pdf | 2016-07-07 12:00 | 631K | |
| NEW YY#LAB 4.pdf | 2016-07-07 12:00 | 1.6M | |
| NEW YY#LAB 3.pdf | 2016-07-07 12:00 | 2.1M | |
| NEW YY#LAB 2.pdf | 2016-07-07 12:00 | 866K | |
| NEW YY#LAB 1.pdf | 2016-07-07 12:00 | 1.5M | |
| NC-mag1.pdf | 2016-07-07 12:00 | 2.0M | |
| NC-mag1-2004- Le chemin du hacker.pdf | 2016-07-07 12:00 | 2.0M | |
| NBargisen_Multiservice_N48.pdf | 2016-07-07 12:00 | 50K | |
| MySQL 5.0 Certification Study Guide.pdf | 2015-09-04 12:00 | 17M | |
| MySQL.4th.Edition2008.pdf | 2015-09-04 12:00 | 6.3M | |
| Multicast over IPsec VPN Design Guide.pdf | 2016-07-07 12:00 | 568K | |
| Multicast in a Campus Network CGMP and IGMP Snooping.pdf | 2016-07-07 12:00 | 62K | |
| Multicast_over_IPsec_Design_Guide.pdf | 2016-07-07 12:00 | 568K | |
| Multicast Catalyst Switches Support Matrix.pdf | 2016-07-07 12:00 | 76K | |
| Multicarrier Techniques for 4G Mobile Communications.pdf | 2016-07-07 12:00 | 6.8M | |
| Modern Game Console Exploitation.pdf | 2016-07-07 12:00 | 221K | |
| Modern Cryptography Theory and Practice - Wenbo Mao.pdf | 2014-12-07 12:00 | 18M | |
| Mobile Pwn2Own Autumn 2013 - Chrome on Android - Exploit Writeup.pdf | 2016-07-07 12:00 | 32K | |
| Misc n37 Mai Juin 2008- DOS.pdf | 2016-07-07 12:00 | 32K | |
| Minimal_Perl_For_UNIX_And_Linux_People__2005_.pdf | 2015-09-04 12:00 | 5.7M | |
| Military Cryptanalysis.pdf | 2014-12-07 12:00 | 48M | |
| Microsoft Windows Scripting Self-Paced Learning Guide 2004.pdf | 2014-12-07 12:00 | 5.2M | |
| Microsoft SQL Server Passwords.pdf | 2016-07-07 12:00 | 32K | |
| Microsoft IIS 0Day Vulnerability in Parsing Files.pdf | 2016-07-07 12:00 | 32K | |
| Metro Ethernet.pdf | 2016-07-07 12:00 | 42M | |
| Metasploitation.pdf | 2018-01-07 12:00 | 642K | |
| Metasploit Toolkit For Penetration Testing, Exploit Development, And Vulnerability Research - Foster, Syngress 2007.pdf | 2015-09-04 12:00 | 4.8M | |
| Metasploit Toolkit.pdf | 2018-01-07 12:00 | 5.0M | |
| Metasploit Framework User Guide.pdf | 2018-01-07 12:00 | 242K | |
| Metasploit Framework 3.pdf | 2018-01-07 12:00 | 201K | |
| Metasploit Framework 2.pdf | 2018-01-07 12:00 | 428K | |
| Metasploit Framework 1.pdf | 2018-01-07 12:00 | 186K | |
| Metasploit-The Penetration Tester s Guide.pdf | 2018-01-07 12:00 | 6.9M | |
| Metasploit - The Penetration Testers Guide.pdf | 2016-07-07 12:00 | 6.9M | |
| Metasploit-Exploit automation and IPS evasion.pdf | 2018-01-07 12:00 | 642K | |
| Mesh-Based Survivable Networks Options and Strategies for Optical, MPLS, SONET, and ATM Networking.pdf | 2016-07-07 12:00 | 36M | |
| McGraw Hill - Web Applications (Hacking Exposed).pdf | 2014-12-07 12:00 | 7.6M | |
| McGraw Hill - Cisco Catalyst LAN Switching.pdf | 2016-07-07 12:00 | 5.3M | |
| McGraw.Hill.Osborne.Media.Ubuntu.Server.Administration.Nov.2008.pdf | 2015-09-04 12:00 | 14M | |
| McGraw.Hill.Linux.plus.Certification.Study.Guide.Aug.2007.pdf | 2015-09-04 12:00 | 28M | |
| McGraw.Hill.Linux.The.Complete.Reference.6th.Edition.Nov.(2008).pdf | 2015-09-04 12:00 | 8.9M | |
| McGraw.Hill.HackNotes.Windows.Security.Portable.Reference.eB.pdf | 2014-12-07 12:00 | 4.8M | |
| McGraw.Hill.HackNotes.Web.Security.Portable.Reference.eBook-DDU.pdf | 2014-12-07 12:00 | 3.4M | |
| McGraw.Hill.HackNotes.Network.Security.Portable.Reference.eBook-DDU.pdf | 2014-12-07 12:00 | 3.6M | |
| McGraw.Hill.HackNotes.Linux.and.Unix.Security.Portable.Reference.eBook-DDU.pdf | 2014-12-07 12:00 | 3.4M | |
| McGraw-Hill - Linux and Unix Security Portable Reference.pdf | 2014-12-07 12:00 | 3.5M | |
| McGraw-Hill - Hacking Exposed, 3rd Ed - Hacking Exposed Win2.pdf | 2014-12-07 12:00 | 5.9M | |
| McGraw-Hill - CCSP - Cisco Certified Security Professional Certification All-in-One Exam Guide.pdf | 2016-07-07 12:00 | 17M | |
| McGraw-Hill - CCSP - Cisco Certified Security Professional Certification All-in-One Exam Guide (Exams SECUR,CSPFA, CSVPN, CSIDS, and CSI).pdf | 2016-07-07 12:00 | 17M | |
| Maximum Apache Security - SAMS - June 2002.pdf | 2015-09-04 12:00 | 3.3M | |
| Mastering FreeBSD and OpenBSD Security - O'Reilly - March 2005.pdf | 2015-09-04 12:00 | 39M | |
| Martini_MPLS_N48.pdf | 2016-07-07 12:00 | 811K | |
| Manual Unpacking d Anti007 2.5.pdf | 2016-07-07 12:00 | 376K | |
| Managing Internet-Driven Change in International Telecommunications.pdf | 2016-07-07 12:00 | 3.6M | |
| ManagedCodeRootkits.pdf | 2016-07-07 12:00 | 5.6M | |
| Malware Unpacking & Analysis.pdf | 2016-07-07 12:00 | 540K | |
| Malware Analysts Cookbook.pdf | 2016-07-07 12:00 | 8.9M | |
| Malware Analysis Training_2011_12_Articles.pdf | 2016-07-07 12:00 | 1.9M | |
| Malware & Rootkits.pdf | 2016-07-07 12:00 | 11M | |
| Malicious Cryptography Exposing Cryptovirology - Adam Young.pdf | 2014-12-07 12:00 | 29M | |
| Malicious Cryptography - Kleptographic Aspects (Academic Paper).pdf | 2016-07-07 12:00 | 168K | |
| Malicious Cryptography - Exposing Cryptovirology.pdf | 2016-07-07 12:00 | 29M | |
| MTU_TCPMSS_PMTUD.pdf | 2016-07-07 12:00 | 28K | |
| MTI Guide To Lockpicking.pdf | 2016-07-07 12:00 | 509K | |
| MSCE - Network tools and troubleshooting.pdf | 2015-09-04 12:00 | 245K | |
| MIT Guide To Lockpicking.pdf | 2016-07-07 12:00 | 509K | |
| MISC-N42.pdf | 2016-07-07 12:00 | 27M | |
| MA_SPS-2003_286971_156-1_v1.pdf | 2016-07-07 12:00 | 9.9M | |
| MA_SESSION-02_285345_156-1_v1.pdf | 2016-07-07 12:00 | 14M | |
| MA_SESSION-01_285343_156-1_v1.pdf | 2016-07-07 12:00 | 8.0M | |
| MA_LABNMS-2001_285018_156-1_v1.pdf | 2016-07-07 12:00 | 139K | |
| MA_LABDCT-2002_285013_156-1_v3.pdf | 2016-07-07 12:00 | 407K | |
| MA_LABDCT-2002_285013_156-1_v2.pdf | 2016-07-07 12:00 | 407K | |
| MA_LABDCT-2002_285013_156-1_v1.pdf | 2016-07-07 12:00 | 5.3M | |
| MA_LABAPP-1002_285022_156-1_v2.pdf | 2016-07-07 12:00 | 730K | |
| MA_LABAPP-1002_285022_156-1_v1.pdf | 2016-07-07 12:00 | 1.8M | |
| MA_CCS-1004_285201_156-1_v1.pdf | 2016-07-07 12:00 | 554K | |
| MA_BRKUCT-3012_284393_156-1_v1.pdf | 2016-07-07 12:00 | 5.0M | |
| MA_BRKUCT-2010_284391_156-1_v1.pdf | 2016-07-07 12:00 | 15M | |
| MA_BRKSEC-3012_284408_156-1_v1.pdf | 2016-07-07 12:00 | 10M | |
| MA_BRKSEC-3006_284402_156-1_v1.pdf | 2016-07-07 12:00 | 22M | |
| MA_BRKSEC-3003_284398_156-1_v1.pdf | 2016-07-07 12:00 | 14M | |
| MA_BRKNMS-3007_284376_156-1_v1.pdf | 2016-07-07 12:00 | 3.6M | |
| MA_BRKNMS-3006_284375_156-1_v1.pdf | 2016-07-07 12:00 | 543K | |
| MA_BRKNMS-3004_284373_156-1_v1.pdf | 2016-07-07 12:00 | 620K | |
| MA_BRKNMS-2011_284380_156-1_v1.pdf | 2016-07-07 12:00 | 2.6M | |
| MA_BRKMWI-3006_284367_156-1_v1.pdf | 2016-07-07 12:00 | 2.6M | |
| MA_BRKMWI-2008_284369_156-1_v1.pdf | 2016-07-07 12:00 | 2.6M | |
| MA_BRKMWI-2004_284365_156-1_v1.pdf | 2016-07-07 12:00 | 1.3M | |
| MA_BRKMWI-2002_284363_156-1_v1.pdf | 2016-07-07 12:00 | 5.4M | |
| MA_BRKIPM-3018_284360_156-1_v1.pdf | 2016-07-07 12:00 | 1.9M | |
| MA_BRKIPM-3014_284356_156-1_v1.pdf | 2016-07-07 12:00 | 843K | |
| MA_BRKIPM-3011_284353_156-1_v1.pdf | 2016-07-07 12:00 | 2.1M | |
| MA_BRKIPM-3008_284350_156-1_v1.pdf | 2016-07-07 12:00 | 880K | |
| MA_BRKIPM-3007_284349_156-1_v1.pdf | 2016-07-07 12:00 | 2.6M | |
| MA_BRKIPM-3006_284348_156-1_v1.pdf | 2016-07-07 12:00 | 597K | |
| MA_BRKIPM-3005_284347_156-1_v1.pdf | 2016-07-07 12:00 | 1.0M | |
| MA_BRKIPM-3003_284345_156-1_v1.pdf | 2016-07-07 12:00 | 1.1M | |
| MA_BRKIPM-2015_284357_156-1_v1.pdf | 2016-07-07 12:00 | 1.0M | |
| MA_BRKDCT-3009_284342_156-1_v1.pdf | 2016-07-07 12:00 | 1.4M | |
| MA_BRKDCT-3008_284341_156-1_v1.pdf | 2016-07-07 12:00 | 2.5M | |
| MA_BRKDCT-2007_284340_156-1_v1.pdf | 2016-07-07 12:00 | 2.4M | |
| MA_BRKDCT-2004_284337_156-1_v1.pdf | 2016-07-07 12:00 | 1.1M | |
| MA_BRKDCT-2002_284335_156-1_v1.pdf | 2016-07-07 12:00 | 1.6M | |
| MA_BRKDCT-2001_284334_156-1_v1.pdf | 2016-07-07 12:00 | 3.0M | |
| MA_BRKCAM-3012_284333_156-1_v1.pdf | 2016-07-07 12:00 | 635K | |
| MA_BRKCAM-3006_284327_156-1_v1.pdf | 2016-07-07 12:00 | 2.8M | |
| MA_BRKCAM-3005_284326_156-1_v1.pdf | 2016-07-07 12:00 | 2.0M | |
| MA_BRKCAM-3004_284325_156-1_v1.pdf | 2016-07-07 12:00 | 1.7M | |
| MA_BRKCAM-3002_284323_156-1_v1.pdf | 2016-07-07 12:00 | 1.4M | |
| MA_BRKBBA-3012_284319_156-1_v1.pdf | 2016-07-07 12:00 | 908K | |
| MA_BRKBBA-3009_284315_156-1_v1.pdf | 2016-07-07 12:00 | 1.5M | |
| MA_BRKBBA-3002_284306_156-1_v1.pdf | 2016-07-07 12:00 | 3.2M | |
| MA_BRKBBA-2013_284320_156-1_v1.pdf | 2016-07-07 12:00 | 1.6M | |
| MA_BRKBBA-2004_284309_156-1_v1.pdf | 2016-07-07 12:00 | 1.4M | |
| MA_BRKAPP-2006_284298_156-1_v1.pdf | 2016-07-07 12:00 | 2.3M | |
| Lutte Anti-Virus 2005.pdf | 2016-07-07 12:00 | 509K | |
| Lucas - PGP & GPG - Email for the Practical Paranoid (No Starch, 2006).pdf | 2015-09-04 12:00 | 3.4M | |
| Lockpicking - How Lock Picking Works.pdf | 2016-07-07 12:00 | 1.1M | |
| LoadBalance.pdf | 2016-07-07 12:00 | 15K | |
| Linux Server Hacks 2003.pdf | 2015-09-04 12:00 | 34M | |
| Linux Server Hacks.pdf | 2016-07-07 12:00 | 34M | |
| Linux Network Administration Guide - From The O'Reilly Anthology.pdf | 2015-09-04 12:00 | 3.8M | |
| Linux Kernel Embedded Systems Building Blocks, Second Edition.pdf | 2015-09-04 12:00 | 6.5M | |
| Linux Firewalls.pdf | 2016-07-07 12:00 | 6.5M | |
| Linux Firewalls, 3rd edition (Novell Press, 2005).pdf | 2015-09-04 12:00 | 47M | |
| Linux Email, 2nd Edition November 2009.pdf | 2015-09-04 12:00 | 8.9M | |
| Linux Command Line and Shell Scripting Bible May.2008.pdf | 2015-09-04 12:00 | 14M | |
| LinuxChiffrement.pdf | 2009-02-03 12:00 | 399K | |
| Linux Bible 2008 Edition.pdf | 2015-09-04 12:00 | 26M | |
| Linux Administration A Beginner's Guide Fifth.Edition Sep.2008.pdf | 2015-09-04 12:00 | 11M | |
| Linux 101 - Configuring and managing iptables for better network security.pdf | 2015-09-04 12:00 | 90K | |
| Linux-security.pdf | 2016-07-07 12:00 | 122K | |
| Linux-Unix-BSD PostÂExploitation Command List.pdf | 2016-07-07 12:00 | 32K | |
| Learnkey - Linux - Rhce Certified Engineer10 - Systems Administration And Security.pdf | 2015-09-04 12:00 | 492K | |
| Learning_Nagios_3.0_[eBook]_18052009_96993.pdf | 2015-09-04 12:00 | 6.5M | |
| Learning Debian Gnu-Linux - Bill Mccarty(1999).pdf | 2015-09-04 12:00 | 9.3M | |
| LRL.pdf | 2016-07-07 12:00 | 2.0M | |
| LPI Linux Certification in a Nutshell.pdf | 2015-09-04 12:00 | 7.6M | |
| LPIC 1 Certification Bible - [Hungry Minds].pdf | 2015-09-04 12:00 | 6.0M | |
| LINUX - Installing Squid with Active Directory Authentication.pdf | 2015-09-04 12:00 | 73K | |
| LDAP injection.pdf | 2016-07-07 12:00 | 32K | |
| LDAP Injection and Blind LDAP Injection In Web Applications.pdf | 2016-07-07 12:00 | 32K | |
| LDAP Injection and Blind LDAP Injection.pdf | 2016-07-07 12:00 | 32K | |
| LANGAGE SQL _ SYNTAXE D_EXTRACTION DES DONNEES.pdf | 2016-07-07 12:00 | 16K | |
| L.Injection SQL.pdf | 2016-07-07 12:00 | 32K | |
| Knowledgenet BSCI 2.1.pdf | 2016-07-07 12:00 | 19M | |
| Knowledgenet.Securing.Cisco.IOS.Networks.Express.SECUR.1.1.Student.Guide.Dec.2003.eBook-DDU.pdf | 2016-07-07 12:00 | 9.6M | |
| Knowledgenet.Cisco.Implementing.Quality.of.Service.QOS.V2.0.pdf | 2016-07-07 12:00 | 26M | |
| Knowledgenet.Cisco.Building.Cisco.Multilayer.Switched.Networks.BCMSN.Student.Guide.V2.2.Vol2.pdf | 2016-07-07 12:00 | 3.8M | |
| Knowledgenet.Cisco.Building.Cisco.Multilayer.Switched.Networks.BCMSN.Student.Guide.V2.2.Vol1.pdf | 2016-07-07 12:00 | 4.4M | |
| KnowledgeNet Cisco IP Telephony (CIPT) 3.3 Student Guide.pdf | 2016-07-07 12:00 | 7.2M | |
| KnowledgeNet CSIDS 4.1 Student Guide.pdf | 2016-07-07 12:00 | 30M | |
| KnowledgeNet.Cisco.Secure.Virutal.Private.Networks.CSVPN.Student.Guide.V4.0.pdf | 2016-07-07 12:00 | 16M | |
| Knet CSVPN v4.7.pdf | 2016-07-07 12:00 | 21M | |
| Keylogging the google search with a jpg- Introduction to $_SERVER Superglobals Sniffing (P3lo).pdf | 2016-07-07 12:00 | 32K | |
| Keychain Analysis with Mac OS X Memory Forensics.pdf | 2018-01-07 12:00 | 1.2M | |
| Kevin_Mitnick_-_The_Art_of_Intrusion.pdf | 2016-07-07 12:00 | 3.1M | |
| Kevin_Mitnick_-_The_Art_of_Deception.pdf | 2016-07-07 12:00 | 5.2M | |
| Kevin Mitnick - The Art of Intrusion.pdf | 2016-07-07 12:00 | 3.1M | |
| Kevin Mitnick - The Art of Deception.pdf | 2016-07-07 12:00 | 5.2M | |
| KNet CCVP Implementing Cisco Voice Gateways and Gatekeepers (GWGK) v1.0.pdf | 2016-07-07 12:00 | 12M | |
| KNOWLEDGENET.CISCO.ICND.STUDENT.GUIDE.VERSION.2.1.pdf | 2015-09-04 12:00 | 6.2M | |
| KNOWLEDGENET.CISCO.EVODD.STUDENT.GUIDE.VERSION.3.3.pdf | 2015-09-04 12:00 | 5.6M | |
| KNOWLEDGENET.CISCO.CVOICE.STUDENT.GUIDE.VERSION.4.1.pdf | 2015-09-04 12:00 | 14M | |
| KNOWLEDGENET.CISCO.CSPFA.STUDENT.GUIDE.VERSION.3.2.pdf | 2015-09-04 12:00 | 6.9M | |
| KNOWLEDGENET.CISCO.CIT.STUDENT.GUIDE.VERSION.5.1.pdf | 2015-09-04 12:00 | 3.8M | |
| KNOWLEDGENET.CISCO.CATALYST.6500.STUDENT.GUIDE.VERSION.1.pdf | 2015-09-04 12:00 | 24M | |
| KNOWLEDGENET.CISCO.BCRAN.STUDENT.GUIDE.VERSION.2.1.pdf | 2015-09-04 12:00 | 16M | |
| KNOWLEDGENET.CISCO.BCMSN.STUDENT.GUIDE.VERSION.2.1.pdf | 2015-09-04 12:00 | 13M | |
| Just Java 2 6th.Edition.pdf | 2015-09-04 12:00 | 2.5M | |
| Jumbo_Giant Frame Support on Catalyst Switches Configuration Example.pdf | 2016-07-07 12:00 | 27K | |
| Jonathan_Katz,_Yehuda_Lindell-Introduction_to_Modern_Cryptography__Principles_and_Protocols-Chapman_and_Hall_CRC(2007).pdf | 2014-12-07 12:00 | 7.7K | |
| John Wiley and Sons - JavaScript in 10 Steps or Less.pdf | 2015-09-04 12:00 | 14M | |
| John Wiley and Sons - 250 HTML and Web Design Secrets - Molly E. Holzschlag 2004.pdf | 2015-09-04 12:00 | 24M | |
| John Wiley And Sons Assembly Language Step-by-Step Programming with DOS and Linux 2nd Ed.pdf | 2015-09-04 12:00 | 4.2M | |
| John Wiley & Sons - hidden financial risk.pdf | 2015-09-04 12:00 | 1.8M | |
| John Wiley & Sons - XML 1.1 Bible, Third Edition.pdf | 2015-09-04 12:00 | 18M | |
| John Wiley & Sons - Smart Card Handbook.pdf | 2015-09-04 12:00 | 17M | |
| John Wiley & Sons - Microsoft Office Project 2003 Bible.pdf | 2015-09-04 12:00 | 43M | |
| John Wiley & Sons - Managing the Risks of Payment System.pdf | 2015-09-04 12:00 | 3.8M | |
| John Wiley & Sons - Making Use of JavaScript.pdf | 2015-09-04 12:00 | 6.9M | |
| John Wiley & Sons - Linux Bible, 2005 Edition.pdf | 2015-09-04 12:00 | 15M | |
| John Wiley & Sons - Leap A Revolution In Creative Business Strategy.pdf | 2015-09-04 12:00 | 2.0M | |
| John Wiley & Sons - J2EE Best Practices Java Design Patterns Automation and Performance.pdf | 2015-09-04 12:00 | 4.3M | |
| John Wiley & Sons - Implementing SSH - Strategies For Optimizing - The Secure Shell - 2004.pdf | 2015-09-04 12:00 | 6.9M | |
| John Wiley & Sons - EJB & JSP Java on the Edge.pdf | 2015-09-04 12:00 | 2.8M | |
| John Wiley & Sons - 2005 - Wiley Series on Treating Addictions - Treating Drug Problems - ISBN 0471484830 - 338 - YYePG.pdf | 2015-09-04 12:00 | 3.3M | |
| John Wiley & Sons - 2005 - The Management Bible - ISBN 0471705454 - 304s - LinG.pdf | 2015-09-04 12:00 | 2.3M | |
| John Wiley & Sons - 2005 - Freud A to Z - ISBN 0471468681 - 256s - YYePG.pdf | 2015-09-04 12:00 | 2.4M | |
| John Wiley & Sons - 2005 - Feed Your Genes Right. Eat to Turn Off Disease-Causing Genes and Slow Down Aging - ISBN 0471479861 - 273s - YYePG.pdf | 2015-09-04 12:00 | 1.6M | |
| John Wiley & Sons - 2005 - Beyond Governance. Creating Corporate Value through Performance, Conformance and Responsibility - ISBN 0470011513 - 339s - TLFeBOOK.pdf | 2015-09-04 12:00 | 2.9M | |
| John Wiley & Sons - 2004 - The Art & Science of Interpreting Market Research Evidence - ISBN 0470844248 - 250s - YYePG.pdf | 2015-09-04 12:00 | 2.5M | |
| John Wiley & Sons - 2004 - Statistics in Practice - Practical Methods for Design and Analysis of Complex Surveys, 2nd Edition - ISBN 0470847697 - 362s - TLFeBOOK.pdf | 2015-09-04 12:00 | 5.1M | |
| John.Wiley and.Sons.The Fat-Burning.Bible.28.Days.of.Foods.Supplements.and.Workouts.that.Help.You.Lose.Weight-2005.pdf | 2015-09-04 12:00 | 4.2M | |
| John.Wiley.and.Sons.XML.in.60.Minutes.a.Day.eBook-DDU.pdf | 2015-09-04 12:00 | 94M | |
| John.Wiley.and.Sons.XML.Programming.Bible.May.2004.eBook-DDU.pdf | 2015-09-04 12:00 | 15M | |
| John.Wiley.and.Sons.Unix.for.Mac.Your.visual.blueprint.to.maximizing.the.foundation.of.Mac.OS.X.eBook-kB.pdf | 2015-09-04 12:00 | 28M | |
| John.Wiley.and.Sons.The.Easy.Guide.to.Repertory.Grids.pdf | 2015-09-04 12:00 | 3.1M | |
| John.Wiley.and.Sons.The.CISSP.Prep.Guide.Mastering.the.CISSP.and.ISSEP.Exams.Second.Edition.Apr.2.pdf | 2015-09-04 12:00 | 21M | |
| John.Wiley.and.Sons.The.Art.of.Intrusion.The.Real.Stories.Behind.the.Exploits.of.Hackers.pdf | 2015-09-04 12:00 | 3.1M | |
| John.Wiley.and.Sons.Programming.Java.2.Micro.Edition.for.Symbian.OS.Jul.2004.eBook-DDU.pdf | 2015-09-04 12:00 | 5.7M | |
| John.Wiley.and.Sons.PHP5.and.MySQL.Bible.Apr.2004.eBook-DDU.pdf | 2015-09-04 12:00 | 16M | |
| John.Wiley.and.Sons.PHP.and.MySQL.for.Dummies.Second.Edition.Mar.2004.pdf | 2015-09-04 12:00 | 9.5M | |
| John.Wiley.and.Sons.Oracle.XSQL.eBook-DDU.pdf | 2015-09-04 12:00 | 6.7M | |
| John.Wiley.and.Sons.MySQL.and.Java.Developers.Guide.eBook-KB.pdf | 2015-09-04 12:00 | 4.1M | |
| John.Wiley.and.Sons.Linux.Timesaving.Techniques.For.Dummies.Jul.2004.eBook-DDU.pdf | 2015-09-04 12:00 | 15M | |
| John.Wiley.and.Sons.JavaScript.Bible.5th.Edition.eBook-DDU.pdf | 2015-09-04 12:00 | 24M | |
| John.Wiley.and.Sons.Java.2.Enterprise.Edition.1.4.J2EE.1.4.Bible.eBook-DDU.pdf | 2015-09-04 12:00 | 13M | |
| John.Wiley.and.Sons.Hacking.Windows.XP.Jul.2004.eBook-DDU.pdf | 2015-09-04 12:00 | 10M | |
| John.Wiley.and.Sons.Dynamic.Enterprise.Architecture.How.to.Make.It.Work.Jan.2005.eBook-DDU.pdf | 2015-09-04 12:00 | 1.9M | |
| John.Wiley.and.Sons.A.Networking.Approach.to.Grid.Computing.pdf | 2015-09-04 12:00 | 7.9M | |
| John.Wiley.Sons.Mission.Critical.Security.Planner.pdf | 2015-09-04 12:00 | 2.2M | |
| John.Wiley.Sons. Beginning.Linux.Programming,Third.Edition.pdf | 2015-09-04 12:00 | 11M | |
| John.Wiley.And.Sons.MySQL.PHP.Database.Applications.2nd.Edition.eBook-LiB.pdf | 2015-09-04 12:00 | 5.5M | |
| John.Wiley.And.Sons.MySQL.Enterprise.Solutions.eBook-LiB.pdf | 2015-09-04 12:00 | 2.8M | |
| John.Wiley.And.Sons.More.Java.Pitfalls.eBook-LiB.pdf | 2015-09-04 12:00 | 3.9M | |
| John.Wiley.And.Sons.Mission.Critical.Security.Planner.eBook-LiB.pdf | 2015-09-04 12:00 | 2.3M | |
| John.Wiley.And.Sons.Mastering.JBuilder.eBook-LiB.pdf | 2015-09-04 12:00 | 10M | |
| John.Wiley.And.Sons.Dictionary.Of.e-business.A.Definitive.Guide.To.Technology.And.Business.Term.pdf | 2015-09-04 12:00 | 2.4M | |
| John.Wiley.And.Sons.Beginning.Programming.For.Dummies.3rd.Edition.pdf | 2015-09-04 12:00 | 7.9M | |
| John.Wiley.And.Son.More.Java.Pitfalls.pdf | 2015-09-04 12:00 | 3.9M | |
| Jessica.Kingsley.Pub.A.Matter.Of.Security.pdf | 2015-09-04 12:00 | 1.5M | |
| Jesse Liberty. C++ Unleashed (SAMS).pdf | 2015-09-04 12:00 | 4.0M | |
| Javascript In 10 Simple Steps Or Less 2004.pdf | 2014-12-07 12:00 | 14M | |
| Java Web Services.pdf | 2015-09-04 12:00 | 2.9M | |
| JavaServer Pages, 2nd Edition.pdf | 2015-09-04 12:00 | 3.0M | |
| Java NIO.pdf | 2015-09-04 12:00 | 2.9M | |
| Java Cryptography - Jonathan B. Knudsen.pdf | 2014-12-07 12:00 | 1.5M | |
| Java.Servlet Programming.pdf | 2015-09-04 12:00 | 8.8M | |
| Java - JavaScript Bible Gold(2001).pdf | 2015-09-04 12:00 | 35M | |
| Jasinska_RouteServer_N48.pdf | 2016-07-07 12:00 | 924K | |
| James A. Freeman - Artificial Intelligence - Neural Networks, Algorithms, Applications and Programming Techniques.pdf | 2015-09-04 12:00 | 10M | |
| JSP_tutorial.pdf | 2015-09-04 12:00 | 225K | |
| JIST Publishing - America's Top Computer and Technical Jobs.pdf | 2015-09-04 12:00 | 8.4M | |
| Intrusion_Detection_Systems_with_Snort_Advanced.May2003.PearsonEducation.RR.pdf | 2015-09-04 12:00 | 3.7M | |
| Intrusion Detection Planning Guide.pdf | 2016-07-07 12:00 | 199K | |
| Intro to ASP.NET (VBL).pdf | 2015-09-04 12:00 | 327K | |
| Introduction to various file infection techniques.pdf | 2016-07-07 12:00 | 469K | |
| Introduction to UML - Structural and Use Case Modeling.pdf | 2015-09-04 12:00 | 1.2M | |
| Introduction to GPS The Global Positioning System.pdf | 2016-07-07 12:00 | 2.9M | |
| Introduction To Ip And Atm Design And Performance - Second Edition.pdf | 2016-07-07 12:00 | 2.3M | |
| Intro Reverse et Patch Android.pdf | 2016-07-07 12:00 | 1.8M | |
| IntroCrypto_fr.pdf | 2009-02-03 12:00 | 2.8M | |
| Intro-Linux.pdf | 2015-09-04 12:00 | 815K | |
| Internetworking Technologies Handbook, Fourth Edition.pdf | 2016-07-07 12:00 | 22M | |
| Internet Security.pdf | 2015-09-04 12:00 | 3.6M | |
| Interdomain Multicast Routing - Practical Juniper Networks And Cisco Systems Solutions.pdf | 2016-07-07 12:00 | 2.8M | |
| InterVLAN_Routing.pdf | 2016-07-07 12:00 | 236K | |
| InterVLAN Routing on Layer 3 Switches.pdf | 2016-07-07 12:00 | 29K | |
| Integrating Linux and Windows - Prentice Hall.pdf | 2015-09-04 12:00 | 4.2M | |
| Installshield - Authoring Net Installations (Vbl).pdf | 2015-09-04 12:00 | 1.1M | |
| Installing and Upgrading Memory in Cisco 1700 Series Routers.pdf | 2016-07-07 12:00 | 1.3M | |
| InstallShield AdminStudio Getting Started Guide.pdf | 2015-09-04 12:00 | 2.8M | |
| Inside a ZeuS botnet part1.pdf | 2016-07-07 12:00 | 1.8M | |
| Inside_Cyber_Warfare_Mapping_.pdf | 2016-07-07 12:00 | 14M | |
| Inside_ASP.NET_Web_Matrix (VBL).pdf | 2015-09-04 12:00 | 5.5M | |
| InsideNuclearsCore_UnravelingMalwarewareasaService.pdf | 2016-07-07 12:00 | 4.0M | |
| Inside-Nuclear-1-2.pdf | 2016-07-07 12:00 | 1.3M | |
| Incident Handling Step by Step (SANS).pdf | 2015-09-04 12:00 | 493K | |
| InciResTlkit.pdf | 2015-09-04 12:00 | 4.8M | |
| Implementing SELinux as a Linux Security Module.pdf | 2016-07-07 12:00 | 32K | |
| Implementing Cisco IP Telephony and Video, Part 2 (CIPTV2) Foundation Learning Guide (CCNP Collaboration Exam 300-075 CIPTV2), 3rd Edition TEchnet24.pdf | 2016-05-29 12:00 | 26M | |
| Implementing.and Administering Security in a Windows 2000 Network.pdf | 2015-09-04 12:00 | 15M | |
| Imperva_HII_HTTP2.pdf | 2016-08-03 12:00 | 6.1M | |
| Image and Video Encryption From Digital Rights Management to Secured Personal Communication - Sushil Jajodia.pdf | 2014-12-07 12:00 | 7.7M | |
| Illustrated Telecom Dictionary.pdf | 2016-07-07 12:00 | 57M | |
| Illustrated TCPIP.pdf | 2015-09-04 12:00 | 6.1M | |
| Illustrated TCP-IP - A Graphic Guide To The Protocol Suite 1999.pdf | 2014-12-07 12:00 | 6.1M | |
| Illustrated Secrets Of Lockpicking.pdf | 2016-07-07 12:00 | 193K | |
| Identity Management.pdf | 2016-07-07 12:00 | 3.7M | |
| ITSecurityHandbook.pdf | 2015-09-04 12:00 | 2.7M | |
| IT.Week.Magazine.Apr.04.2005.pdf | 2015-09-04 12:00 | 5.1M | |
| IS_IS_BGP_convergence.pdf | 2016-07-07 12:00 | 349K | |
| ISR_II_3845.pdf | 2016-07-07 12:00 | 1.1M | |
| ISR_II_2851.pdf | 2016-07-07 12:00 | 1.1M | |
| ISR_II_2811.pdf | 2016-07-07 12:00 | 1.0M | |
| ISR_II_2801.pdf | 2016-07-07 12:00 | 1.1M | |
| ISR_II_1841.pdf | 2016-07-07 12:00 | 463K | |
| IRM.Press.Mobile.And.Wireless.Systems.Beyond.3G.Managing.New.Business.Opportunities.Mar.2005.eBook-DDU.pdf | 2015-09-04 12:00 | 7.6M | |
| IPsec_VPN_WAN_Design.pdf | 2016-07-07 12:00 | 619K | |
| IPexpert_Security3.1_Workbook_eBook_Cracked_STAR.pdf | 2016-07-07 12:00 | 58M | |
| IPexpert_Security3.1_Workbook_eBook.pdf | 2016-07-07 12:00 | 58M | |
| IP_Communication_Solution_for_Group_Applications_Configuration_Example.pdf | 2016-07-07 12:00 | 1.7M | |
| IPSec_Prefragment.pdf | 2016-07-07 12:00 | 72K | |
| IPSec Network Security ipsec.pdf | 2015-09-04 12:00 | 219K | |
| IPS.pdf | 2016-07-07 12:00 | 567K | |
| IP Quality of Service - CCIE - Cisco press 2002.pdf | 2016-07-07 12:00 | 5.1M | |
| IPExpert_CCIE_Warmup_2.pdf | 2016-07-07 12:00 | 1.3M | |
| IPExpert_CCIE_Warmup_1.pdf | 2016-07-07 12:00 | 1.2M | |
| IPExpert Voice Workbook Ver 4.0 by CiscoNet.pdf | 2016-07-07 12:00 | 59M | |
| IPExpert Student Handbook Voice Lab Exam v1.0 by CiscoNet.pdf | 2016-07-07 12:00 | 17M | |
| IPExpert CCIE Voice Proctor Guide v4.0 by CiscoNet.pdf | 2016-07-07 12:00 | 105M | |
| IPExpert.CCIE.Security.Proctor.Guide.v4.0.pdf | 2016-07-07 12:00 | 272M | |
| IPCC_Express.pdf | 2016-07-07 12:00 | 463K | |
| IOS XR - Cisco's Carrier Class Opeating System.pdf | 2016-07-07 12:00 | 3.7M | |
| IOS12.4.11.pdf | 2016-07-07 12:00 | 6.9M | |
| INTRODUCTION TO CRYPTOGRAPHY WITH JAVA APPLETS - DAVID BISHOP.pdf | 2014-12-07 12:00 | 9.7M | |
| INSIDE ArcInfo madej_ch06.pdf | 2015-09-04 12:00 | 1.7M | |
| INSIDE ArcInfo madej_05.pdf | 2015-09-04 12:00 | 754K | |
| INSIDE ArcInfo flynn_pitts_fm.pdf | 2015-09-04 12:00 | 380K | |
| INSIDE ArcInfo flynn_pitts_ch02.pdf | 2015-09-04 12:00 | 1.0M | |
| INSECURE-Mag-25.pdf | 2016-07-07 12:00 | 8.6M | |
| INSECURE-Mag-25..pdf | 2016-07-07 12:00 | 8.6M | |
| INE_CCNP_WB_Updated_14Dec2009_final_2009.pdf | 2016-07-07 12:00 | 5.2M | |
| INE_CCNP_WB_16Nov2009.pdf | 2016-07-07 12:00 | 2.7M | |
| IEWB RS VOL IV Solutions.pdf | 2016-07-07 12:00 | 3.0M | |
| IEWB RS VOL IV Scenarios.pdf | 2016-07-07 12:00 | 2.0M | |
| IEWB RS VOL IV Diagrams.pdf | 2016-07-07 12:00 | 4.0M | |
| IEWB RS VOL II TShoot Tickets.pdf | 2016-07-07 12:00 | 28M | |
| IEWB RS VOL II TShoot Solutions.pdf | 2016-07-07 12:00 | 128M | |
| IEWB RS VOL II TShoot Diagrams.pdf | 2016-07-07 12:00 | 8.9M | |
| IEWB RS VOL II Solutions.pdf | 2016-07-07 12:00 | 128M | |
| IEWB RS VOL II Scenarios.pdf | 2016-07-07 12:00 | 28M | |
| IEWB RS VOL III Solutions.pdf | 2016-07-07 12:00 | 24M | |
| IEWB RS VOL III Scenarios.pdf | 2016-07-07 12:00 | 7.4M | |
| IEWB RS VOL III Diagrams.pdf | 2016-07-07 12:00 | 6.0M | |
| IEWB RS VOL II Diagrams.pdf | 2016-07-07 12:00 | 8.1M | |
| IEWB RS VOL I Diagram.pdf | 2016-07-07 12:00 | 680K | |
| IEWB RS VOL I.pdf | 2016-07-07 12:00 | 245M | |
| IEWB RS Hardware Specifications.pdf | 2016-07-07 12:00 | 677K | |
| IEWB-RS-VOL-2.lab18.diagrams.v5.00.011.pdf | 2016-07-07 12:00 | 53K | |
| IEWB-RS-VOL-2.lab17.diagrams.v5.00.012.pdf | 2016-07-07 12:00 | 39K | |
| IEWB-RS-VOL-2.lab16.diagrams.v5.00.011.pdf | 2016-07-07 12:00 | 38K | |
| IEWB-RS-VOL-2.lab14.diagrams.v5.00.001.pdf | 2016-07-07 12:00 | 54K | |
| IEWB-RS-VOL-2.lab13.diagrams.v5.00.001.pdf | 2016-07-07 12:00 | 95K | |
| IEWB-RS-VOL-2.lab12.diagrams.v5.00.010.pdf | 2016-07-07 12:00 | 61K | |
| IEWB-RS-VOL-2.lab11.diagrams.v5.00.002_2.pdf | 2016-07-07 12:00 | 40K | |
| IEWB-RS-VOL-2.lab10.diagrams.v5.00.011.pdf | 2016-07-07 12:00 | 68K | |
| IEWB-RS-VOL-2.lab9.diagrams.v5.00.002_2.pdf | 2016-07-07 12:00 | 42K | |
| IEWB-RS-VOL-2.lab8.diagrams.v5.00.003_2.pdf | 2016-07-07 12:00 | 63K | |
| IEWB-RS-VOL-2.lab7.diagrams.v5.00.001_2.pdf | 2016-07-07 12:00 | 40K | |
| IEWB-RS-VOL-2.lab6.diagrams.v5.00.010.pdf | 2016-07-07 12:00 | 66K | |
| IEWB-RS-VOL-2.lab5.diagrams.v5.00.012.pdf | 2016-07-07 12:00 | 48K | |
| IEWB-RS-VOL-2.lab4.diagrams.v5.00.003.pdf | 2016-07-07 12:00 | 39K | |
| IEWB-RS-VOL-2.lab3.diagrams.v5.00.010.pdf | 2016-07-07 12:00 | 40K | |
| IEWB-RS-VOL-2.lab2.diagrams.v5.00.050.pdf | 2016-07-07 12:00 | 43K | |
| IEWB-RS-VOL-2.lab1.diagrams.v5.00.010.pdf | 2016-07-07 12:00 | 39K | |
| IESC-WB-diagrams.pdf | 2016-07-07 12:00 | 3.3M | |
| IESC-WB-Vol.1-Tasks.pdf | 2016-07-07 12:00 | 4.1M | |
| IEEE - Communication Patterns of Engineers.pdf | 2016-07-07 12:00 | 2.9M | |
| IEATSBC-RS.day3.multicast.troubleshooting.1.00.pdf | 2016-07-07 12:00 | 37K | |
| IEATSBC-RS.day3.mpls.troubleshooting.1.01.pdf | 2016-07-07 12:00 | 40K | |
| IEATSBC-RS.day3.bgp.troubleshooting.1.01.pdf | 2016-07-07 12:00 | 37K | |
| IEATSBC-RS.day2.ipv4.igp.troubleshooting.1.00.pdf | 2016-07-07 12:00 | 52K | |
| IEATSBC-RS.day1.wan.troubleshooting.1.00.pdf | 2016-07-07 12:00 | 42K | |
| IEATSBC-RS.day1.troubleshooting.overview.1.00.pdf | 2016-07-07 12:00 | 92K | |
| IEATSBC-RS.day1.lan.troubleshooting.1.00.pdf | 2016-07-07 12:00 | 58K | |
| IEATSBC-RS.Lab3.diagram.0.01.pdf | 2016-07-07 12:00 | 48K | |
| IEATSBC-RS.Lab1_2.diagrams.1.0.pdf | 2016-07-07 12:00 | 55K | |
| IEATSBC-RS.Lab1.Solutions.1.0.pdf | 2016-07-07 12:00 | 27K | |
| IEATSBC-RS.Lab1.1.0.pdf | 2016-07-07 12:00 | 21K | |
| IDS Sensor Q&A beta.pdf | 2016-07-07 12:00 | 4.9M | |
| IDS Sensor Getting Started.pdf | 2016-07-07 12:00 | 76K | |
| IDS-commands.pdf | 2016-07-07 12:00 | 75K | |
| IDS-4.pdf | 2016-07-07 12:00 | 1.3M | |
| IDS-3.pdf | 2016-07-07 12:00 | 1.5M | |
| IDS-2.pdf | 2016-07-07 12:00 | 2.8M | |
| IDS-1.pdf | 2016-07-07 12:00 | 1.6M | |
| IDG - The Official InstallShield for Windows Installer Developer's Guide.pdf | 2015-09-04 12:00 | 5.3M | |
| IDG - The Complete XML Bible.pdf | 2015-09-04 12:00 | 5.7M | |
| IDG - MS Visual Studio .NET C++ for Dummies Quick Reference Guide.pdf | 2015-09-04 12:00 | 11M | |
| IDEA_0304.pdf | 2009-02-03 12:00 | 308K | |
| IDA L usine a Gaz.pdf | 2016-07-07 12:00 | 532K | |
| IC_TECH_REPORT_199938.pdf | 2009-02-03 12:00 | 183K | |
| IBM Redbook - TCP IP tutorial.pdf | 2015-09-04 12:00 | 3.1M | |
| I22Diff.pdf | 2009-02-03 12:00 | 7.9K | |
| I2_cryptologie.pdf | 2009-02-03 12:00 | 64K | |
| Hunting rootkits with Windbg.pdf | 2016-07-07 12:00 | 622K | |
| Hungry Minds - Windows XP for Dummies (2001).pdf | 2015-09-04 12:00 | 6.2M | |
| Hungry Minds - LPIC 1 (101,102) Certification Bible.pdf | 2015-09-04 12:00 | 5.3M | |
| Hungry Minds - Asp .NET Your Visual Blueprint For Creating Web Applications On The .NET Framework.pdf | 2015-09-04 12:00 | 14M | |
| Hungry Minds - ASP .Net Database Programming Weekend Crash Course.pdf | 2015-09-04 12:00 | 3.2M | |
| HungryMinds - ASP.NET Visual Blueprint (VBL).pdf | 2015-09-04 12:00 | 14M | |
| Hungry Minds - ASP .NET Bible.pdf | 2015-09-04 12:00 | 7.3M | |
| Hungry Minds - A+ Certification for Dummies 2nd Edition (2001).pdf | 2015-09-04 12:00 | 3.0M | |
| HungryMinds -- Linux+ Certification Bible.pdf | 2015-09-04 12:00 | 3.6M | |
| Http Parameter Contamination.pdf | 2016-07-07 12:00 | 32K | |
| How to build secure LANs with IPSec.pdf | 2016-07-07 12:00 | 485K | |
| How to Troubleshoot Black Hole Router Issues.pdf | 2016-07-07 12:00 | 16K | |
| How to Determine the Serial Number of Catalyst Switch Components.pdf | 2016-07-07 12:00 | 140K | |
| How debugger modules & plugins can speed up basic exploit development.pdf | 2016-07-07 12:00 | 32K | |
| How_To_Do_Everything_With_Contribute.pdf | 2015-09-04 12:00 | 11M | |
| How We Cracked the Code Book Ciphers.pdf | 2016-07-07 12:00 | 272K | |
| How To Steal An Election By Hacking The Vote.pdf | 2016-07-07 12:00 | 32K | |
| How To Crack Any Type Of Time Trial Protection (Ebook).pdf | 2015-09-04 12:00 | 48K | |
| HowSecure.pdf | 2016-07-07 12:00 | 3.9M | |
| How Lock Picking Works.pdf | 2016-07-07 12:00 | 1.1M | |
| How Hackers Do It_ Tricks, Tools, and Techniques.pdf | 2016-07-07 12:00 | 16K | |
| How Hackers Do It Tricks, Tools, and Techniques.pdf | 2016-07-07 12:00 | 48K | |
| How. to.Crack.CD.Protections.pdf | 2015-09-04 12:00 | 30K | |
| Hoot_and_Holler_over_V3PN_Configuration_Example.pdf | 2016-07-07 12:00 | 455K | |
| Honeypots.pdf | 2016-07-07 12:00 | 32K | |
| Home Networking for Dummies 3rd Ed 2005.pdf | 2014-12-07 12:00 | 8.8M | |
| High Performance Web Caching With Squid.pdf | 2015-09-04 12:00 | 27K | |
| Heartbleed analysis daemon.pdf | 2016-07-07 12:00 | 32K | |
| Heap de Windows structure, fonctionnement et exploitation.pdf | 2016-07-07 12:00 | 32K | |
| Hardware Installation Guide.pdf | 2016-07-07 12:00 | 3.2M | |
| HardwareInstall831.pdf | 2016-07-07 12:00 | 931K | |
| HardwareInstalGuide2950G48EI.pdf | 2016-07-07 12:00 | 4.6M | |
| Hardening the Operating System.pdf | 2016-07-07 12:00 | 1.4M | |
| Hardening Linux.pdf | 2016-07-07 12:00 | 6.3M | |
| Hard Disk - Basics.pdf | 2015-09-04 12:00 | 5.9M | |
| Hands-On Ethical Hacking and Network Defense.pdf | 2016-07-07 12:00 | 83M | |
| Handheld Computers for Doctors.pdf | 2015-09-04 12:00 | 4.5M | |
| Handbuch TCP-IP-Ethernet und Web-IO.pdf | 2015-09-04 12:00 | 1.5M | |
| Handbook of Applied Cryptography - Alfred J. Menezes.pdf | 2014-12-07 12:00 | 4.6M | |
| Handbook of Applied Cryptography (Crc Press Series on Discrete Mathematics and Its Applications) 5th Edition.pdf | 2014-12-07 12:00 | 5.5M | |
| Handbook_of_Applied_Cryptography-A.Menezes-P.vanOorschot-S.Vanstone-CRC_Press_1996.pdf | 2016-07-07 12:00 | 6.3M | |
| Handbook Of Applied Cryptography.pdf | 2016-07-07 12:00 | 12M | |
| Hakin9_06_2009__FR.pdf | 2016-07-07 12:00 | 18M | |
| Hakin9_05_2009_e_book.pdf | 2016-07-07 12:00 | 4.5M | |
| Hakin9_03_2009__FR.pdf | 2016-07-07 12:00 | 11M | |
| Hackproofing Oracle Application Server.pdf | 2014-12-07 12:00 | 306K | |
| Hacking the Xbox.pdf | 2016-07-07 12:00 | 18M | |
| Hacking the Linux 2.6 kernel, Part 2 Making your first hack.pdf | 2016-07-07 12:00 | 32K | |
| Hacking jBoss Hacking a default jBoss installation using a browser.pdf | 2016-07-07 12:00 | 32K | |
| Hacking jBoss.pdf | 2016-07-07 12:00 | 512K | |
| Hacking into computer systems - a beginners guide.pdf | 2014-12-07 12:00 | 615K | |
| Hacking Windows XP.pdf | 2014-12-07 12:00 | 10M | |
| Hacking Windows.pdf | 2016-07-07 12:00 | 9.7M | |
| Hacking Web Applications Using Cookie Poisoning.pdf | 2016-07-07 12:00 | 32K | |
| Hacking Web Applications.pdf | 2016-07-07 12:00 | 5.8M | |
| Hacking The Performance of Technology.pdf | 2016-07-07 12:00 | 16K | |
| Hacking The Invisible Network.pdf | 2016-07-07 12:00 | 32K | |
| Hacking The Genome.pdf | 2016-07-07 12:00 | 301K | |
| Hacking The Cable Modem.pdf | 2016-07-07 12:00 | 32K | |
| Hacking The Art of Exploitation 2nd Edition.pdf | 2016-07-07 12:00 | 4.0M | |
| Hacking The Art of Exploitation.pdf | 2016-07-07 12:00 | 32K | |
| Hacking The Art of Exploitation, 2nd Edition.pdf | 2016-07-07 12:00 | 32K | |
| Hacking Techniques.pdf | 2016-07-07 12:00 | 32K | |
| Hacking Securite Hand-Book.pdf | 2016-07-07 12:00 | 3.7M | |
| Hacking Secrets Revealed.pdf | 2015-09-04 12:00 | 493K | |
| Hacking Secret Ciphers with Python.pdf | 2016-07-07 12:00 | 6.6M | |
| HackingPSP.pdf | 2016-07-07 12:00 | 12M | |
| Hacking Matter.pdf | 2016-07-07 12:00 | 2.3M | |
| Hacking Leopard.pdf | 2016-07-07 12:00 | 32K | |
| Hacking Intranet Websites.pdf | 2016-07-07 12:00 | 5.4M | |
| Hacking Intranet Website From The Outside.pdf | 2016-07-07 12:00 | 32K | |
| Hacking Into Computer Systems.pdf | 2016-07-07 12:00 | 32K | |
| Hacking Into Computer Systems - A Beginners Guide.pdf | 2015-09-04 12:00 | 615K | |
| Hacking IIS Servers.pdf | 2014-12-07 12:00 | 31K | |
| Hacking Exposed Web Applications.pdf | 2015-09-04 12:00 | 7.6M | |
| Hacking Exposed Network Security Secrets & Solutions, Third Edition ch1.pdf | 2014-12-07 12:00 | 1.9M | |
| Hacking Exposed.pdf | 2016-07-07 12:00 | 33M | |
| Hacking Exposed-Windows - Windows Security Secrets & Solutions, 3rd Ed.pdf | 2016-07-07 12:00 | 8.8M | |
| Hacking Exposed-Windows - Windows Security Secrets & Solutions, 3rd Ed..pdf | 2014-12-07 12:00 | 9.1M | |
| Hacking Exposed-Web 2.0 - Web 2.0 Security Secrets & Solutions.pdf | 2014-12-07 12:00 | 6.3M | |
| Hacking Exposed - Network Security Secrets & Solutions, 2nd Edition.pdf | 2014-12-07 12:00 | 10M | |
| Hacking Exposed - Network Security Secrets & Solutions, 2Nd Edition.pdf | 2015-09-04 12:00 | 10M | |
| Hacking Exposed-Network Security - Secrets & Solutions, 3rd Ed..pdf | 2014-12-07 12:00 | 5.9M | |
| Hacking Exposed-Network Security - Secrets & Solutions, 2nd Ed..pdf | 2014-12-07 12:00 | 8.0M | |
| Hacking Cisco Routers.pdf | 2014-12-07 12:00 | 19K | |
| Hacking Bluetooth enabled mobile phones and beyond-2.pdf | 2016-07-07 12:00 | 32K | |
| Hacking Bluetooth Enabled Mobile Phones And Beyond.pdf | 2016-07-07 12:00 | 32K | |
| Hacking Blind.pdf | 2016-07-07 12:00 | 32K | |
| Hacking.Guide.V3.1.pdf | 2014-12-07 12:00 | 1.2M | |
| Hacking-ebook - CIA-Book-of-Dirty-Tricks1.pdf | 2014-12-07 12:00 | 355K | |
| Hacking-The Hacker Crackdown.pdf | 2014-12-07 12:00 | 633K | |
| Hacking - The Art of Explotation.pdf | 2016-07-07 12:00 | 4.0M | |
| Hacking-Hacker's Guide.pdf | 2014-12-07 12:00 | 3.7M | |
| Hacking - Firewalls And Networks How To Hack Into Remote Computers.pdf | 2014-12-07 12:00 | 2.9M | |
| Hackin9 Vulnerabilites de type format string.pdf | 2016-07-07 12:00 | 32K | |
| Hackers Delight.pdf | 2016-07-07 12:00 | 24M | |
| Hackers Beware Defending Your Network From The Wiley Hacker.pdf | 2015-09-04 12:00 | 4.9M | |
| Hackers Beware.pdf | 2014-12-07 12:00 | 4.9M | |
| Hackers, Heroes Of The Computer Revolution.pdf | 2014-12-07 12:00 | 105K | |
| Hackademy_cours Newbie.pdf | 2016-07-07 12:00 | 30M | |
| Hackademy_cours Newbie +.pdf | 2016-07-07 12:00 | 20M | |
| Hackademy_MagazineN5.pdf | 2016-07-07 12:00 | 576K | |
| Hackademy_MagazineN5.pdf | 2016-07-07 12:00 | 576K | |
| Hackademy-cours_2.pdf | 2016-07-07 12:00 | 9.2M | |
| Hackademy-cours_1.pdf | 2016-07-07 12:00 | 11M | |
| Hackademy - The Hackademy Prg n2 Ebook Fr-Library.pdf | 2016-07-07 12:00 | 17M | |
| Hack Proofing Your Web Applications.pdf | 2014-12-07 12:00 | 8.6M | |
| Hack Proofing Your Network_First Edition.pdf | 2014-12-07 12:00 | 2.9M | |
| Hack Proofing Your Network Second Edition.pdf | 2014-12-07 12:00 | 8.8M | |
| Hack Proofing Your E-Commerce Site.pdf | 2014-12-07 12:00 | 7.3M | |
| Hack Proofing Sun Solaris 8.pdf | 2014-12-07 12:00 | 6.8M | |
| Hack Proofing Linux - A Guide To Open Source Security.pdf | 2015-09-04 12:00 | 12M | |
| HackNotes Windows Security Portable Reference.pdf | 2015-09-04 12:00 | 4.8M | |
| HackNotes Network Security Portable Reference.pdf | 2015-09-04 12:00 | 3.6M | |
| HackNotes Linux And Unix Security Portable Reference.pdf | 2015-09-04 12:00 | 3.4M | |
| Hack It Security Through Penetration Testing.pdf | 2016-07-07 12:00 | 32K | |
| Hack IT Security Through Penetration Testing.pdf | 2014-12-07 12:00 | 12M | |
| Hack Attacks Revealed.pdf | 2016-07-07 12:00 | 8.2M | |
| HUST CTF 2010 Write-up-PPP.pdf | 2016-07-07 12:00 | 32K | |
| HTTP Request Smuggling-2.pdf | 2016-07-07 12:00 | 32K | |
| HTTP REQUEST SMUGGLING.pdf | 2016-07-07 12:00 | 32K | |
| HTTP HEAD method trick in php scripts.pdf | 2016-07-07 12:00 | 32K | |
| HTML_XHTML_and_CSS_Bible_3rd_Edition.Oct2004.Wiley.RR.pdf | 2015-09-04 12:00 | 20M | |
| HTML5 Web Security 2011.pdf | 2016-07-07 12:00 | 32K | |
| HITB Ezine Issue 6 2011.pdf | 2016-07-07 12:00 | 31M | |
| HITB-Ezine-Issue-001.pdf | 2016-07-07 12:00 | 2.9M | |
| HDmoore - Penetration Testing with IPv6 .pdf | 2016-07-07 12:00 | 32K | |
| HAVAL_paper.pdf | 2009-02-03 12:00 | 268K | |
| HAND-Book d-un Hacker.pdf | 2016-07-07 12:00 | 3.7M | |
| Gulf.Professional.Publishing.Principles.of.Applied.Reservoir.Simulation.2nd.pdf | 2015-09-04 12:00 | 29M | |
| Guide to Elliptic Curve Cryptography - Darrel Hankerson.pdf | 2014-12-07 12:00 | 4.4M | |
| Guide to ATM Technology, For the Catalyst 8540 MSR, Catalyst 8510 MSR, and.pdf | 2016-07-07 12:00 | 2.6M | |
| Guide Asterisk.pdf | 2016-07-07 12:00 | 1.0M | |
| Grund_Symmetric-Cryptography_Paper.pdf | 2009-02-03 12:00 | 367K | |
| Googles Backdoor.pdf | 2015-09-04 12:00 | 146K | |
| Google Hacks.pdf | 2016-07-07 12:00 | 32K | |
| Google Hacking Of Oracle Technologies V1.02.pdf | 2016-07-07 12:00 | 32K | |
| Google Hacking Making Competitive Intelligence Work for You.pdf | 2016-07-07 12:00 | 32K | |
| Google Hacking 101.pdf | 2015-09-04 12:00 | 625K | |
| Google Hackers Guide.pdf | 2015-09-04 12:00 | 1.0M | |
| GoogleHackTool.pdf | 2015-09-04 12:00 | 227K | |
| Google Attacks.pdf | 2015-09-04 12:00 | 212K | |
| Google Anatomy.pdf | 2015-09-04 12:00 | 121K | |
| Google - The Missing Manual.pdf | 2015-09-04 12:00 | 2.5M | |
| Globalscape Secure FTP Server 3.0.2 Buffer-Overflow.pdf | 2016-07-07 12:00 | 32K | |
| Gigabit Ethernet And Atm, A Technology Perspective.pdf | 2016-07-07 12:00 | 228K | |
| Getting the most from your IPS System.pdf | 2016-07-07 12:00 | 1.4M | |
| Getting Started with Macromedia Flash Communication Server MX.pdf | 2015-09-04 12:00 | 3.9M | |
| Getting Started With Installshield Developer And Windows Installer Setups.pdf | 2015-09-04 12:00 | 12M | |
| Get Acquainted With Linux Security and Optimization System.pdf | 2015-09-04 12:00 | 1.2M | |
| Generic Coding with the ADO.NET 2.0 Base Classes and Factories.pdf | 2015-09-04 12:00 | 49K | |
| Generate Assemblies With Reflection Emit.pdf | 2015-09-04 12:00 | 53K | |
| Game Hacking 101.pdf | 2016-07-07 12:00 | 32K | |
| Game Hacking.pdf | 2016-07-07 12:00 | 32K | |
| Game Console Hacking-Xbox.Playstation.Nintendo.Atari.and.Gamepark.pdf | 2015-09-04 12:00 | 23M | |
| GSM and Personal Communications Handbook.pdf | 2016-07-07 12:00 | 2.5M | |
| GRE_over_IPsec_Design_Guide.pdf | 2016-07-07 12:00 | 1.0M | |
| GRE_MTU_problems.pdf | 2016-07-07 12:00 | 21K | |
| GPRS QoS in integrated 3G networks VoIP.pdf | 2016-07-07 12:00 | 2.7M | |
| GPRS Gateway to Third Generation Mobile Networks.pdf | 2016-07-07 12:00 | 15M | |
| GEFI Support ITR3 (CISCO niv3).pdf | 2016-07-07 12:00 | 2.8M | |
| GEFI Support ITR2 (SWITCHS CISCO).pdf | 2016-07-07 12:00 | 2.4M | |
| GEFI Support ITR (CISCO).pdf | 2016-07-07 12:00 | 1.4M | |
| GDB QUICK REFERENCE.pdf | 2016-07-07 12:00 | 75K | |
| GDB - petit tutoriel.pdf | 2016-07-07 12:00 | 84K | |
| G.SHDSL WAN.pdf | 2016-07-07 12:00 | 201K | |
| Fuzzy Hashing for Digital Forensic Investigators.pdf | 2016-07-07 12:00 | 16K | |
| Fuzzing for software vulnerability discovery.pdf | 2016-07-07 12:00 | 32K | |
| From Exploit to Metasploit - The basics.pdf | 2018-01-07 12:00 | 35K | |
| Freedman_bgp102_N48.pdf | 2016-07-07 12:00 | 772K | |
| Freedman_bgp101_N48.pdf | 2016-07-07 12:00 | 3.6M | |
| FreeBSD Handbook-7.1.pdf | 2015-09-04 12:00 | 11M | |
| Foundations of Cryptography A Primer - Oded Goldreich.pdf | 2014-12-07 12:00 | 2.1M | |
| Foundation PHP for Flash.pdf | 2015-09-04 12:00 | 10M | |
| Forensics Analysis of Hacking Cases.pdf | 2018-01-07 12:00 | 510K | |
| Forensic_UltraDock_v5_user_manual.pdf | 2018-01-07 12:00 | 1.3M | |
| Forensic Toolkit.pdf | 2016-07-07 12:00 | 32K | |
| Forensic Challenge 2010_-_Challenge_2_-_Solution.pdf | 2018-01-07 12:00 | 1.1M | |
| Forensic Analysis, Dan Farmer.pdf | 2018-01-07 12:00 | 2.1M | |
| For.Dummies.Windows.XP.for.Dummies.Quick.Reference.2ed.Oct.2004.eBook-DDU.pdf | 2015-09-04 12:00 | 5.2M | |
| For.Dummies.Troubleshooting.Your.PC.For.Dummies.Feb.2005.eBook-DDU.pdf | 2015-09-04 12:00 | 8.8M | |
| For.Dummies.Search.Engine.Optimization.for.Dummies.2004.pdf | 2015-09-04 12:00 | 12M | |
| For.Dummies.Red.Hat.Fedora.Linux.2.All-in-One.Desk.Reference.For.Dummies.Jul.2004.eBook-DDU.pdf | 2015-09-04 12:00 | 17M | |
| For.Dummies.PHP.5.for.Dummies.Apr.2004.eBook-DDU.pdf | 2015-09-04 12:00 | 6.0M | |
| For.Dummies.Networking.For.Dummies.7.edition.Oct.2004.eBook.pdf | 2015-09-04 12:00 | 9.2M | |
| For.Dummies.Hacking.for.Dummies.Apr.2004.eBook-DDU.pdf | 2015-09-04 12:00 | 9.3M | |
| For.Dummies.HDTV.For.Dummies.Nov.2004.eBook-DDU.pdf | 2015-09-04 12:00 | 4.7M | |
| For.Dummies.Cleaning.Windows.XP.For.Dummies.Sep.2004.eBook-DDU.pdf | 2015-09-04 12:00 | 8.5M | |
| For.Dummies.Blocking.Spam.and.Spyware.For.Dummies.eBook-YYePG.[www.sharetuga.web.pt].pdf | 2015-09-04 12:00 | 6.0M | |
| Flash MX Tutorials.pdf | 2015-09-04 12:00 | 4.3M | |
| Flash MX Savvy.pdf | 2015-09-04 12:00 | 12M | |
| Flash MX Advanced Visual QuickPro Guide.pdf | 2015-09-04 12:00 | 15M | |
| Flash MX ActionScript.pdf | 2015-09-04 12:00 | 8.0M | |
| Flash 5 Bible.pdf | 2015-09-04 12:00 | 16M | |
| Flash 5-100 Percent Site.pdf | 2015-09-04 12:00 | 513K | |
| Firewalls for Dummies, 2e.pdf | 2015-09-04 12:00 | 8.3M | |
| Firewall and Proxy Server HOWTO.pdf | 2015-09-04 12:00 | 114K | |
| Fingerprinting - Defense.pdf | 2016-07-07 12:00 | 32K | |
| Finess_63config.pdf | 2016-07-07 12:00 | 4.9M | |
| Filip_BIRD_final_N48.pdf | 2016-07-07 12:00 | 482K | |
| File System Forensic Analysis.pdf | 2018-01-07 12:00 | 4.0M | |
| FeteSc.pdf | 2009-02-03 12:00 | 160K | |
| Feed Injection In Web 2.0.pdf | 2016-07-07 12:00 | 32K | |
| FL _ Techniques de hacking.pdf | 2016-07-07 12:00 | 32K | |
| F1 - Get the Most out of Excel! - The Ultimate Excel Tip Help Guide.pdf | 2015-09-04 12:00 | 15M | |
| Extreme-Privilege-Escalation-On-Windows8-UEFI-Systems.pdf | 2016-07-07 12:00 | 48K | |
| Exploring the Blackhole Exploit Kit.pdf | 2016-07-07 12:00 | 32K | |
| Exploit writing tutorial part 9-Introduction to Win32 shellcoding.pdf | 2016-07-07 12:00 | 32K | |
| Exploit writing tutorial part 8-Win32 Egg Hunting.pdf | 2016-07-07 12:00 | 16K | |
| Exploit writing tutorial part 7 Unicode - from 0.00410041 to calc.pdf | 2016-07-07 12:00 | 622K | |
| Exploit writing tutorial part 7-Unicode.pdf | 2016-07-07 12:00 | 32K | |
| Exploit writing tutorial part 5-How debugger modules and plugins can speed.pdf | 2016-07-07 12:00 | 32K | |
| Exploit writing tutorial part 3-SEH Based Exploits.pdf | 2016-07-07 12:00 | 32K | |
| Exploit writing tutorial part 2-Stack Based Overflows.pdf | 2016-07-07 12:00 | 32K | |
| Exploit writing tutorial part 1-Stack Based Overflows.pdf | 2016-07-07 12:00 | 32K | |
| Exploiting Format String Vulnerabilities.pdf | 2016-07-07 12:00 | 32K | |
| Exploit-writing-tutorial-part6-Bypassing-Stack-Cookies-SafeSeh-SEHOP-HW-DEP-and-ASLR.pdf | 2016-07-07 12:00 | 32K | |
| Exploit-writing-tutorial-part5-How-Debugger-modules-and-plugins-can-speed-up-basic-exploit-development.pdf | 2016-07-07 12:00 | 32K | |
| Exploit-writing-tutorial-part4-From-Exploit-to-Metasploit-The-Basics.pdf | 2016-07-07 12:00 | 16K | |
| Exploit-writing-tutorial-part3b-SEH-Based-exploits.pdf | 2016-07-07 12:00 | 32K | |
| Exploit-writing-tutorial-part2-Stack-Based-Oveflows-Jump-to-shellcode.pdf | 2016-07-07 12:00 | 32K | |
| Exploit-writing-tutorial-part2-SEH-Based-exploits.pdf | 2016-07-07 12:00 | 32K | |
| Exploit-writing-tutorial-part1-Stack-Based-Oveflows.pdf | 2016-07-07 12:00 | 32K | |
| Expert_C_Programming_Deep_C_Secrets.pdf | 2015-09-04 12:00 | 2.1M | |
| Exim-SpamAndVirusScanning.pdf | 2015-09-04 12:00 | 533K | |
| Excel 2002 Formulas.pdf | 2015-09-04 12:00 | 10M | |
| Excel 2000 Advanced Training Manual.pdf | 2015-09-04 12:00 | 709K | |
| Examining the skmMenu Server Control.pdf | 2015-09-04 12:00 | 158K | |
| ExamCram2_LPIC.pdf | 2015-09-04 12:00 | 8.1M | |
| Evolving Custom Controls.pdf | 2015-09-04 12:00 | 112K | |
| Ethical_Hacking_Techniques.pdf | 2015-09-04 12:00 | 363K | |
| Ethical Hacking And Countermeasures.pdf | 2016-07-07 12:00 | 32K | |
| EtherChannel Between Catalyst 3550_3560_3750 Series Switches.pdf | 2016-07-07 12:00 | 34K | |
| EtherChannel.pdf | 2016-07-07 12:00 | 85K | |
| Essentials.Featuring.the.Solaris.9.Operating.Environment.SA-119.pdf | 2015-09-04 12:00 | 2.1M | |
| En memoire aux timing attacks.pdf | 2016-07-07 12:00 | 32K | |
| End-to-End Quality of Service over Cellular Networks.pdf | 2016-07-07 12:00 | 12M | |
| Encryption Solution Design and Deployment Considerations.pdf | 2016-07-07 12:00 | 1.8M | |
| Elsevier.Network.Security.March.2005.pdf | 2015-09-04 12:00 | 1.4M | |
| Elsevier.Computer.and.Fraud.Security.March.2005.pdf | 2015-09-04 12:00 | 855K | |
| Elsevier.Biometric.Technology.Today.March.2005.pdf | 2015-09-04 12:00 | 397K | |
| Electronics Tutorial (good).pdf | 2015-09-04 12:00 | 3.3M | |
| Electronic.Gaming.Monthly.Magazine.Apr.2005.pdf | 2015-09-04 12:00 | 19M | |
| EffectiveSTL.pdf | 2016-05-14 12:00 | 1.8M | |
| Ebook - Poser 4 Advanced Techniques.pdf | 2015-09-04 12:00 | 5.2M | |
| Ebook-Data Warehousing Architecture And Implementation-Prentice Hall.pdf | 2015-09-04 12:00 | 4.9M | |
| Ebook-Adobe Photoshop CS Tips and Tricks.pdf | 2015-09-04 12:00 | 2.1M | |
| Ebay Hacks 100 Industrial-Strength Tips And Tools.pdf | 2016-07-07 12:00 | 32K | |
| EWEEK.Magazine.Apr.04.2005.pdf | 2015-09-04 12:00 | 3.9M | |
| EN-secrets of lockpicking-2.pdf | 2016-07-07 12:00 | 156K | |
| EN-metasploit_guide.pdf | 2018-01-07 12:00 | 242K | |
| EN-Yahoo Hacking Of Oracle Technologies.pdf | 2016-07-07 12:00 | 32K | |
| EN-Unreliable Guide To Locking.pdf | 2016-07-07 12:00 | 247K | |
| EN-The Complete Guide To Lockpicking - Eddie the Wire - Loompanics.pdf | 2016-07-07 12:00 | 3.6M | |
| EN-Stack Overflow Exploitation Explained.pdf | 2016-07-07 12:00 | 32K | |
| EN-Secrets of Lockpicking.pdf | 2016-07-07 12:00 | 710K | |
| EN-SEH Overwrites Simplified v1.01.pdf | 2016-07-07 12:00 | 32K | |
| EN-SECRETS OF LOCK PICKING.pdf | 2016-07-07 12:00 | 193K | |
| EN-SDB shadowinteger_backdoor.pdf | 2016-07-07 12:00 | 22K | |
| EN-SAP Penetration testing_Black-H_Europe.pdf | 2016-07-07 12:00 | 3.3M | |
| EN-Rule Set Based Access Control (RSBAC).pdf | 2016-07-07 12:00 | 144K | |
| EN-Preventing Web App Hacking.pdf | 2016-07-07 12:00 | 48K | |
| EN-Port Scanning, Vulnerability Scanning,Packet Sniffing, and Intrusion Detection.pdf | 2016-07-07 12:00 | 32K | |
| EN-Penetration Testing with IPv6 .pdf | 2016-07-07 12:00 | 32K | |
| EN-NOx86-64 buffer overflow exploits and the borrowed code chunks exploitation technique -NX.pdf | 2016-07-07 12:00 | 32K | |
| EN-More_advanced_sql_injection.pdf | 2016-07-07 12:00 | 16K | |
| EN-Microsoft SQL Server Passwords.pdf | 2016-07-07 12:00 | 32K | |
| EN-Microsoft IIS 0Day Vulnerability in Parsing Files (semicolon bug).pdf | 2016-07-07 12:00 | 32K | |
| EN-Metasploitation (Exploit automation and IPS evasion).pdf | 2018-01-07 12:00 | 642K | |
| EN-Metasploit Toolkit.pdf | 2018-01-07 12:00 | 5.0M | |
| EN-MTI Guide To Lockpicking.pdf | 2016-07-07 12:00 | 509K | |
| EN-Lockpicking - How Lock Picking Works by Tom Harris & Marshall Brain.pdf | 2016-07-07 12:00 | 1.1M | |
| EN-Introduction to various file infection techniques.pdf | 2016-07-07 12:00 | 469K | |
| EN-INSECURE-Mag-25.Penetration testing.pdf | 2016-07-07 12:00 | 8.6M | |
| EN-Honeypots.pdf | 2016-07-07 12:00 | 32K | |
| EN-Hardware Hacking - Have Fun While Voiding Your Warranty (2004).pdf | 2016-07-07 12:00 | 39M | |
| EN-Hacking jBoss.pdf | 2016-07-07 12:00 | 512K | |
| EN-Hacking for Dummies.pdf | 2016-07-07 12:00 | 6.9M | |
| EN-Hacking_The_Art_of_Exploitation 1.pdf | 2016-07-07 12:00 | 32K | |
| EN-Hacking_The_Art_Of_Exploitation 2.pdf | 2016-07-07 12:00 | 32K | |
| EN-Hacking Windows XP.pdf | 2016-07-07 12:00 | 9.2M | |
| EN-Hacking Web Applications Using Cookie Poisoning.pdf | 2016-07-07 12:00 | 32K | |
| EN-Hacking Web Applications.pdf | 2016-07-07 12:00 | 5.8M | |
| EN-Hacking VoIP Exposed.pdf | 2016-07-07 12:00 | 3.6M | |
| EN-Hacking The Cable Modem.pdf | 2016-07-07 12:00 | 22M | |
| EN-Hacking Techniques.pdf | 2016-07-07 12:00 | 32K | |
| EN-Hacking Technique.pdf | 2016-07-07 12:00 | 16K | |
| EN-Hacking Securite Hand-Book.pdf | 2016-07-07 12:00 | 3.7M | |
| EN-Hacking PSP.pdf | 2016-07-07 12:00 | 12M | |
| EN-Hacking Matter.pdf | 2016-07-07 12:00 | 2.3M | |
| EN-Hacking Intranet Websites.pdf | 2016-07-07 12:00 | 32K | |
| EN-Hacking Intranet Website From The Outside.pdf | 2016-07-07 12:00 | 5.4M | |
| EN-Hacking Gmail.pdf | 2016-07-07 12:00 | 5.3M | |
| EN-Hacking Bluetooth Enabled Mobile Phones And Beyond.pdf | 2016-07-07 12:00 | 32K | |
| EN-Hack It Security Through Penetration Testing.pdf | 2016-07-07 12:00 | 12M | |
| EN-HITB-LDaP Injection -Attack and Defence Techniques.pdf | 2016-07-07 12:00 | 32K | |
| EN-Google Hacks.pdf | 2016-07-07 12:00 | 32K | |
| EN- Google Hacking Of Oracle Technologies V1.02.pdf | 2016-07-07 12:00 | 90K | |
| EN-Google Hacking- Making Competitive Intelligence Work for You.pdf | 2016-07-07 12:00 | 5.1M | |
| EN-Game Hacking.pdf | 2016-07-07 12:00 | 32K | |
| EN-GCC The Complete Guide Reference.pdf | 2016-07-07 12:00 | 5.7M | |
| EN-Feed Injection In Web 2.0.pdf | 2016-07-07 12:00 | 32K | |
| EN-Exploration in the Cross By Xylitol.pdf | 2016-07-07 12:00 | 32K | |
| EN-Exploit writing tutorial part 3 _ SEH Based Exploits.pdf | 2016-07-07 12:00 | 32K | |
| EN-Exploiting Format String Vulnerabilities.pdf | 2016-07-07 12:00 | 32K | |
| EN-Ethical Hacking.pdf | 2016-07-07 12:00 | 26M | |
| EN-Decimalisation Table Attacks For PIN Cracking.pdf | 2016-07-07 12:00 | 223K | |
| EN-DOS ATTACKS USING SQL WILDCARDS.pdf | 2016-07-07 12:00 | 16K | |
| EN-Cross Site Tracing(XST).pdf | 2016-07-07 12:00 | 32K | |
| EN-Changing the entry-point.pdf | 2016-07-07 12:00 | 428K | |
| EN-Changing the PE-File Entry-Point to avoid anti-virus detection.pdf | 2016-07-07 12:00 | 428K | |
| EN-Certified Ethical Hacker 3.0 Official Course.pdf | 2016-07-07 12:00 | 26M | |
| EN-Bypass windows server 2008.pdf | 2016-07-07 12:00 | 64K | |
| EN-Bypassing SEHOP.pdf | 2016-07-07 12:00 | 32K | |
| EN-Buffer.Overflow.Attacks.-.Detect.Exploit.Prevent.pdf | 2016-07-07 12:00 | 5.4M | |
| EN-BSD Hacks.pdf | 2016-07-07 12:00 | 2.0M | |
| EN-Attacking the OutGuess.pdf | 2016-07-07 12:00 | 202K | |
| EN-An Introduction to Arp Spoofing.pdf | 2016-07-07 12:00 | 29K | |
| EN-Advanced SQL Injection In SQL Server Applications.pdf | 2016-07-07 12:00 | 291K | |
| EN-ASLR Smack _ Laugh Reference.pdf | 2016-07-07 12:00 | 509K | |
| EN-ASLR.pdf | 2016-07-07 12:00 | 259K | |
| EJB Design Patterns (Marinescu, 2002).pdf | 2015-09-04 12:00 | 808K | |
| E-BOOK-FRHACK-v2.2.pdf | 2016-07-07 12:00 | 2.8M | |
| Dynamic-Link Library Hijacking.pdf | 2016-07-07 12:00 | 110K | |
| Dummies - Hack How To Create Keygens (1).pdf | 2014-12-07 12:00 | 9.6K | |
| Dr.Dobbs.Journal.Volume.30.Issue.3.Number.370.March.2005.READ.NFO-EEn.pdf | 2015-09-04 12:00 | 2.1M | |
| Digital Video Broadcasting-Technology, Standards, And Regulations.pdf | 2016-07-07 12:00 | 1.2M | |
| Digital Crossroads American Telecommunications Policy in the Internet Age.pdf | 2016-07-07 12:00 | 5.1M | |
| Digit.Magazine.Apr.2005.pdf | 2015-09-04 12:00 | 13M | |
| Differential Cryptanalysis Of DES Like Cryptosystems.pdf | 2016-07-07 12:00 | 634K | |
| Developing service Architectures for Metro Ethernet Deployments.pdf | 2016-07-07 12:00 | 11M | |
| Developing_Web_Applications_with_Visual_Basic_NET_and_ASP_NET_NoFearLevenT.pdf | 2015-09-04 12:00 | 5.1M | |
| Developing Web Apps with Flash MX.pdf | 2015-09-04 12:00 | 1.9M | |
| Developing Applications using Ado.net for Microsoft Sql Server 2000.pdf | 2015-09-04 12:00 | 9.9M | |
| Developing ASP Components, 2nd Edition.pdf | 2015-09-04 12:00 | 9.5M | |
| Developing .NET Web Services with XML.pdf | 2015-09-04 12:00 | 6.1M | |
| Detections Heuristiques en environnement Win32.pdf | 2016-07-07 12:00 | 145K | |
| Detection of Promiscuous Nodes Using ARP Packets.pdf | 2016-07-07 12:00 | 94K | |
| Detecting, Troubleshooting, and Preventing Congestion in Storage Networks.pdf | 2023-11-27 12:00 | 50M | |
| Detecting, Troubleshooting, and Preventing Congestion in Storage Networks.epub | 2023-11-26 12:00 | 39M | |
| Designing_Microsoft_ASP.NET_Applications (VBL).pdf | 2015-09-04 12:00 | 3.3M | |
| Designing Microsoft ASP.NET Applications.pdf | 2015-09-04 12:00 | 3.3M | |
| Designing BSD Rootkits.pdf | 2016-07-07 12:00 | 8.4M | |
| Designing BSD Rootkits - An Introduction to Kernel Hacking.pdf | 2016-05-15 12:00 | 8.4M | |
| Design and Architecture of Datacenter Networking Platforms.pdf | 2016-07-07 12:00 | 2.5M | |
| Design Patterns and Object Oriented Programming in Visual Basic 6 and VB.NET.pdf | 2015-09-04 12:00 | 5.6M | |
| Derek Partridge - Artificial Intelligence and Software Engineering - Understanding the Promise of the Future.pdf | 2015-09-04 12:00 | 2.6M | |
| Deploying Virtual Private Networks with Microsoft Windows Server 2003.pdf | 2015-09-04 12:00 | 3.9M | |
| Deploying Cisco IOS Security with a Public-Key Infrastructure.pdf | 2016-07-07 12:00 | 109K | |
| Deploying .NET Applications (VBL).pdf | 2015-09-04 12:00 | 954K | |
| Demystifying Google Hacks.pdf | 2016-07-07 12:00 | 75K | |
| Delmar Technician's Guide to 68HC11 Microcontroller.pdf | 2015-09-04 12:00 | 3.0M | |
| Delmar. Modern Control Technology--Components & Systems (2nd Ed.).pdf | 2015-09-04 12:00 | 6.1M | |
| Delmar.Fiber Optics Technician's Manual (2nd Ed.).pdf | 2015-09-04 12:00 | 1.5M | |
| Delmar. Digital Signal Processing--Filtering Approach.pdf | 2015-09-04 12:00 | 3.3M | |
| Delmar.Digital Design with CPLD Applications & VHDL.pdf | 2015-09-04 12:00 | 8.6M | |
| Defeating_DEP_through_a_mapped_file.pdf | 2016-07-07 12:00 | 533K | |
| Debuging.pdf | 2016-07-07 12:00 | 47K | |
| Data Structures & Algorithms in Java -- SAMS.pdf | 2015-09-04 12:00 | 3.0M | |
| Data Networks IP and the Internet Protocols Design and Operation 2003.pdf | 2014-12-07 12:00 | 13M | |
| Data Binding in Macromedia Flash MX Professional 2004.pdf | 2015-09-04 12:00 | 186K | |
| Dangerous Google Searching for Secrets.pdf | 2016-07-07 12:00 | 2.1M | |
| Dangerous Google - Searching for Secrets.pdf | 2015-09-04 12:00 | 2.1M | |
| DangerousGoogle-SearchingForSecrets.pdf | 2014-12-07 12:00 | 2.1M | |
| DPA.pdf | 2009-02-03 12:00 | 217K | |
| DOiT Workbook.pdf | 2016-07-07 12:00 | 8.8M | |
| DOS ATTACKS USING SQL WILDCARDS.pdf | 2016-07-07 12:00 | 567K | |
| DNS Server RPC Interface buffer overflow.pdf | 2016-07-07 12:00 | 83K | |
| DHCP.pdf | 2016-07-07 12:00 | 330K | |
| DFRWS-EU-2016-12.pdf | 2016-07-07 12:00 | 395K | |
| DFRWS-EU-2016-7.pdf | 2016-07-07 12:00 | 1.2M | |
| DFRWS-EU-2016-2.pdf | 2016-07-07 12:00 | 2.6M | |
| DFA of Secret Key Cryptosystems.pdf | 2016-07-07 12:00 | 699K | |
| DEFCON-23-WMI-Attacks-Defense-Forensics.pdf | 2018-01-07 12:00 | 2.7M | |
| DEAMON - Pages 72.pdf | 2016-07-07 12:00 | 94K | |
| DEAMON-Guide du cracking pour debutants.pdf | 2016-07-07 12:00 | 867K | |
| DAVE_Quick_Start_Guide.pdf | 2015-09-04 12:00 | 1.1M | |
| D1T2 - Seunghun Han - Create Your Own Bad USB Device.pdf | 2016-05-28 12:00 | 3.5M | |
| Cyber Crime Investigator's Field Guide (Bruce Middleton).pdf | 2017-01-22 12:00 | 2.7M | |
| Custom-Porting-Guide.pdf | 2015-09-04 12:00 | 62K | |
| Cryptography for Developers - Simon Johnson.pdf | 2014-12-07 12:00 | 5.0M | |
| Cryptography Theory And Practice - Douglas Stinson.pdf | 2014-12-07 12:00 | 17M | |
| Cryptography-3.pdf | 2009-02-03 12:00 | 72K | |
| Cryptography-1.pdf | 2009-02-03 12:00 | 73K | |
| Cross Site Scripting Attacks Xss Exploits and Defense.pdf | 2014-12-07 12:00 | 7.3M | |
| Creation De Binaires Multiplateformes.pdf | 2016-07-07 12:00 | 243K | |
| Creating Server Controls.pdf | 2015-09-04 12:00 | 105K | |
| Creating Components in Flash MX (1).pdf | 2015-09-04 12:00 | 344K | |
| Crc Press - Handbook Of Neural Network Dsp.pdf | 2015-09-04 12:00 | 13M | |
| Crc Press - Handbook Of Lasers.pdf | 2015-09-04 12:00 | 8.1M | |
| Crc Press - Elementary Mathematical And Computational Tools For Electrical And Computer Engineers Using .pdf | 2015-09-04 12:00 | 9.2M | |
| CrashCourse_Metasploit 2.2.pdf | 2018-01-07 12:00 | 73K | |
| Craig Hunt -- Linux Network Servers.pdf | 2015-09-04 12:00 | 6.7M | |
| Crackme KillNag de KiTo.pdf | 2016-07-07 12:00 | 152K | |
| Cracking_Passwords_Guide.pdf | 2014-12-07 12:00 | 272K | |
| Cracking ZIP file s Password.pdf | 2016-07-07 12:00 | 16K | |
| Cover.pdf | 2016-07-07 12:00 | 374K | |
| Course Administration Guide.pdf | 2016-07-07 12:00 | 2.1M | |
| Cours_Hackademy 2.pdf | 2016-07-07 12:00 | 9.2M | |
| Cours_Hackademy 1.pdf | 2016-07-07 12:00 | 11M | |
| Cours-N-9.pdf | 2016-07-07 12:00 | 1.9M | |
| Cours-N-8.pdf | 2016-07-07 12:00 | 763K | |
| Cours-N-7.pdf | 2016-07-07 12:00 | 1.2M | |
| Cours-N-6.pdf | 2016-07-07 12:00 | 218K | |
| Cours-N-5.pdf | 2016-07-07 12:00 | 198K | |
| Cours-N-4.pdf | 2016-07-07 12:00 | 2.4M | |
| Cours-N-2.pdf | 2016-07-07 12:00 | 752K | |
| Cours-N-1.pdf | 2016-07-07 12:00 | 716K | |
| Counter Hack Reloaded.pdf | 2016-07-07 12:00 | 13M | |
| Corruption de la memoire lors de l exploitation.pdf | 2016-07-07 12:00 | 510K | |
| Coriolis Press - VS.NET The .NET Framework Black Book.pdf | 2015-09-04 12:00 | 6.6M | |
| Control Flow Obfuscations in Malwares.pdf | 2016-07-07 12:00 | 1.7M | |
| Contournement de passerelle antivirus.pdf | 2016-07-07 12:00 | 122K | |
| Content Security and Control SSM Administrator Guide.pdf | 2016-07-07 12:00 | 2.0M | |
| Contemporary Cryptography - Rolf Oppliger.pdf | 2014-12-07 12:00 | 7.7M | |
| Construction d un desassembleur de taille oriente Hooking.pdf | 2016-07-07 12:00 | 1.7M | |
| Connection-Oriented Networks - SONET, SDH, ATM, MPLS and Optical Networks .pdf | 2016-07-07 12:00 | 4.0M | |
| Connecting a Terminal to the Console Port on Catalyst Switches.pdf | 2016-07-07 12:00 | 166K | |
| Configuring the Catalyst Switched Port Analyzer (SPAN) Feature.pdf | 2016-07-07 12:00 | 220K | |
| Configuring and Analyzing Clustering on Catalyst Fixed Configuration Switches.pdf | 2016-07-07 12:00 | 496K | |
| Configuring Policy-Based Routing.pdf | 2016-07-07 12:00 | 109K | |
| Configuring InterVLAN Routing with Catalyst 3550.pdf | 2016-07-07 12:00 | 61K | |
| Configuring ISA Server 2000.pdf | 2015-09-04 12:00 | 6.8M | |
| Configuring EtherChannel and Trunking Between Catalyst 2950 a....pdf | 2016-07-07 12:00 | 61K | |
| Configuring CPE Back-to-Back Through G.SHDSL Ports.pdf | 2016-07-07 12:00 | 29K | |
| Configuring 802.1Q Trunking Between a Catalyst 3550 and Catalyst Switches That Run Cisco IOS Software.pdf | 2016-07-07 12:00 | 36K | |
| Configuration_Register_Settings .pdf | 2016-07-07 12:00 | 173K | |
| Configuration_Example_Easy_VPN.pdf | 2016-07-07 12:00 | 254K | |
| Conf_IKE_Features.pdf | 2016-07-07 12:00 | 323K | |
| Computer Vulnerabilities.pdf | 2015-09-04 12:00 | 477K | |
| Computer Vision - A Modern Approach (Prentice Hall 2002).pdf | 2015-09-04 12:00 | 50M | |
| Computer - Networking Essentials.pdf | 2015-09-04 12:00 | 5.1M | |
| Computer - Hackers Secrets - e-book.pdf | 2014-12-07 12:00 | 493K | |
| Complexity and Cryptography An Introduction - JOHN TALBOT.pdf | 2014-12-07 12:00 | 3.3M | |
| CompactFlash_Memory_Cards.pdf | 2016-07-07 12:00 | 196K | |
| Cody_SIP_N48.pdf | 2016-07-07 12:00 | 856K | |
| Coding and Cryptography Korner.pdf | 2015-09-04 12:00 | 517K | |
| Codegate 2010 Prequal - Problem Solution - PPP.pdf | 2016-07-07 12:00 | 848K | |
| Clustering.pdf | 2016-07-07 12:00 | 516K | |
| Classroom in a Book.pdf | 2015-09-04 12:00 | 18M | |
| Cisco_en_NS2_ILM_v20.pdf | 2016-07-07 12:00 | 9.3M | |
| Cisco_en_NS1_ILM_v20.pdf | 2016-07-07 12:00 | 8.0M | |
| Cisco_SNRS_10_full_nfw_D.pdf | 2016-07-07 12:00 | 10M | |
| Cisco_QandA_3845.pdf | 2016-07-07 12:00 | 179K | |
| Cisco_IPSec_VPN_troubleshooting.pdf | 2016-07-07 12:00 | 1.3M | |
| Cisco_Cisco_SS7_over_IP_Strategy.pdf | 2016-07-07 12:00 | 12M | |
| Cisco_COS.pdf | 2016-07-07 12:00 | 158K | |
| Cisco WebVPN for Routers.pdf | 2016-07-07 12:00 | 1.3M | |
| Cisco Voice over IP Fundamentals.pdf | 2016-07-07 12:00 | 6.1M | |
| Cisco VPN 3000 Concentrator.pdf | 2016-07-07 12:00 | 2.9M | |
| Cisco Unity Express GUI Administrator.pdf | 2016-07-07 12:00 | 2.0M | |
| Cisco Systems - Cisco Unified Communications System Engineer. UCSE. Student Guide v1.3.pdf | 2016-07-07 12:00 | 6.6M | |
| Cisco Systems - Cisco IP Telephony. Volume 1. CIPT1. Student Guide V4.1.pdf | 2016-07-07 12:00 | 1.4M | |
| Cisco Systems - Cisco IP Telephony. Volume 1-2. CIPT2. Student Guide V4.1.pdf.pdf | 2016-07-07 12:00 | 17M | |
| Cisco Software-Defined Wide Area Networks Designing, Deploying.pdf | 2020-08-26 12:00 | 40M | |
| Cisco Security Appliance System Log Messages, Version 7.1.pdf | 2016-07-07 12:00 | 4.4M | |
| Cisco Security Appliance Logging Configuration and System Log Messages.pdf | 2016-04-09 12:00 | 4.7M | |
| Cisco Security Appliance Command Reference.pdf | 2016-07-07 12:00 | 16M | |
| Cisco Security Appliance Command Line Configuration_Guide_Version7.pdf | 2016-07-07 12:00 | 6.7M | |
| Cisco Security Appliance Command Line Configuration Guide.pdf | 2016-04-09 12:00 | 11M | |
| Cisco Security Appliance Command Line Configuration Guide, Version 7.1.pdf | 2016-07-07 12:00 | 5.5M | |
| Cisco Secure PIX Firewall Fundamentals Advanced.pdf | 2015-09-04 12:00 | 281K | |
| Cisco Routers For The Desperate Router Management The Easy Way (2004) No Starch Presss.pdf | 2015-09-04 12:00 | 8.4M | |
| CiscoPress_CCNP-and-CCIE-Enterprise-Core_CCNP-Enterprise-Advanced-Routing-Portable-Command-Guide_Technet24.pdf | 2023-11-01 12:00 | 4.7M | |
| Cisco Press Voice over Frame ATM and IP.pdf | 2016-07-07 12:00 | 33M | |
| Cisco Press CCSP CSI Exam Certification Guide.pdf | 2016-07-07 12:00 | 544K | |
| Cisco Press CCNP Practical Studies - Routing.pdf | 2016-07-07 12:00 | 2.6M | |
| Cisco Press 2006 - CCIE Routing and Switching Official Exam Certification Guide 2nd Edition.pdf | 2016-07-07 12:00 | 9.1M | |
| Cisco Press 2006 - Advanced Host Intrusion Prevention with CSA.pdf | 2016-07-07 12:00 | 25M | |
| Cisco Press 2005 - Cisco CallManager Fundamentals Second Edition.pdf | 2016-07-07 12:00 | 73M | |
| Cisco Press 2004 - Cisco CCIE Security Student Guide.pdf | 2016-07-07 12:00 | 8.5M | |
| Cisco Press 2004 - 640-861 CCDA Exam Certification Guide Second Edition.pdf | 2016-07-07 12:00 | 29M | |
| Cisco Press 2003 - OSPF Network Design Solutions Second Edition.pdf | 2016-07-07 12:00 | 15M | |
| Cisco Press 2003 - MPLS and VPN Architectures Volume II.pdf | 2016-07-07 12:00 | 8.9M | |
| Cisco Press 2003 - Cisco Catalyst QoS - Quality of Service in Campus Networks.pdf | 2016-07-07 12:00 | 8.2M | |
| Cisco Press 2003 - CCIE Self Study CCIE Practical Studies Volume II.pdf | 2016-07-07 12:00 | 20M | |
| Cisco Press 2003 - CCIE Security Exam Certification.pdf | 2016-07-07 12:00 | 16M | |
| Cisco Press 2003 - CCIE Routing and Switching Exam Certification Guide.pdf | 2016-07-07 12:00 | 10M | |
| Cisco Press 2003 - CCIE.Self.Study.CCIE.Security.Exam.Certification.Guide.pdf | 2016-07-07 12:00 | 9.8M | |
| Cisco Press 2003 - 642-871 CCDP ARCH Student Guide.pdf | 2016-07-07 12:00 | 17M | |
| Cisco Press 2002 - DWDM Network Designs And Engineering Solutions.pdf | 2016-07-07 12:00 | 8.5M | |
| Cisco Press 2002 - Cisco ISP Essentials.pdf | 2016-07-07 12:00 | 2.5M | |
| Cisco Press 2001 - Deploying Cisco Voice over IP Solutions.pdf | 2016-07-07 12:00 | 5.0M | |
| Cisco Press 2000 - Voice over IP Fundamentals.pdf | 2016-07-07 12:00 | 6.1M | |
| Cisco Press 2000 - CCIE Developing IP Multicast Networks.pdf | 2016-07-07 12:00 | 3.1M | |
| Cisco Press 2000 - BGP - Internet Routing Architectures, 2nd Edition.pdf | 2016-07-07 12:00 | 4.7M | |
| Cisco Press 1999 - Internetworking Troubleshooting Handbook.pdf | 2016-07-07 12:00 | 1.3M | |
| Cisco Press - Self Study CCSP Cisco Secure VPN Exam Certification Guide.pdf | 2016-07-07 12:00 | 19M | |
| Cisco Press - Metro Ethernet.pdf | 2016-07-07 12:00 | 5.2M | |
| CiscoPress - MPLS and VPN Architectures - VolumeII.pdf | 2016-07-07 12:00 | 8.9M | |
| CiscoPress - MPLS and VPN Architectures - Volume I.pdf | 2016-07-07 12:00 | 6.7M | |
| CiscoPress - MPLS Fundamentals.pdf | 2016-07-07 12:00 | 4.2M | |
| Cisco Press - DQOS Exam Certification Guide (642-641 QOS CCIP).pdf | 2016-07-07 12:00 | 13M | |
| CiscoPress - Cisco Software-Defined Wide-Area Networks.pdf | 2023-04-11 12:00 | 21M | |
| Cisco Press - Cisco Secure Intrusion Detection System.pdf | 2016-07-07 12:00 | 1.8M | |
| CiscoPress-Cisco-Data-Center-Fundamentals.pdf | 2023-11-01 12:00 | 32M | |
| Cisco Press - CallManager System Guide.pdf | 2016-07-07 12:00 | 5.3M | |
| Cisco Press - CallManager Admin Guide.pdf | 2016-07-07 12:00 | 5.1M | |
| Cisco Press - CCSP SECUR Exam Certification Guide (CCSP Self-Study, 642-501).pdf | 2016-07-07 12:00 | 8.7M | |
| Cisco Press - CCSP Cisco Secure PIX Firewall Advanced Exam Certification Guide.pdf | 2016-07-07 12:00 | 15M | |
| Cisco Press - CCSP - 642-541 - CSI.pdf | 2016-07-07 12:00 | 7.3M | |
| CiscoPress-CCNP-and-CCIE-Security-Core-SCOR-350-701-Official-Cert-Guide-2nd-Edition.pdf | 2023-12-02 12:00 | 14M | |
| CiscoPress-CCNP-and-CCIE-Enterprise-Core-ENCOR-350-401-Official-Cert-Guide.pdf | 2023-12-02 12:00 | 17M | |
| CiscoPress-CCNP-and-CCIE-Enterprise-Core-ENCOR-350-401-Official-Cert-Guide (1).pdf | 2023-12-02 12:00 | 17M | |
| CiscoPress-CCNP-and-CCIE-Collaboration-Core-CLCOR-350-801-Official-Cert-Guide-2nd-Edition.pdf | 2023-12-02 12:00 | 18M | |
| CiscoPress-CCNP-Enterprise-Design-ENSLD-300-420-Official-Cert-Guide_Technet24.pdf | 2023-11-01 12:00 | 24M | |
| CiscoPress-CCNP-Enterprise-Advanced-Routing-ENARSI-300-410-Official-Cert-Guide.pdf | 2023-12-02 12:00 | 39M | |
| Cisco Press - CCIE Security Exam Certification Guide.pdf | 2016-07-07 12:00 | 16M | |
| CiscoPress-CCIE-Enterprise-Infrastructure-Foundation-2nd-Edition.pdf | 2023-11-01 12:00 | 37M | |
| Cisco PIX 515E Security Appliance Getting Started Guide.pdf | 2016-04-09 12:00 | 2.2M | |
| Cisco Network Security Little Black Book(Paraglyph Press).pdf | 2015-09-04 12:00 | 3.0M | |
| Cisco Intrusion Detection System Appliance and Module Installation and Configuration Guide Version 4.1.pdf | 2016-07-07 12:00 | 4.7M | |
| Cisco IP Videoconferencing SRND.pdf | 2016-07-07 12:00 | 1.6M | |
| Cisco IP Telephony Solution Guide.pdf | 2016-07-07 12:00 | 10M | |
| Cisco IP Telephony QoS Design Guide.pdf | 2016-07-07 12:00 | 3.4M | |
| Cisco IP Telephony Network Design Guide.pdf | 2016-07-07 12:00 | 5.0M | |
| Cisco IP Telephony Design Guide.pdf | 2016-07-07 12:00 | 10M | |
| Cisco IP Telephony - Network Design Guide.pdf | 2016-07-07 12:00 | 5.0M | |
| Cisco IP Routing Fundamentals.pdf | 2015-09-04 12:00 | 2.2M | |
| Cisco IOS Software Selector - Cisco Systems.pdf | 2016-09-10 12:00 | 26K | |
| Cisco IOS ISDN Voice Configuration Guide.pdf | 2016-07-07 12:00 | 2.8M | |
| Cisco IOS H.323 Configuration Guide .pdf | 2016-07-07 12:00 | 2.6M | |
| Cisco Catalyst QoS Quality of Service in Campus Networks.pdf | 2016-07-07 12:00 | 8.2M | |
| Cisco CCNA Study Guide Exam 640-802 6th Edition.pdf | 2016-07-07 12:00 | 39M | |
| Cisco.Unified.Communications.System.Administrator.UCSA.1.1.pdf | 2015-09-04 12:00 | 2.5M | |
| Cisco.Secure.Intrusion.Detection.Version.4.0.Student.Guide.2004.eBook-DDU.pdf | 2016-07-07 12:00 | 14M | |
| Cisco.Routing TCPIP Vol 2.pdf | 2015-09-04 12:00 | 93M | |
| Cisco.Press.Web.Security.Field.Guide.eBook-KB.pdf | 2015-09-04 12:00 | 22M | |
| Cisco.Press.DWDM.Network.Designs.and.Engineering.Solutions.eBook-KB.pdf | 2015-09-04 12:00 | 8.5M | |
| Cisco.Press.CCSP.SNPA.Official.Exam.Certification.Guide.3rd.Edition.Apr.2006.pdf | 2016-07-07 12:00 | 9.1M | |
| Cisco.Press.CCNP.Routing.Exam.Certification.Guide.pdf.rar | 2016-07-07 12:00 | 32K | |
| Cisco.Press.CCIE.Self.Study.CCIE.Security.Exam.Certification.Guide.pdf | 2016-07-07 12:00 | 9.8M | |
| Cisco.Press.CCIE.Self.Study.CCIE.Practical.Studies.Volume.II.pdf | 2016-07-07 12:00 | 20M | |
| Cisco.Press.CCIE.Security.Exam.Certification.Guide.Self.Study.2nd.Edition.May.2005.pdf | 2016-07-07 12:00 | 7.0M | |
| Cisco.Press.CCIE.Developing.Ip.Multicast.Networks.pdf | 2016-07-07 12:00 | 3.1M | |
| Cisco.Implementing.Cisco.Multicast.MCAST.1.0.pdf | 2015-09-04 12:00 | 6.7M | |
| Cisco.Designing.VPN.Security.pdf | 2016-07-07 12:00 | 8.3M | |
| Cisco.Designing.Perimeter.Security.pdf | 2016-07-07 12:00 | 5.2M | |
| Cisco.Deploying.QOS.for.Enterprise.Networks.DQOS.Student.Guide.v1.0a-DDU.pdf | 2016-07-07 12:00 | 11M | |
| Cisco.Building.Scalable.Cisco.Internetworks.BSCI.Student.Guide.v3.0.vol.2.pdf | 2016-07-07 12:00 | 5.9M | |
| Cisco.Building.Scalable.Cisco.Internetworks.BSCI.Student.Guide.v3.0.vol.1.pdf | 2016-07-07 12:00 | 6.1M | |
| Cisco.Aironet.Wireless.LAN.Fundamentals.AWLF.3.1.pdf | 2015-09-04 12:00 | 7.3M | |
| Cisco-secure-pix-firewall-advanced-101.pdf | 2015-09-04 12:00 | 4.6M | |
| Cisco - VoIP Configuration Guide.pdf | 2016-07-07 12:00 | 10M | |
| Cisco - QoS for VoIP Solutions Guide.pdf | 2016-07-07 12:00 | 381K | |
| Cisco-IOS.Naming.pdf | 2016-09-10 12:00 | 154K | |
| Cisco - Designing Network Security.pdf | 2015-09-04 12:00 | 1.3M | |
![[ ]](/icons/compressed.gif) | Cisco - CCSP Cisco Secure VPN Exam Certification Guide (CCSP Self-Study).pdf.zip | 2016-07-07 12:00 | 16M | |
| Cisco - CCSP Cisco Secure PIX Firewall Advanced Exam Certification Guide (CCSP Self-Study).pdf.zip | 2016-07-07 12:00 | 9.6M | |
| Chu_SIP_N48.pdf | 2016-07-07 12:00 | 140K | |
| Christopher_SIP_N48.pdf | 2016-07-07 12:00 | 571K | |
| Chip & Pin Broken_Smart Card Authentication.pdf | 2016-07-07 12:00 | 1.4M | |
| Charles.C.Thomas-Document.Security.Protecting.Physical.and.Electronic.Content.2007.RETAiL.EBook.pdf | 2014-12-07 12:00 | 1.3M | |
| Chapter 10.pdf | 2016-07-07 12:00 | 387K | |
| Chapter 9.pdf | 2016-07-07 12:00 | 764K | |
| Chapter 8.pdf | 2016-07-07 12:00 | 1.8M | |
| Chapter 7.pdf | 2016-07-07 12:00 | 1.7M | |
| Chapter 6.pdf | 2016-07-07 12:00 | 1.1M | |
| Chapter 5.pdf | 2016-07-07 12:00 | 799K | |
| Chapter 4.pdf | 2016-07-07 12:00 | 1.7M | |
| Chapter 3.pdf | 2016-07-07 12:00 | 1.0M | |
| Chapter 2.pdf | 2016-07-07 12:00 | 864K | |
| Chap_07.pdf | 2009-02-03 12:00 | 167K | |
| Changing the Pe-File Entry-Point to avoid anti-virus detection.pdf | 2016-07-07 12:00 | 428K | |
| Changing the PE-File Entry-Point to avoid anti-virus detection.pdf | 2016-07-07 12:00 | 428K | |
| Challenge SSTIC 2010 elements de reponse.pdf | 2016-07-07 12:00 | 1.1M | |
| Challenge SSTIC 2010_ elements de reponse.pdf | 2016-07-07 12:00 | 1.1M | |
| Challenge Insomni_Hack 2008 - Solutions.pdf | 2016-07-07 12:00 | 688K | |
| Challenge Insomni Hack 2008-solutions.pdf | 2016-07-07 12:00 | 688K | |
| Challenge Insomni Hack 2008 - Solutions.pdf | 2016-07-07 12:00 | 688K | |
| Certified Ethical Hacker (CEH) v3.0 Official Course.pdf | 2014-12-07 12:00 | 26M | |
| Centos 4 System Administration Guide.pdf | 2015-09-04 12:00 | 9.6M | |
| CentOS Bible.pdf | 2015-09-04 12:00 | 18M | |
| Cell Planning with Capacity Expansion in Mobile Communications - A Tabu Search Approach.pdf | 2016-07-07 12:00 | 119K | |
| Catalyst_3560_Switcht_SCGuide.pdf | 2016-07-07 12:00 | 11M | |
| Catalyst 3560 Switch Software Configuration Guide.pdf | 2016-07-07 12:00 | 12M | |
| Catalyst 3550 Multilayer Switch Software Configuration Guide, Rel. 12.2_25SEE.pdf | 2016-07-07 12:00 | 11M | |
| Catalyst 3550 Multilayer Switch Hardware Installation Guide.pdf | 2016-07-07 12:00 | 2.7M | |
| Cat2950SI.pdf | 2016-07-07 12:00 | 125K | |
| Cat2950EI.pdf | 2016-07-07 12:00 | 135K | |
| CSVPN Student Guide V4.0-Cisco Secure Virtual Private Networks[2004].pdf | 2016-07-07 12:00 | 16M | |
| CSS Web Sites with Dreamweaver MX - 2004.pdf | 2015-09-04 12:00 | 14M | |
| CSPFA Student Guide V3.2-Cisco Secure PIX Firewall Advanced[2004].pdf | 2016-07-07 12:00 | 7.0M | |
| CSI Student Guide V2.0-Cisco SAFE Implementation[2004].pdf | 2016-07-07 12:00 | 4.5M | |
| CSIDS Student Guide V4.0-Cisco Secure Intrusion Detection[2004].pdf | 2016-07-07 12:00 | 14M | |
| CSE-97-15.pdf | 2009-02-03 12:00 | 466K | |
| CROSS-SITE TRACING (XST) THE NEW TECHNIQUES AND EMERGING THREATS TO BYPASS CURRENT WEB SECURITY MEASURES USING TRACE AND XSS.pdf | 2016-07-07 12:00 | 774K | |
| CROSS-SITE TRACING (XST).pdf | 2016-07-07 12:00 | 774K | |
| CRN.UK.Magazine.Apr.04.2005.pdf | 2015-09-04 12:00 | 7.3M | |
| CRC Press - The Hacker's Handbook.pdf | 2015-09-04 12:00 | 18M | |
| CRC Press - Introduction to Forensic Sciences. -2nd Edition.pdf | 2015-09-04 12:00 | 7.7M | |
| CRC Press - Information Security Management Handbook, Fifth Edition.pdf | 2016-07-07 12:00 | 43M | |
| CRC Press - Handbook of Multisensor Data Fusion.pdf | 2015-09-04 12:00 | 8.5M | |
| CRC Press - Forensic Engineering Investigation.pdf | 2015-09-04 12:00 | 6.9M | |
| CRC Press - Cyber Forensics.pdf | 2015-09-04 12:00 | 3.7M | |
| CRC Press - Cyber Crime Investigator's Field Guide.pdf | 2015-09-04 12:00 | 2.3M | |
| CRC Press - Behavioral and Cognitive Modeling of the Human Brain.pdf | 2015-09-04 12:00 | 8.6M | |
| CRC Press - Atlas of Human Hair Microscopic Characteristics.pdf | 2015-09-04 12:00 | 611K | |
| CRC Press - Artificial Intelligence and Soft Computing - Behavioral and Cognitive Modeling of the Human Brain.pdf | 2015-09-04 12:00 | 8.6M | |
| CRC Press - Artificial Intelligence and Expert Systems for Engineers.pdf | 2015-09-04 12:00 | 3.7M | |
| COMPSTAT 2002 - Proceedings in Computational Statistics [Hardle, Ronz].pdf | 2015-09-04 12:00 | 481K | |
| CNAP Lab Manual-en_TSHOOT_SLM_v60.pdf | 2016-07-07 12:00 | 44M | |
| CIT_ss.pdf | 2016-07-07 12:00 | 172K | |
| CITCTF 2010 writeups by Nibbles.pdf | 2016-07-07 12:00 | 629K | |
| CISCO.DESGN.STUDENT.GUIDE.VERSION.1.1-DDU.pdf | 2016-07-07 12:00 | 34M | |
| CISCO.ARCH.STUDENT.GUIDE.VERSION.1.1-DDU.pdf | 2016-07-07 12:00 | 26M | |
| CHJ_02ge.pdf | 2009-02-03 12:00 | 275K | |
| CEIC2006-Defeating_Forensic_Analysis.pdf | 2018-01-07 12:00 | 395K | |
| CDMA Systems Engineering Handbook (Artech House).pdf | 2016-07-07 12:00 | 37M | |
| CCST-Cisco-Certified-Support-Todd-Lammle.pdf | 2023-11-01 12:00 | 14M | |
| CCSP_SECUR1.1_Knet_HiRes.pdf | 2016-07-07 12:00 | 8.9M | |
| CCSP Complete Study Guide.pdf | 2016-07-07 12:00 | 25M | |
| CCSP Complete Study Guide (Exams 642-501,642-511,642-521,642-531,642-541) [Sybex 2005].pdf | 2016-07-07 12:00 | 25M | |
| CCSP Cisco Secure VPN.pdf | 2016-07-07 12:00 | 17M | |
| CCSP Cisco Secure PIX.pdf | 2016-07-07 12:00 | 12M | |
| CCNP ONT Quick Reference Sheets (Exam 642-845) by CiscoNet.pdf | 2016-07-07 12:00 | 1.7M | |
| CCNP BSCI Quick Reference Sheets (Exam 642-901) by CiscoNet.pdf | 2016-07-07 12:00 | 2.2M | |
| CCNP BCMSN Quick Reference Sheets (Exam 642-812) by CiscoNet.pdf | 2016-07-07 12:00 | 1.8M | |
| CCNP-and-CCIE-Enterprise-Core-Encor-350-401-Official-Cert-Guide-2nd-Edition.pdf | 2023-11-01 12:00 | 66M | |
| CCNP-Enterprise-Design-ENSLD-300-420-Official-Cert-Guide-2nd-Edition.pdf | 2024-01-25 12:00 | 60M | |
| CCNA-ICND2 Exam Certification Guide.pdf | 2016-07-07 12:00 | 176K | |
| CCM5-Bootcamp.pdf | 2016-07-07 12:00 | 17M | |
| CCIE_Redistribution.pdf | 2016-07-07 12:00 | 833K | |
| CCIE_Network_Design.pdf | 2016-07-07 12:00 | 2.3M | |
| CCIESummit Keynote.pdf | 2016-07-07 12:00 | 17M | |
| CCIE Self-Study CCIE Security Exam Certification Guide.pdf | 2016-07-07 12:00 | 9.8M | |
| CCIE Security book.pdf | 2016-07-07 12:00 | 16M | |
| CCIE Security Exam Certification Certification Guide.pdf | 2016-07-07 12:00 | 10M | |
| CCIE Routing and Switching v4.0 Quick Reference (eBook), 2nd Edition.pdf | 2016-07-07 12:00 | 5.2M | |
| CCIE Routing and Switching Practice Labs.pdf | 2016-07-07 12:00 | 3.1M | |
| CCDA_DESGN1.1.pdf | 2016-07-07 12:00 | 34M | |
| C541CramSheet.pdf | 2016-07-07 12:00 | 42K | |
| C.Sullivan, J.Asher, P.Mauvais - Advanced Host Intrusion Prevention with CSA. 2006.pdf | 2016-07-07 12:00 | 25M | |
| Bypass protections heap sur Windows.pdf | 2016-07-07 12:00 | 159K | |
| Bypassing Stack Cookies, SafeSeh, HW DEP and ASLR.pdf | 2016-07-07 12:00 | 3.1M | |
| Bypassing Stack Cookies, SafeSeh, HW DEP and ASLR.pdf | 2016-07-07 12:00 | 3.1M | |
| Bypassing Secure Web Transactions via DNS Corruption.pdf | 2016-07-07 12:00 | 23K | |
| Bypassing SEHOP.pdf | 2016-07-07 12:00 | 195K | |
| Bulletproof Wireless Security - GSM, UMTS, 802.11, And Ad Hoc Security 2005.pdf | 2014-12-07 12:00 | 3.3M | |
| Building Wireless Community Networks 1st ed 2002.pdf | 2014-12-07 12:00 | 1.0M | |
| Building Service Provider Networks .pdf | 2016-07-07 12:00 | 2.7M | |
| Building Embedded Linux Systems2.pdf | 2015-09-04 12:00 | 5.5M | |
| Building Cisco Multilayer Switched Networks Student Guide.pdf | 2016-07-07 12:00 | 640K | |
| Build Your Own Security Lab for Network Testing.pdf | 2016-07-07 12:00 | 8.6M | |
| Buffer Overflow Attacks - Detect Exploit Prevent.pdf | 2016-07-07 12:00 | 5.4M | |
| Broadband Telecommunications Handbook, 2nd ed.pdf | 2016-07-07 12:00 | 23M | |
| Botnets - The killer web applications.pdf | 2014-12-07 12:00 | 7.0M | |
| BootRoot.pdf | 2016-07-07 12:00 | 437K | |
| Blind_SQLInjection.pdf | 2016-07-07 12:00 | 219K | |
| Blind Sql Injection with Regular Expressions Attack.pdf | 2016-07-07 12:00 | 222K | |
| Blind-sql-injections.pdf | 2016-07-07 12:00 | 162K | |
| BlackHat-Europe-2009-DiCroce-CYBSEC-Publication-SAP-Penetration-Testing-slides.pdf | 2016-07-07 12:00 | 3.3M | |
| BlackHat-DC-2010-Medina-Abusing-insecure-features-of-Internet-Explorer-wp.pdf | 2016-07-07 12:00 | 575K | |
| Black - IBM and the Holocaust - The Strategic Alliance Between Nazi German.pdf | 2015-09-04 12:00 | 3.6M | |
| Big Book of Windows Hacks.pdf | 2016-07-07 12:00 | 74M | |
| Beginning Ubuntu Linux Server Administration - From Novice to Professional (Apress, 2007).pdf | 2015-09-04 12:00 | 4.6M | |
| Basics of Penetration Testing.pdf | 2016-07-07 12:00 | 3.7M | |
| Backup & Recovery-2006-Preston-Oreilly.pdf | 2015-09-04 12:00 | 5.9M | |
| BSidesAth16_Perform_Effective_Command_Injection_Attacks_Like_Mr.Robot_Final.pdf | 2016-07-10 12:00 | 4.0M | |
| BRICS-RS-94-38.pdf | 2009-02-03 12:00 | 293K | |
| BGPSEC_RTBH.pdf | 2016-07-07 12:00 | 821K | |
| BCSI_ss.pdf | 2016-07-07 12:00 | 517K | |
| BCRAN_ss.pdf | 2016-07-07 12:00 | 270K | |
| BCMSN_ss.pdf | 2016-07-07 12:00 | 531K | |
| Automating Linux and Unix System Administration ,Second Edition(2009).pdf | 2015-09-04 12:00 | 2.1M | |
| Authentication and Authorization Server Groups for VPN Users via ASDM Configuration Example.pdf | 2016-07-07 12:00 | 211K | |
| Authentication Authorization and Accounting Configuration on the Cisco PIX Firewall.pdf | 2016-07-07 12:00 | 6.4M | |
| Auerbach.Pub.The.Hackers.Handbook.The.Strategy.Behind.Breaking.into.and.Defending.Networks.Nov.20.pdf | 2014-12-07 12:00 | 18M | |
| Auerbach.Practical.Hacking.Techniques.and.Countermeasures.Nov.2006.pdf | 2014-12-07 12:00 | 144M | |
| Attacks on Steganographic Systems.pdf | 2016-07-07 12:00 | 964K | |
| Attacks-on-UEFI-security.pdf | 2016-07-07 12:00 | 2.4M | |
| Attacks-on-Biometric-Systems.pdf | 2016-07-07 12:00 | 206 | |
| Attacking with HTML5.pdf | 2016-07-07 12:00 | 757K | |
| Attacking the DNS Protocol.pdf | 2014-12-07 12:00 | 322K | |
| Attacking the DNS Protocol - Security Paper v2.pdf | 2016-07-07 12:00 | 322K | |
| Attacking DDoS At The Source.pdf | 2016-07-07 12:00 | 155K | |
| Attacking Automatic Wireless Network Selection.pdf | 2016-07-07 12:00 | 129K | |
| Asterisk TurnKey v 3.5.pdf | 2016-07-07 12:00 | 5.2M | |
| Asterisk The Future of Telephony.pdf | 2016-07-07 12:00 | 8.1M | |
| Asterisk Pt-Br-WBA.pdf | 2016-07-07 12:00 | 5.8M | |
| Asterisk Handbook-Draft.pdf | 2016-07-07 12:00 | 3.4M | |
| Asterisk - The Future of Telephony.pdf | 2016-07-07 12:00 | 4.8M | |
| A small tutorial on sbd Shadowinteger-s Backdoor.pdf | 2016-07-07 12:00 | 22K | |
| A small tutorial on sbd.pdf | 2016-07-07 12:00 | 22K | |
| Arp poisoning & MITM & Dos.pdf | 2016-07-07 12:00 | 30K | |
| Apress.The.Definitive.Guide.to.GCC.2nd.Edition.Aug.2006.pdf | 2015-09-04 12:00 | 11M | |
| Apress.The.Definitive.Guide.to.CentOS.Jul.2009.pdf | 2015-09-04 12:00 | 12M | |
| Apress.Pro.Open.Source.Mail.Building.an.Enterprise.Mail.Solution.Sep.2006.pdf | 2015-09-04 12:00 | 7.2M | |
| Apress.Linux.System.Administration.Recipes.A.Problem.Solution.Approach.Oct.2009(1).pdf | 2015-09-04 12:00 | 5.2M | |
| Apress.Beginning.Ubuntu.LTS.Server.Administration.From.Novice.to.Professional.2nd.Edition.Sep.2008.eBook-DDU.pdf | 2015-09-04 12:00 | 3.4M | |
| Apress - Pulling Strings with Puppet - Configuration Management Made Easy (Feb 2008).pdf | 2015-09-04 12:00 | 3.6M | |
| Apress - Pro DNS and BIND (Aug.2005).pdf | 2015-09-04 12:00 | 3.1M | |
| Apress-Pro.OpenSolaris.(2009).pdf | 2015-09-04 12:00 | 15M | |
| Applied Cryptography - Bruce Schenier.pdf | 2016-07-07 12:00 | 2.8M | |
| Applications and Services in Wireless Networks 2001.pdf | 2014-12-07 12:00 | 4.7M | |
| Application mapping.pdf | 2016-07-07 12:00 | 678K | |
| Application Optimisation and Application Security.pdf | 2016-07-07 12:00 | 7.5M | |
| Apache webserver security analysis.pdf | 2015-09-04 12:00 | 1.1M | |
| Apache Server 2 Bible - 2002.pdf | 2015-09-04 12:00 | 3.4M | |
| Apache Security and Auditing.pdf | 2015-09-04 12:00 | 255K | |
| Apache Security - Ivan Ristic - Oreilly - 2005.pdf | 2015-09-04 12:00 | 2.8M | |
| Apache Security - Improving the security your web server - 41P - English.pdf | 2015-09-04 12:00 | 1.8M | |
| An Introduction to Arp Spoofing.pdf | 2016-07-07 12:00 | 29K | |
| Althos.Introduction.to.IP.Telephony.eBook-KB.pdf | 2016-07-07 12:00 | 5.6M | |
| Ahmad-Reza_Sadeghi,_David_Naccache,_Pim_Tuyls-Towards_Hardware-Intrinsic_Security__Foundations_and_Practice_(Information_Security_and_Cryptography)(2010).pdf | 2014-12-07 12:00 | 8.0M | |
| Advanced_MPLS_Design_and_Implementation.pdf | 2016-07-07 12:00 | 7.4M | |
| Advanced XSS.pdf | 2016-07-07 12:00 | 74K | |
| Advanced SQL Injection In SQL Server Applications.pdf | 2016-07-07 12:00 | 291K | |
| Advanced SQL Injection 2.pdf | 2016-07-07 12:00 | 2.0M | |
| Advanced SQL Injection.pdf | 2016-07-07 12:00 | 1.9M | |
| Advanced PostgreSQL SQL Injection and Filter Bypass Techniques.pdf | 2016-07-07 12:00 | 154K | |
| Advanced Operating Systems and Kernel Applications Techniques and Technologies.pdf | 2016-07-07 12:00 | 6.2M | |
| Administering Cisco QoS in IP Networks.pdf | 2016-07-07 12:00 | 3.7M | |
| Addressing_and_Services.pdf | 2016-07-07 12:00 | 3.9M | |
| ActualTest ROUTE.pdf | 2016-07-07 12:00 | 12M | |
| ActualTest%20640-801%20v05.24.07.pdf | 2016-07-07 12:00 | 19M | |
| Access Denied The Practice and Policy of Global Internet Filtering.pdf | 2016-07-07 12:00 | 7.8M | |
| Abusing Insecure Features of Internet Explorer.pdf | 2016-07-07 12:00 | 575K | |
| Absolute_OpenBSD.pdf | 2015-09-04 12:00 | 1.7M | |
| Absolute Openbsd Unix For The Practical Paranoid.pdf | 2015-09-04 12:00 | 4.2M | |
| Absolute OpenBSD - UNIX For The Practical Paranoid (2003).pdf | 2015-09-04 12:00 | 1.4M | |
| Absolute Beginner's Guide To Security, Spam, Spyware & Viruses-Walker.pdf | 2015-09-04 12:00 | 10M | |
| A_Tour_Beyond_BIOS_Launching_STM_to_Monitor_SMM_in_EFI_Developer_Kit_II.pdf | 2016-07-07 12:00 | 870K | |
| ATM and MPLS Theory and.Application.pdf | 2016-07-07 12:00 | 26M | |
| ATM Signalling, Protocols & Practice .pdf | 2016-07-07 12:00 | 12M | |
| ATM Mode for Two-Wire or Four-Wire SHDSL.pdf | 2016-07-07 12:00 | 560K | |
| ASLR Smack & Laugh Reference.pdf | 2016-07-07 12:00 | 509K | |
| ASLR Address Space Layout Randomization.pdf | 2016-07-07 12:00 | 259K | |
| ARP cache poisoning.pdf | 2016-07-07 12:00 | 1.5M | |
| A Professionals Guide To Data Communication In A TCPIP World 2004.pdf | 2014-12-07 12:00 | 3.5M | |
| A Practical Message Falsification Attack on WPA.pdf | 2016-07-07 12:00 | 547K | |
| A Practical Guide to Ubuntu Linux (Prentice Hall, 2008).pdf | 2015-09-04 12:00 | 9.0M | |
| APACHE - Administrator's Handbook - March 2002.pdf | 2015-09-04 12:00 | 2.2M | |
| A Middleware Approach to Asynchronous and Backward Compatible Detection and Prevention of ARP Cache Poisoning.pdf | 2016-07-07 12:00 | 58K | |
| A Guide to Kernel Exploitation.pdf | 2016-07-07 12:00 | 5.3M | |
| AGPS_01OCFB-paper.pdf | 2009-02-03 12:00 | 279K | |
| A Forensic Analysis.pdf | 2018-01-07 12:00 | 41K | |
| AB-9800.pdf | 2009-02-03 12:00 | 233K | |
| A-forensic-analysis-of-apt-lateral-movement-in-windows-environment.pdf | 2018-01-07 12:00 | 4.8M | |
| 87201232.pdf | 2016-07-07 12:00 | 12M | |
| 87200899.pdf | 2016-07-07 12:00 | 927K | |
| 87200724.pdf | 2016-07-07 12:00 | 948K | |
| 87200708.pdf | 2016-07-07 12:00 | 3.2M | |
| 20120813.pdf | 2016-07-07 12:00 | 674K | |
| 3077366-HackerHighSchool.pdf | 2014-12-07 12:00 | 2.9M | |
| 731986-Hacker's Desk Reference.pdf | 2014-12-07 12:00 | 715K | |
| 285063-Hacker.Bibel.[278.kB_www.netz.ru].pdf | 2014-12-07 12:00 | 278K | |
| 43119_VPN.pdf | 2016-07-07 12:00 | 415K | |
| 39658.pdf | 2016-07-07 12:00 | 5.9M | |
| 3845datasheet.pdf | 2016-07-07 12:00 | 563K | |
| 2950SoftwareInstal.pdf | 2016-07-07 12:00 | 8.2M | |
| 2950SCG.pdf | 2016-04-08 12:00 | 7.5M | |
| 2950HardwareInstal.pdf | 2016-07-07 12:00 | 4.6M | |
| 2821.pdf | 2016-07-07 12:00 | 207K | |
| 2800_qsg.pdf | 2016-07-07 12:00 | 3.4M | |
| 2600 config examples.pdf | 2016-07-07 12:00 | 338K | |
| 2016_drown_attack_ssl.pdf | 2016-03-02 12:00 | 412K | |
| 2016_bypass_aslr.pdf | 2016-10-19 12:00 | 896K | |
| 2016_Crypto_101.pdf | 2016-09-08 12:00 | 16M | |
| 2016_Codes_et_cryptologie.pdf | 2016-02-28 12:00 | 464K | |
| 2015_weakning_crypto_systems.pdf | 2016-09-13 12:00 | 399K | |
| 2015_timing_attack_openssl_ecdsa.pdf | 2015-08-31 12:00 | 1.2M | |
| 2015_rsa_lattice_attacks.pdf | 2015-09-12 12:00 | 308K | |
| 2015_pohlig-hellman_ec.pdf | 2016-10-31 12:00 | 177K | |
| 2015_glibc_adventures.pdf | 2015-04-12 12:00 | 1.0M | |
| 2014_radare2_commands.pdf | 2014-09-13 12:00 | 99K | |
| 2014_perfect_forward_security.pdf | 2014-09-12 12:00 | 196K | |
| 2014_mathematical_cryptography.pdf | 2016-09-11 12:00 | 1.2M | |
| 2014_crypto_monnaie_pour_inverstisseurs.pdf | 2014-12-07 12:00 | 3.2M | |
| 2014_applied_crypto_hardening.pdf | 2015-01-08 12:00 | 1.3M | |
| 2014_RE_for_beginners.pdf | 2014-10-20 12:00 | 6.2M | |
| 2013_tutorial_on_whitebox_aes.pdf | 2015-03-22 12:00 | 727K | |
| 2013_the_art_of_leak.pdf | 2014-09-11 12:00 | 1.0M | |
| 2013_string_oriented_programming.pdf | 2014-10-07 12:00 | 297K | |
| 2013_smashing_the_stack.pdf | 2014-09-11 12:00 | 173K | |
| 2013_blind_ROP.pdf | 2014-09-11 12:00 | 475K | |
| 2012_rop.pdf | 2014-09-11 12:00 | 205K | |
| 2011_remote_kernel_exploit.pdf | 2014-09-11 12:00 | 359K | |
| 2011_Attacking_the_core.pdf | 2015-02-01 12:00 | 5.3M | |
| 2010_memory_corruption_attacks.pdf | 2014-10-05 12:00 | 3.8M | |
| 2010_gdb.pdf | 2014-09-11 12:00 | 1.9M | |
| 2010_cours_crypto.pdf | 2009-12-21 12:00 | 17M | |
| 2010_a_course_in_crypto.pdf | 2015-03-22 12:00 | 1.7M | |
| 2010_ROP.pdf | 2014-09-11 12:00 | 209K | |
| 2009_debugging_buffer_overruns_freebsd_kernel.pdf | 2014-10-05 12:00 | 339K | |
| 2008_Return_Oriented_Programming.pdf | 2014-10-08 12:00 | 4.0M | |
| 2007_introduction_to_modern_cryptography.pdf | 2014-01-29 12:00 | 5.6M | |
| 2006_ec_attack_discret_logarithm.pdf | 2016-11-20 12:00 | 588K | |
| 2004_sac_A4.pdf | 2009-02-03 12:00 | 207K | |
| 2004_red_hat_vuln_prevention.pdf | 2014-09-11 12:00 | 238K | |
| 2002_the_discrete_logarithm_problem.pdf | 2014-12-15 12:00 | 415K | |
| 2002_attack_pkcs_rsa.pdf | 2016-04-04 12:00 | 129K | |
| 2002_HDRThesis-US.pdf | 2009-02-03 12:00 | 1.7M | |
| 2001_refs.pdf | 2016-09-11 12:00 | 448K | |
| 2001_index.pdf | 2016-09-11 12:00 | 40K | |
| 2001_goodman_jssc.pdf | 2009-02-03 12:00 | 440K | |
| 2001_ch15.pdf | 2016-09-11 12:00 | 208K | |
| 2001_ch14.pdf | 2016-09-11 12:00 | 362K | |
| 2001_ch13.pdf | 2016-09-11 12:00 | 332K | |
| 2001_ch12.pdf | 2016-09-11 12:00 | 391K | |
| 2001_ch11.pdf | 2016-09-11 12:00 | 515K | |
| 2001_ch10.pdf | 2016-09-11 12:00 | 309K | |
| 2001_ch9.pdf | 2016-09-11 12:00 | 471K | |
| 2001_ch8.pdf | 2016-09-11 12:00 | 296K | |
| 2001_ch7.pdf | 2016-09-11 12:00 | 480K | |
| 2001_ch6.pdf | 2016-09-11 12:00 | 268K | |
| 2001_ch5.pdf | 2016-09-11 12:00 | 201K | |
| 2001_ch4.pdf | 2016-09-11 12:00 | 324K | |
| 2001_ch3.pdf | 2016-09-11 12:00 | 388K | |
| 2001_ch2.pdf | 2016-09-11 12:00 | 337K | |
| 2001_ch1.pdf | 2016-09-11 12:00 | 335K | |
| 2001_appendix.pdf | 2016-09-11 12:00 | 324K | |
| 1999_linear_differential_cryptanalysis.pdf | 2015-02-03 12:00 | 177K | |
| 1998_feal.pdf | 2015-01-06 12:00 | 281K | |
| 1995meadows-asiacrypt94.pdf | 2009-02-03 12:00 | 134K | |
| 831qsg.pdf | 2016-07-07 12:00 | 371K | |
| 802.11 wi-fi handbook, Chapter 9 Wireless Lans in the network.pdf | 2014-12-07 12:00 | 393K | |
| 802.11 Wireless Networks- The Definitive Guide 2002.pdf | 2014-12-07 12:00 | 4.0M | |
| 802.11 Security 2002.pdf | 2014-12-07 12:00 | 911K | |
| 800upgrd.pdf | 2016-07-07 12:00 | 416K | |
| 800series_routersA.pdf | 2016-07-07 12:00 | 149K | |
| 800series_routers.pdf | 2016-07-07 12:00 | 98K | |
| 642_502.pdf | 2016-07-07 12:00 | 2.0M | |
| 642-541qae110.pdf | 2016-07-07 12:00 | 1.7M | |
| 642-531qae220.pdf | 2016-07-07 12:00 | 3.0M | |
| 642-522 Cisco Press SNPA 40 Student Guide .pdf | 2016-07-07 12:00 | 9.4M | |
| 642-511qae230S.pdf | 2016-07-07 12:00 | 2.4M | |
| 642-511qae230NP.pdf | 2016-07-07 12:00 | 2.4M | |
| 642-511qae230.pdf | 2016-07-07 12:00 | 2.4M | |
| 642-501.pdf | 2016-07-07 12:00 | 872K | |
| 640-801 v63-1.pdf | 2016-07-07 12:00 | 11M | |
| 350-001_444_.pdf | 2016-07-07 12:00 | 5.6M | |
| 199.pdf | 2009-02-03 12:00 | 56K | |
| 148.pdf | 2009-02-03 12:00 | 245K | |
| 147.pdf | 2009-02-03 12:00 | 314K | |
| 144.pdf | 2009-02-03 12:00 | 81K | |
| 126.pdf | 2009-02-03 12:00 | 337K | |
| 63config.pdf | 2016-04-09 12:00 | 4.9M | |
| 63cmdref.pdf | 2016-04-09 12:00 | 4.6M | |
| 28hwinst.pdf | 2016-07-07 12:00 | 13M | |
| 24_Konoth.pdf | 2016-07-07 12:00 | 366K | |
| 9E0-421 Cisco - IP Telephony Troubleshooting (IPTT).pdf | 2016-07-07 12:00 | 286K | |
| 8xxConfig.pdf | 2016-07-07 12:00 | 2.8M | |
| 4portEthernetcard3845.pdf | 2016-07-07 12:00 | 100K | |
| 4.pdf | 2009-02-03 12:00 | 466K | |
| 3-Metasploit 2004.pdf | 2018-01-07 12:00 | 201K | |
| 2_Cisco Press - CIPT - IP Telephony Coursebook-v2.0.pdf | 2016-07-07 12:00 | 7.1M | |
| 2-Metasploit 2004.pdf | 2018-01-07 12:00 | 428K | |
| 1-Metasploit 2004.pdf | 2018-01-07 12:00 | 186K | |
| 08 - Advanced Security Services - IOS FW Feature Set.pdf | 2016-07-07 12:00 | 3.8M | |
| 0764541889.pdf | 2009-02-03 12:00 | 241K | |
| 075.pdf | 2009-02-03 12:00 | 127K | |
| 07 - Advanced Security Services - IPSEC.pdf | 2016-07-07 12:00 | 9.2M | |
| 061.pdf | 2009-02-03 12:00 | 70K | |
| 06 - Deploying Basic Security Services.pdf | 2016-07-07 12:00 | 5.2M | |
| 0501038.pdf | 2009-02-03 12:00 | 105K | |
| 03 - Managing Routing Protocols.pdf | 2016-07-07 12:00 | 6.5M | |
| 02 - Deploying Interior Routing Protocols.pdf | 2016-07-07 12:00 | 3.3M | |
| 013-jgl.pdf | 2009-02-03 12:00 | 272K | |
| 01 - Managing Your IP Address Space.pdf | 2016-07-07 12:00 | 4.4M | |
| 007.pdf | 2009-02-03 12:00 | 143K | |
| 00-cnam-cryptographie.pdf | 2009-02-03 12:00 | 199K | |
| (more) Advanced SQL Injection.pdf | 2016-07-07 12:00 | 190K | |
| (ebook) Rocket Piano - Learn Piano Today..pdf | 2015-09-04 12:00 | 6.0K | |
| (eBook - hack) (FR)Piratage, Hackers Linux & Windows.pdf | 2016-07-07 12:00 | 3.7M | |
| (eBook - PDF) Hugo Cornwall - The Hacker's Handbook .pdf | 2014-12-07 12:00 | 278K | |
| (eBook) Securing and Optimizing Linux - Redhat Edition.pdf | 2015-09-04 12:00 | 4.9M | |
| (Ebook - Computer) Hacking The Windows Registry.pdf | 2014-12-07 12:00 | 222K | |
| (Ebook) Squid Proxy Server.pdf | 2015-09-04 12:00 | 198K | |
| (Ebook) Linux - Unix System Administration Handbook (Prentice Hall).pdf | 2015-09-04 12:00 | 302K | |
| (E-Book) - secrets of lockpicking.pdf | 2016-07-07 12:00 | 156K | |
| (2010) [Cisco Press] CCIE Security v3.0 Configuration Practice Labs, 2nd Edition.pdf | 2016-07-07 12:00 | 6.3M | |
|
|---|